mirror of
https://github.com/varun-r-mallya/py-libp2p.git
synced 2026-03-23 21:51:28 +00:00
Compare commits
1 Commits
399a52bc54
...
concurrenc
| Author | SHA1 | Date | |
|---|---|---|---|
| 8b2268fcc9 |
@ -1,64 +0,0 @@
|
||||
mDNS Peer Discovery Example
|
||||
===========================
|
||||
|
||||
This example demonstrates how to use mDNS (Multicast DNS) for peer discovery in py-libp2p.
|
||||
|
||||
Prerequisites
|
||||
-------------
|
||||
|
||||
First, ensure you have py-libp2p installed and your environment is activated:
|
||||
|
||||
.. code-block:: console
|
||||
|
||||
$ python -m pip install libp2p
|
||||
|
||||
Running the Example
|
||||
-------------------
|
||||
|
||||
The mDNS demo script allows you to discover peers on your local network using mDNS. To start a peer, run:
|
||||
|
||||
.. code-block:: console
|
||||
|
||||
$ mdns-demo
|
||||
|
||||
You should see output similar to:
|
||||
|
||||
.. code-block:: console
|
||||
|
||||
Run this from another console to start another peer on a different port:
|
||||
|
||||
python mdns-demo -p <ANOTHER_PORT>
|
||||
|
||||
Waiting for mDNS peer discovery events...
|
||||
|
||||
2025-06-20 23:28:12,052 - libp2p.example.discovery.mdns - INFO - Starting peer Discovery
|
||||
|
||||
To discover peers, open another terminal and run the same command with a different port:
|
||||
|
||||
.. code-block:: console
|
||||
|
||||
$ python mdns-demo -p 9001
|
||||
|
||||
You should see output indicating that a new peer has been discovered:
|
||||
|
||||
.. code-block:: console
|
||||
|
||||
Run this from the same folder in another console to start another peer on a different port:
|
||||
|
||||
python mdns-demo -p <ANOTHER_PORT>
|
||||
|
||||
Waiting for mDNS peer discovery events...
|
||||
|
||||
2025-06-20 23:43:43,786 - libp2p.example.discovery.mdns - INFO - Starting peer Discovery
|
||||
2025-06-20 23:43:43,790 - libp2p.example.discovery.mdns - INFO - Discovered: 16Uiu2HAmGxy5NdQEjZWtrYUMrzdp3Syvg7MB2E5Lx8weA9DanYxj
|
||||
|
||||
When a new peer is discovered, its peer ID will be printed in the console output.
|
||||
|
||||
How it Works
|
||||
------------
|
||||
|
||||
- Each node advertises itself on the local network using mDNS.
|
||||
- When a new peer is discovered, the handler prints its peer ID.
|
||||
- This is useful for local peer discovery without requiring a DHT or bootstrap nodes.
|
||||
|
||||
You can modify the script to perform additional actions when peers are discovered, such as opening streams or exchanging messages.
|
||||
@ -13,4 +13,3 @@ Examples
|
||||
examples.pubsub
|
||||
examples.circuit_relay
|
||||
examples.kademlia
|
||||
examples.mDNS
|
||||
|
||||
@ -1,21 +0,0 @@
|
||||
libp2p.discovery.events package
|
||||
===============================
|
||||
|
||||
Submodules
|
||||
----------
|
||||
|
||||
libp2p.discovery.events.peerDiscovery module
|
||||
--------------------------------------------
|
||||
|
||||
.. automodule:: libp2p.discovery.events.peerDiscovery
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
|
||||
Module contents
|
||||
---------------
|
||||
|
||||
.. automodule:: libp2p.discovery.events
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
@ -1,45 +0,0 @@
|
||||
libp2p.discovery.mdns package
|
||||
=============================
|
||||
|
||||
Submodules
|
||||
----------
|
||||
|
||||
libp2p.discovery.mdns.broadcaster module
|
||||
----------------------------------------
|
||||
|
||||
.. automodule:: libp2p.discovery.mdns.broadcaster
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
|
||||
libp2p.discovery.mdns.listener module
|
||||
-------------------------------------
|
||||
|
||||
.. automodule:: libp2p.discovery.mdns.listener
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
|
||||
libp2p.discovery.mdns.mdns module
|
||||
---------------------------------
|
||||
|
||||
.. automodule:: libp2p.discovery.mdns.mdns
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
|
||||
libp2p.discovery.mdns.utils module
|
||||
----------------------------------
|
||||
|
||||
.. automodule:: libp2p.discovery.mdns.utils
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
|
||||
Module contents
|
||||
---------------
|
||||
|
||||
.. automodule:: libp2p.discovery.mdns
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
@ -1,22 +0,0 @@
|
||||
libp2p.discovery package
|
||||
========================
|
||||
|
||||
Subpackages
|
||||
-----------
|
||||
|
||||
.. toctree::
|
||||
:maxdepth: 4
|
||||
|
||||
libp2p.discovery.events
|
||||
libp2p.discovery.mdns
|
||||
|
||||
Submodules
|
||||
----------
|
||||
|
||||
Module contents
|
||||
---------------
|
||||
|
||||
.. automodule:: libp2p.discovery
|
||||
:members:
|
||||
:undoc-members:
|
||||
:show-inheritance:
|
||||
@ -8,7 +8,6 @@ Subpackages
|
||||
:maxdepth: 4
|
||||
|
||||
libp2p.crypto
|
||||
libp2p.discovery
|
||||
libp2p.host
|
||||
libp2p.identity
|
||||
libp2p.io
|
||||
|
||||
@ -3,65 +3,6 @@ Release Notes
|
||||
|
||||
.. towncrier release notes start
|
||||
|
||||
py-libp2p v0.2.9 (2025-07-09)
|
||||
-----------------------------
|
||||
|
||||
Breaking Changes
|
||||
~~~~~~~~~~~~~~~~
|
||||
|
||||
- Reordered the arguments to ``upgrade_security`` to place ``is_initiator`` before ``peer_id``, and made ``peer_id`` optional.
|
||||
This allows the method to reflect the fact that peer identity is not required for inbound connections. (`#681 <https://github.com/libp2p/py-libp2p/issues/681>`__)
|
||||
|
||||
|
||||
Bugfixes
|
||||
~~~~~~~~
|
||||
|
||||
- Add timeout wrappers in:
|
||||
1. ``multiselect.py``: ``negotiate`` function
|
||||
2. ``multiselect_client.py``: ``select_one_of`` , ``query_multistream_command`` functions
|
||||
to prevent indefinite hangs when a remote peer does not respond. (`#696 <https://github.com/libp2p/py-libp2p/issues/696>`__)
|
||||
- Align stream creation logic with yamux specification (`#701 <https://github.com/libp2p/py-libp2p/issues/701>`__)
|
||||
- Fixed an issue in ``Pubsub`` where async validators were not handled reliably under concurrency. Now uses a safe aggregator list for consistent behavior. (`#702 <https://github.com/libp2p/py-libp2p/issues/702>`__)
|
||||
|
||||
|
||||
Features
|
||||
~~~~~~~~
|
||||
|
||||
- Added support for ``Kademlia DHT`` in py-libp2p. (`#579 <https://github.com/libp2p/py-libp2p/issues/579>`__)
|
||||
- Limit concurrency in ``push_identify_to_peers`` to prevent resource congestion under high peer counts. (`#621 <https://github.com/libp2p/py-libp2p/issues/621>`__)
|
||||
- Store public key and peer ID in peerstore during handshake
|
||||
|
||||
Modified the InsecureTransport class to accept an optional peerstore parameter and updated the handshake process to store the received public key and peer ID in the peerstore when available.
|
||||
|
||||
Added test cases to verify:
|
||||
1. The peerstore remains unchanged when handshake fails due to peer ID mismatch
|
||||
2. The handshake correctly adds a public key to a peer ID that already exists in the peerstore but doesn't have a public key yet (`#631 <https://github.com/libp2p/py-libp2p/issues/631>`__)
|
||||
- Fixed several flow-control and concurrency issues in the ``YamuxStream`` class. Previously, stress-testing revealed that transferring data over ``DEFAULT_WINDOW_SIZE`` would break the stream due to inconsistent window update handling and lock management. The fixes include:
|
||||
|
||||
- Removed sending of window updates during writes to maintain correct flow-control.
|
||||
- Added proper timeout handling when releasing and acquiring locks to prevent concurrency errors.
|
||||
- Corrected the ``read`` function to properly handle window updates for both ``read_until_EOF`` and ``read_n_bytes``.
|
||||
- Added event logging at ``send_window_updates`` and ``waiting_for_window_updates`` for better observability. (`#639 <https://github.com/libp2p/py-libp2p/issues/639>`__)
|
||||
- Added support for ``Multicast DNS`` in py-libp2p (`#649 <https://github.com/libp2p/py-libp2p/issues/649>`__)
|
||||
- Optimized pubsub publishing to send multiple topics in a single message instead of separate messages per topic. (`#685 <https://github.com/libp2p/py-libp2p/issues/685>`__)
|
||||
- Optimized pubsub message writing by implementing a write_msg() method that uses pre-allocated buffers and single write operations, improving performance by eliminating separate varint prefix encoding and write operations in FloodSub and GossipSub. (`#687 <https://github.com/libp2p/py-libp2p/issues/687>`__)
|
||||
- Added peer exchange and backoff logic as part of Gossipsub v1.1 upgrade (`#690 <https://github.com/libp2p/py-libp2p/issues/690>`__)
|
||||
|
||||
|
||||
Internal Changes - for py-libp2p Contributors
|
||||
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
|
||||
|
||||
- Added sparse connect utility function to pubsub test utilities for creating test networks with configurable connectivity. (`#679 <https://github.com/libp2p/py-libp2p/issues/679>`__)
|
||||
- Added comprehensive tests for pubsub connection utility functions to verify degree limits are enforced, excess peers are handled correctly, and edge cases (degree=0, negative values, empty lists) are managed gracefully. (`#707 <https://github.com/libp2p/py-libp2p/issues/707>`__)
|
||||
- Added extra tests for identify push concurrency cap under high peer load (`#708 <https://github.com/libp2p/py-libp2p/issues/708>`__)
|
||||
|
||||
|
||||
Miscellaneous Changes
|
||||
~~~~~~~~~~~~~~~~~~~~~
|
||||
|
||||
- `#678 <https://github.com/libp2p/py-libp2p/issues/678>`__, `#684 <https://github.com/libp2p/py-libp2p/issues/684>`__
|
||||
|
||||
|
||||
py-libp2p v0.2.8 (2025-06-10)
|
||||
-----------------------------
|
||||
|
||||
|
||||
@ -8,10 +8,9 @@ import trio
|
||||
from libp2p import (
|
||||
new_host,
|
||||
)
|
||||
from libp2p.identity.identify.identify import (
|
||||
ID as IDENTIFY_PROTOCOL_ID,
|
||||
identify_handler_for,
|
||||
parse_identify_response,
|
||||
from libp2p.identity.identify.identify import ID as IDENTIFY_PROTOCOL_ID
|
||||
from libp2p.identity.identify.pb.identify_pb2 import (
|
||||
Identify,
|
||||
)
|
||||
from libp2p.peer.peerinfo import (
|
||||
info_from_p2p_addr,
|
||||
@ -51,7 +50,7 @@ def print_identify_response(identify_response):
|
||||
)
|
||||
|
||||
|
||||
async def run(port: int, destination: str, use_varint_format: bool = True) -> None:
|
||||
async def run(port: int, destination: str) -> None:
|
||||
localhost_ip = "0.0.0.0"
|
||||
|
||||
if not destination:
|
||||
@ -59,24 +58,11 @@ async def run(port: int, destination: str, use_varint_format: bool = True) -> No
|
||||
listen_addr = multiaddr.Multiaddr(f"/ip4/{localhost_ip}/tcp/{port}")
|
||||
host_a = new_host()
|
||||
|
||||
# Set up identify handler with specified format
|
||||
identify_handler = identify_handler_for(
|
||||
host_a, use_varint_format=use_varint_format
|
||||
)
|
||||
host_a.set_stream_handler(IDENTIFY_PROTOCOL_ID, identify_handler)
|
||||
|
||||
async with host_a.run(listen_addrs=[listen_addr]):
|
||||
# Get the actual address and replace 0.0.0.0 with 127.0.0.1 for client
|
||||
# connections
|
||||
server_addr = str(host_a.get_addrs()[0])
|
||||
client_addr = server_addr.replace("/ip4/0.0.0.0/", "/ip4/127.0.0.1/")
|
||||
|
||||
format_name = "length-prefixed" if use_varint_format else "raw protobuf"
|
||||
print(
|
||||
f"First host listening (using {format_name} format). "
|
||||
f"Run this from another console:\n\n"
|
||||
"First host listening. Run this from another console:\n\n"
|
||||
f"identify-demo "
|
||||
f"-d {client_addr}\n"
|
||||
f"-d {host_a.get_addrs()[0]}\n"
|
||||
)
|
||||
print("Waiting for incoming identify request...")
|
||||
await trio.sleep_forever()
|
||||
@ -98,18 +84,11 @@ async def run(port: int, destination: str, use_varint_format: bool = True) -> No
|
||||
|
||||
try:
|
||||
print("Starting identify protocol...")
|
||||
|
||||
# Read the complete response (could be either format)
|
||||
# Read a larger chunk to get all the data before stream closes
|
||||
response = await stream.read(8192) # Read enough data in one go
|
||||
|
||||
response = await stream.read()
|
||||
await stream.close()
|
||||
|
||||
# Parse the response using the robust protocol-level function
|
||||
# This handles both old and new formats automatically
|
||||
identify_msg = parse_identify_response(response)
|
||||
identify_msg = Identify()
|
||||
identify_msg.ParseFromString(response)
|
||||
print_identify_response(identify_msg)
|
||||
|
||||
except Exception as e:
|
||||
print(f"Identify protocol error: {e}")
|
||||
|
||||
@ -119,12 +98,9 @@ async def run(port: int, destination: str, use_varint_format: bool = True) -> No
|
||||
def main() -> None:
|
||||
description = """
|
||||
This program demonstrates the libp2p identify protocol.
|
||||
First run 'identify-demo -p <PORT> [--raw-format]' to start a listener.
|
||||
First run identify-demo -p <PORT>' to start a listener.
|
||||
Then run 'identify-demo <ANOTHER_PORT> -d <DESTINATION>'
|
||||
where <DESTINATION> is the multiaddress shown by the listener.
|
||||
|
||||
Use --raw-format to send raw protobuf messages (old format) instead of
|
||||
length-prefixed protobuf messages (new format, default).
|
||||
"""
|
||||
|
||||
example_maddr = (
|
||||
@ -139,22 +115,10 @@ def main() -> None:
|
||||
type=str,
|
||||
help=f"destination multiaddr string, e.g. {example_maddr}",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--raw-format",
|
||||
action="store_true",
|
||||
help=(
|
||||
"use raw protobuf format (old format) instead of "
|
||||
"length-prefixed (new format)"
|
||||
),
|
||||
)
|
||||
args = parser.parse_args()
|
||||
|
||||
# Determine format: raw format if --raw-format is specified, otherwise
|
||||
# length-prefixed
|
||||
use_varint_format = not args.raw_format
|
||||
|
||||
try:
|
||||
trio.run(run, *(args.port, args.destination, use_varint_format))
|
||||
trio.run(run, *(args.port, args.destination))
|
||||
except KeyboardInterrupt:
|
||||
pass
|
||||
|
||||
|
||||
@ -57,56 +57,18 @@ from libp2p.peer.peerinfo import (
|
||||
logger = logging.getLogger("libp2p.identity.identify-push-example")
|
||||
|
||||
|
||||
def custom_identify_push_handler_for(host, use_varint_format: bool = True):
|
||||
def custom_identify_push_handler_for(host):
|
||||
"""
|
||||
Create a custom handler for the identify/push protocol that logs and prints
|
||||
the identity information received from the dialer.
|
||||
|
||||
Args:
|
||||
host: The libp2p host
|
||||
use_varint_format: If True, expect length-prefixed format; if False, expect
|
||||
raw protobuf
|
||||
|
||||
"""
|
||||
|
||||
async def handle_identify_push(stream: INetStream) -> None:
|
||||
peer_id = stream.muxed_conn.peer_id
|
||||
|
||||
try:
|
||||
if use_varint_format:
|
||||
# Read length-prefixed identify message from the stream
|
||||
from libp2p.utils.varint import decode_varint_from_bytes
|
||||
|
||||
# First read the varint length prefix
|
||||
length_bytes = b""
|
||||
while True:
|
||||
b = await stream.read(1)
|
||||
if not b:
|
||||
break
|
||||
length_bytes += b
|
||||
if b[0] & 0x80 == 0:
|
||||
break
|
||||
|
||||
if not length_bytes:
|
||||
logger.warning("No length prefix received from peer %s", peer_id)
|
||||
return
|
||||
|
||||
msg_length = decode_varint_from_bytes(length_bytes)
|
||||
|
||||
# Read the protobuf message
|
||||
data = await stream.read(msg_length)
|
||||
if len(data) != msg_length:
|
||||
logger.warning("Incomplete message received from peer %s", peer_id)
|
||||
return
|
||||
else:
|
||||
# Read raw protobuf message from the stream
|
||||
data = b""
|
||||
while True:
|
||||
chunk = await stream.read(4096)
|
||||
if not chunk:
|
||||
break
|
||||
data += chunk
|
||||
|
||||
# Read the identify message from the stream
|
||||
data = await stream.read()
|
||||
identify_msg = Identify()
|
||||
identify_msg.ParseFromString(data)
|
||||
|
||||
@ -167,13 +129,9 @@ def custom_identify_push_handler_for(host, use_varint_format: bool = True):
|
||||
return handle_identify_push
|
||||
|
||||
|
||||
async def run_listener(port: int, use_varint_format: bool = True) -> None:
|
||||
async def run_listener(port: int) -> None:
|
||||
"""Run a host in listener mode."""
|
||||
format_name = "length-prefixed" if use_varint_format else "raw protobuf"
|
||||
print(
|
||||
f"\n==== Starting Identify-Push Listener on port {port} "
|
||||
f"(using {format_name} format) ====\n"
|
||||
)
|
||||
print(f"\n==== Starting Identify-Push Listener on port {port} ====\n")
|
||||
|
||||
# Create key pair for the listener
|
||||
key_pair = create_new_key_pair()
|
||||
@ -181,14 +139,9 @@ async def run_listener(port: int, use_varint_format: bool = True) -> None:
|
||||
# Create the listener host
|
||||
host = new_host(key_pair=key_pair)
|
||||
|
||||
# Set up the identify and identify/push handlers with specified format
|
||||
host.set_stream_handler(
|
||||
ID_IDENTIFY, identify_handler_for(host, use_varint_format=use_varint_format)
|
||||
)
|
||||
host.set_stream_handler(
|
||||
ID_IDENTIFY_PUSH,
|
||||
identify_push_handler_for(host, use_varint_format=use_varint_format),
|
||||
)
|
||||
# Set up the identify and identify/push handlers
|
||||
host.set_stream_handler(ID_IDENTIFY, identify_handler_for(host))
|
||||
host.set_stream_handler(ID_IDENTIFY_PUSH, custom_identify_push_handler_for(host))
|
||||
|
||||
# Start listening
|
||||
listen_addr = multiaddr.Multiaddr(f"/ip4/0.0.0.0/tcp/{port}")
|
||||
@ -212,15 +165,9 @@ async def run_listener(port: int, use_varint_format: bool = True) -> None:
|
||||
await trio.sleep_forever()
|
||||
|
||||
|
||||
async def run_dialer(
|
||||
port: int, destination: str, use_varint_format: bool = True
|
||||
) -> None:
|
||||
async def run_dialer(port: int, destination: str) -> None:
|
||||
"""Run a host in dialer mode that connects to a listener."""
|
||||
format_name = "length-prefixed" if use_varint_format else "raw protobuf"
|
||||
print(
|
||||
f"\n==== Starting Identify-Push Dialer on port {port} "
|
||||
f"(using {format_name} format) ====\n"
|
||||
)
|
||||
print(f"\n==== Starting Identify-Push Dialer on port {port} ====\n")
|
||||
|
||||
# Create key pair for the dialer
|
||||
key_pair = create_new_key_pair()
|
||||
@ -228,14 +175,9 @@ async def run_dialer(
|
||||
# Create the dialer host
|
||||
host = new_host(key_pair=key_pair)
|
||||
|
||||
# Set up the identify and identify/push handlers with specified format
|
||||
host.set_stream_handler(
|
||||
ID_IDENTIFY, identify_handler_for(host, use_varint_format=use_varint_format)
|
||||
)
|
||||
host.set_stream_handler(
|
||||
ID_IDENTIFY_PUSH,
|
||||
identify_push_handler_for(host, use_varint_format=use_varint_format),
|
||||
)
|
||||
# Set up the identify and identify/push handlers
|
||||
host.set_stream_handler(ID_IDENTIFY, identify_handler_for(host))
|
||||
host.set_stream_handler(ID_IDENTIFY_PUSH, identify_push_handler_for(host))
|
||||
|
||||
# Start listening on a different port
|
||||
listen_addr = multiaddr.Multiaddr(f"/ip4/0.0.0.0/tcp/{port}")
|
||||
@ -264,9 +206,7 @@ async def run_dialer(
|
||||
|
||||
try:
|
||||
# Call push_identify_to_peer which returns a boolean
|
||||
success = await push_identify_to_peer(
|
||||
host, peer_info.peer_id, use_varint_format=use_varint_format
|
||||
)
|
||||
success = await push_identify_to_peer(host, peer_info.peer_id)
|
||||
|
||||
if success:
|
||||
logger.info("Identify push completed successfully!")
|
||||
@ -300,40 +240,29 @@ def main() -> None:
|
||||
This program demonstrates the libp2p identify/push protocol.
|
||||
Without arguments, it runs as a listener on random port.
|
||||
With -d parameter, it runs as a dialer on random port.
|
||||
|
||||
Use --raw-format to send raw protobuf messages (old format) instead of
|
||||
length-prefixed protobuf messages (new format, default).
|
||||
"""
|
||||
|
||||
example = (
|
||||
"/ip4/127.0.0.1/tcp/8000/p2p/QmQn4SwGkDZKkUEpBRBvTmheQycxAHJUNmVEnjA2v1qe8Q"
|
||||
)
|
||||
|
||||
parser = argparse.ArgumentParser(description=description)
|
||||
parser.add_argument("-p", "--port", default=0, type=int, help="source port number")
|
||||
parser.add_argument(
|
||||
"-d",
|
||||
"--destination",
|
||||
type=str,
|
||||
help="destination multiaddr string",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--raw-format",
|
||||
action="store_true",
|
||||
help=(
|
||||
"use raw protobuf format (old format) instead of "
|
||||
"length-prefixed (new format)"
|
||||
),
|
||||
help=f"destination multiaddr string, e.g. {example}",
|
||||
)
|
||||
args = parser.parse_args()
|
||||
|
||||
# Determine format: raw format if --raw-format is specified, otherwise
|
||||
# length-prefixed
|
||||
use_varint_format = not args.raw_format
|
||||
|
||||
try:
|
||||
if args.destination:
|
||||
# Run in dialer mode with random available port if not specified
|
||||
trio.run(run_dialer, args.port, args.destination, use_varint_format)
|
||||
trio.run(run_dialer, args.port, args.destination)
|
||||
else:
|
||||
# Run in listener mode with random available port if not specified
|
||||
trio.run(run_listener, args.port, use_varint_format)
|
||||
trio.run(run_listener, args.port)
|
||||
except KeyboardInterrupt:
|
||||
print("\nInterrupted by user")
|
||||
logger.info("Interrupted by user")
|
||||
|
||||
@ -1,74 +0,0 @@
|
||||
import argparse
|
||||
import logging
|
||||
import secrets
|
||||
|
||||
import multiaddr
|
||||
import trio
|
||||
|
||||
from libp2p import (
|
||||
new_host,
|
||||
)
|
||||
from libp2p.abc import PeerInfo
|
||||
from libp2p.crypto.secp256k1 import (
|
||||
create_new_key_pair,
|
||||
)
|
||||
from libp2p.discovery.events.peerDiscovery import peerDiscovery
|
||||
|
||||
logger = logging.getLogger("libp2p.discovery.mdns")
|
||||
logger.setLevel(logging.INFO)
|
||||
handler = logging.StreamHandler()
|
||||
handler.setFormatter(
|
||||
logging.Formatter("%(asctime)s - %(name)s - %(levelname)s - %(message)s")
|
||||
)
|
||||
logger.addHandler(handler)
|
||||
|
||||
# Set root logger to DEBUG to capture all logs from dependencies
|
||||
logging.getLogger().setLevel(logging.DEBUG)
|
||||
|
||||
|
||||
def onPeerDiscovery(peerinfo: PeerInfo):
|
||||
logger.info(f"Discovered: {peerinfo.peer_id}")
|
||||
|
||||
|
||||
async def run(port: int) -> None:
|
||||
secret = secrets.token_bytes(32)
|
||||
key_pair = create_new_key_pair(secret)
|
||||
listen_addr = multiaddr.Multiaddr(f"/ip4/0.0.0.0/tcp/{port}")
|
||||
|
||||
peerDiscovery.register_peer_discovered_handler(onPeerDiscovery)
|
||||
|
||||
print(
|
||||
"Run this from the same folder in another console to "
|
||||
"start another peer on a different port:\n\n"
|
||||
"mdns-demo -p <ANOTHER_PORT>\n"
|
||||
)
|
||||
print("Waiting for mDNS peer discovery events...\n")
|
||||
|
||||
logger.info("Starting peer Discovery")
|
||||
host = new_host(key_pair=key_pair, enable_mDNS=True)
|
||||
async with host.run(listen_addrs=[listen_addr]):
|
||||
await trio.sleep_forever()
|
||||
|
||||
|
||||
def main() -> None:
|
||||
description = """
|
||||
This program demonstrates mDNS peer discovery using libp2p.
|
||||
To use it, run 'mdns-demo -p <PORT>', where <PORT> is the port number.
|
||||
Start multiple peers on different ports to see discovery in action.
|
||||
"""
|
||||
parser = argparse.ArgumentParser(description=description)
|
||||
parser.add_argument("-p", "--port", default=0, type=int, help="source port number")
|
||||
parser.add_argument(
|
||||
"-v", "--verbose", action="store_true", help="Enable verbose output"
|
||||
)
|
||||
args = parser.parse_args()
|
||||
if args.verbose:
|
||||
logger.setLevel(logging.DEBUG)
|
||||
try:
|
||||
trio.run(run, args.port)
|
||||
except KeyboardInterrupt:
|
||||
logger.info("Exiting...")
|
||||
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
||||
@ -32,9 +32,6 @@ from libp2p.custom_types import (
|
||||
TProtocol,
|
||||
TSecurityOptions,
|
||||
)
|
||||
from libp2p.discovery.mdns.mdns import (
|
||||
MDNSDiscovery,
|
||||
)
|
||||
from libp2p.host.basic_host import (
|
||||
BasicHost,
|
||||
)
|
||||
@ -84,8 +81,6 @@ DEFAULT_MUXER = "YAMUX"
|
||||
# Multiplexer options
|
||||
MUXER_YAMUX = "YAMUX"
|
||||
MUXER_MPLEX = "MPLEX"
|
||||
DEFAULT_NEGOTIATE_TIMEOUT = 5
|
||||
|
||||
|
||||
|
||||
def set_default_muxer(muxer_name: Literal["YAMUX", "MPLEX"]) -> None:
|
||||
@ -250,8 +245,6 @@ def new_host(
|
||||
disc_opt: IPeerRouting | None = None,
|
||||
muxer_preference: Literal["YAMUX", "MPLEX"] | None = None,
|
||||
listen_addrs: Sequence[multiaddr.Multiaddr] | None = None,
|
||||
enable_mDNS: bool = False,
|
||||
negotiate_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
) -> IHost:
|
||||
"""
|
||||
Create a new libp2p host based on the given parameters.
|
||||
@ -263,7 +256,6 @@ def new_host(
|
||||
:param disc_opt: optional discovery
|
||||
:param muxer_preference: optional explicit muxer preference
|
||||
:param listen_addrs: optional list of multiaddrs to listen on
|
||||
:param enable_mDNS: whether to enable mDNS discovery
|
||||
:return: return a host instance
|
||||
"""
|
||||
swarm = new_swarm(
|
||||
@ -276,7 +268,8 @@ def new_host(
|
||||
)
|
||||
|
||||
if disc_opt is not None:
|
||||
return RoutedHost(swarm, disc_opt, enable_mDNS)
|
||||
return BasicHost(network=swarm,enable_mDNS=enable_mDNS , negotitate_timeout=negotiate_timeout)
|
||||
return RoutedHost(swarm, disc_opt)
|
||||
return BasicHost(swarm)
|
||||
|
||||
|
||||
__version__ = __version("libp2p")
|
||||
|
||||
764
libp2p/abc.py
764
libp2p/abc.py
@ -50,11 +50,6 @@ if TYPE_CHECKING:
|
||||
Pubsub,
|
||||
)
|
||||
|
||||
from typing import TYPE_CHECKING
|
||||
|
||||
if TYPE_CHECKING:
|
||||
from libp2p.protocol_muxer.multiselect import Multiselect
|
||||
|
||||
from libp2p.pubsub.pb import (
|
||||
rpc_pb2,
|
||||
)
|
||||
@ -390,18 +385,6 @@ class IPeerMetadata(ABC):
|
||||
:raises Exception: If the operation is unsuccessful.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metadata(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Remove all stored metadata for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose metadata are to be removed.
|
||||
|
||||
"""
|
||||
|
||||
|
||||
# -------------------------- addrbook interface.py --------------------------
|
||||
|
||||
@ -493,272 +476,10 @@ class IAddrBook(ABC):
|
||||
"""
|
||||
|
||||
|
||||
# -------------------------- keybook interface.py --------------------------
|
||||
|
||||
|
||||
class IKeyBook(ABC):
|
||||
"""
|
||||
Interface for an key book.
|
||||
|
||||
Provides methods for managing cryptographic keys.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def pubkey(self, peer_id: ID) -> PublicKey:
|
||||
"""
|
||||
Returns the public key of the specified peer
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose public key is to be returned.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def privkey(self, peer_id: ID) -> PrivateKey:
|
||||
"""
|
||||
Returns the private key of the specified peer
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose private key is to be returned.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_pubkey(self, peer_id: ID, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
Adds the public key for a specified peer
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose public key is to be added
|
||||
pubkey: PublicKey
|
||||
The public key of the peer
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_privkey(self, peer_id: ID, privkey: PrivateKey) -> None:
|
||||
"""
|
||||
Adds the private key for a specified peer
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose private key is to be added
|
||||
privkey: PrivateKey
|
||||
The private key of the peer
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_key_pair(self, peer_id: ID, key_pair: KeyPair) -> None:
|
||||
"""
|
||||
Adds the key pair for a specified peer
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose key pair is to be added
|
||||
key_pair: KeyPair
|
||||
The key pair of the peer
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def peer_with_keys(self) -> list[ID]:
|
||||
"""Returns all the peer IDs stored in the AddrBook"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_keydata(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Remove all stored keydata for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose keys are to be removed.
|
||||
|
||||
"""
|
||||
|
||||
|
||||
# -------------------------- metrics interface.py --------------------------
|
||||
|
||||
|
||||
class IMetrics(ABC):
|
||||
"""
|
||||
Interface for metrics of peer interaction.
|
||||
|
||||
Provides methods for managing the metrics.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def record_latency(self, peer_id: ID, RTT: float) -> None:
|
||||
"""
|
||||
Records a new round-trip time (RTT) latency value for the specified peer
|
||||
using Exponentially Weighted Moving Average (EWMA).
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer for which latency is being recorded.
|
||||
|
||||
RTT : float
|
||||
The round-trip time latency value to record.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def latency_EWMA(self, peer_id: ID) -> float:
|
||||
"""
|
||||
Returns the current latency value for the specified peer using
|
||||
Exponentially Weighted Moving Average (EWMA).
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose latency EWMA is to be returned.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metrics(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Clears the stored latency metrics for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose latency metrics are to be cleared.
|
||||
|
||||
"""
|
||||
|
||||
|
||||
# -------------------------- protobook interface.py --------------------------
|
||||
|
||||
|
||||
class IProtoBook(ABC):
|
||||
"""
|
||||
Interface for a protocol book.
|
||||
|
||||
Provides methods for managing the list of supported protocols.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def get_protocols(self, peer_id: ID) -> list[str]:
|
||||
"""
|
||||
Returns the list of protocols associated with the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose supported protocols are to be returned.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Adds the given protocols to the specified peer's protocol list.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer to which protocols will be added.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to add.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def set_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Replaces the existing protocols of the specified peer with the given list.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose protocols are to be set.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to assign.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def remove_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Removes the specified protocols from the peer's protocol list.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer from which protocols will be removed.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to remove.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def supports_protocols(self, peer_id: ID, protocols: Sequence[str]) -> list[str]:
|
||||
"""
|
||||
Returns the list of protocols from the input sequence that the peer supports.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer to check for protocol support.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check against the peer's
|
||||
supported protocols.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def first_supported_protocol(self, peer_id: ID, protocols: Sequence[str]) -> str:
|
||||
"""
|
||||
Returns the first protocol from the input list that the peer supports.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer to check for supported protocols.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check.
|
||||
|
||||
Returns
|
||||
-------
|
||||
str
|
||||
The first matching protocol string, or an empty string
|
||||
if none are supported.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_protocol_data(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Clears all protocol data associated with the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose protocol data will be cleared.
|
||||
|
||||
"""
|
||||
|
||||
|
||||
# -------------------------- peerstore interface.py --------------------------
|
||||
|
||||
|
||||
class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
class IPeerStore(IAddrBook, IPeerMetadata):
|
||||
"""
|
||||
Interface for a peer store.
|
||||
|
||||
@ -766,7 +487,85 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
management, protocol handling, and key storage.
|
||||
"""
|
||||
|
||||
# -------METADATA---------
|
||||
@abstractmethod
|
||||
def peer_info(self, peer_id: ID) -> PeerInfo:
|
||||
"""
|
||||
Retrieve the peer information for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
|
||||
Returns
|
||||
-------
|
||||
PeerInfo
|
||||
The peer information object for the given peer.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def get_protocols(self, peer_id: ID) -> list[str]:
|
||||
"""
|
||||
Retrieve the protocols associated with the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
|
||||
Returns
|
||||
-------
|
||||
list[str]
|
||||
A list of protocol identifiers.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer ID is not found.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Add additional protocols for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
protocols : Sequence[str]
|
||||
The protocols to add.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def set_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Set the protocols for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
protocols : Sequence[str]
|
||||
The protocols to set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
Retrieve all peer identifiers stored in the peer store.
|
||||
|
||||
Returns
|
||||
-------
|
||||
list[ID]
|
||||
A list of all peer IDs in the store.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def get(self, peer_id: ID, key: str) -> Any:
|
||||
"""
|
||||
@ -807,19 +606,6 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metadata(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Clears the stored latency metrics for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose latency metrics are to be cleared.
|
||||
|
||||
"""
|
||||
|
||||
# --------ADDR-BOOK---------
|
||||
@abstractmethod
|
||||
def add_addr(self, peer_id: ID, addr: Multiaddr, ttl: int) -> None:
|
||||
"""
|
||||
@ -893,7 +679,25 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
|
||||
"""
|
||||
|
||||
# --------KEY-BOOK----------
|
||||
@abstractmethod
|
||||
def add_pubkey(self, peer_id: ID, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
Add a public key for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
pubkey : PublicKey
|
||||
The public key to add.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer already has a public key set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def pubkey(self, peer_id: ID) -> PublicKey:
|
||||
"""
|
||||
@ -916,6 +720,25 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_privkey(self, peer_id: ID, privkey: PrivateKey) -> None:
|
||||
"""
|
||||
Add a private key for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
privkey : PrivateKey
|
||||
The private key to add.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer already has a private key set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def privkey(self, peer_id: ID) -> PrivateKey:
|
||||
"""
|
||||
@ -938,44 +761,6 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_pubkey(self, peer_id: ID, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
Add a public key for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
pubkey : PublicKey
|
||||
The public key to add.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer already has a public key set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_privkey(self, peer_id: ID, privkey: PrivateKey) -> None:
|
||||
"""
|
||||
Add a private key for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
privkey : PrivateKey
|
||||
The private key to add.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer already has a private key set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_key_pair(self, peer_id: ID, key_pair: KeyPair) -> None:
|
||||
"""
|
||||
@ -995,213 +780,6 @@ class IPeerStore(IPeerMetadata, IAddrBook, IKeyBook, IMetrics, IProtoBook):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def peer_with_keys(self) -> list[ID]:
|
||||
"""Returns all the peer IDs stored in the AddrBook"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_keydata(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Remove all stored keydata for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The peer identifier whose keys are to be removed.
|
||||
|
||||
"""
|
||||
|
||||
# -------METRICS---------
|
||||
@abstractmethod
|
||||
def record_latency(self, peer_id: ID, RTT: float) -> None:
|
||||
"""
|
||||
Records a new round-trip time (RTT) latency value for the specified peer
|
||||
using Exponentially Weighted Moving Average (EWMA).
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer for which latency is being recorded.
|
||||
|
||||
RTT : float
|
||||
The round-trip time latency value to record.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def latency_EWMA(self, peer_id: ID) -> float:
|
||||
"""
|
||||
Returns the current latency value for the specified peer using
|
||||
Exponentially Weighted Moving Average (EWMA).
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose latency EWMA is to be returned.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metrics(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Clears the stored latency metrics for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose latency metrics are to be cleared.
|
||||
|
||||
"""
|
||||
|
||||
# --------PROTO-BOOK----------
|
||||
@abstractmethod
|
||||
def get_protocols(self, peer_id: ID) -> list[str]:
|
||||
"""
|
||||
Retrieve the protocols associated with the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
|
||||
Returns
|
||||
-------
|
||||
list[str]
|
||||
A list of protocol identifiers.
|
||||
|
||||
Raises
|
||||
------
|
||||
PeerStoreError
|
||||
If the peer ID is not found.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Add additional protocols for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
protocols : Sequence[str]
|
||||
The protocols to add.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def set_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Set the protocols for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
protocols : Sequence[str]
|
||||
The protocols to set.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def remove_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Removes the specified protocols from the peer's protocol list.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer from which protocols will be removed.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to remove.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def supports_protocols(self, peer_id: ID, protocols: Sequence[str]) -> list[str]:
|
||||
"""
|
||||
Returns the list of protocols from the input sequence that the peer supports.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer to check for protocol support.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check against the peer's
|
||||
supported protocols.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def first_supported_protocol(self, peer_id: ID, protocols: Sequence[str]) -> str:
|
||||
"""
|
||||
Returns the first protocol from the input list that the peer supports.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer to check for supported protocols.
|
||||
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check.
|
||||
|
||||
Returns
|
||||
-------
|
||||
str
|
||||
The first matching protocol string, or an empty string
|
||||
if none are supported.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_protocol_data(self, peer_id: ID) -> None:
|
||||
"""
|
||||
Clears all protocol data associated with the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer whose protocol data will be cleared.
|
||||
|
||||
"""
|
||||
|
||||
# --------PEER-STORE--------
|
||||
@abstractmethod
|
||||
def peer_info(self, peer_id: ID) -> PeerInfo:
|
||||
"""
|
||||
Retrieve the peer information for the specified peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
peer_id : ID
|
||||
The identifier of the peer.
|
||||
|
||||
Returns
|
||||
-------
|
||||
PeerInfo
|
||||
The peer information object for the given peer.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
Retrieve all peer identifiers stored in the peer store.
|
||||
|
||||
Returns
|
||||
-------
|
||||
list[ID]
|
||||
A list of all peer IDs in the store.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_peerdata(self, peer_id: ID) -> None:
|
||||
"""clear_peerdata"""
|
||||
|
||||
|
||||
# -------------------------- listener interface.py --------------------------
|
||||
|
||||
@ -1550,8 +1128,9 @@ class IHost(ABC):
|
||||
|
||||
"""
|
||||
|
||||
# FIXME: Replace with correct return type
|
||||
@abstractmethod
|
||||
def get_mux(self) -> "Multiselect":
|
||||
def get_mux(self) -> Any:
|
||||
"""
|
||||
Retrieve the muxer instance for the host.
|
||||
|
||||
@ -1736,60 +1315,6 @@ class IPeerData(ABC):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def remove_protocols(self, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
Removes the specified protocols from this peer's list of supported protocols.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to be removed.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def supports_protocols(self, protocols: Sequence[str]) -> list[str]:
|
||||
"""
|
||||
Returns the list of protocols from the input sequence that are supported
|
||||
by this peer.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check against this peer's supported
|
||||
protocols.
|
||||
|
||||
Returns
|
||||
-------
|
||||
list[str]
|
||||
A list of protocol strings that are supported.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def first_supported_protocol(self, protocols: Sequence[str]) -> str:
|
||||
"""
|
||||
Returns the first protocol from the input list that this peer supports.
|
||||
|
||||
Parameters
|
||||
----------
|
||||
protocols : Sequence[str]
|
||||
A sequence of protocol strings to check for support.
|
||||
|
||||
Returns
|
||||
-------
|
||||
str
|
||||
The first matching protocol, or an empty string if none are supported.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_protocol_data(self) -> None:
|
||||
"""
|
||||
Clears all protocol data associated with this peer.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_addrs(self, addrs: Sequence[Multiaddr]) -> None:
|
||||
"""
|
||||
@ -1799,8 +1324,6 @@ class IPeerData(ABC):
|
||||
----------
|
||||
addrs : Sequence[Multiaddr]
|
||||
A sequence of multiaddresses to add.
|
||||
ttl: inr
|
||||
Time to live for the peer record
|
||||
|
||||
"""
|
||||
|
||||
@ -1859,12 +1382,6 @@ class IPeerData(ABC):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metadata(self) -> None:
|
||||
"""
|
||||
Clears all metadata entries associated with this peer.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def add_pubkey(self, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
@ -1923,45 +1440,6 @@ class IPeerData(ABC):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_keydata(self) -> None:
|
||||
"""
|
||||
Clears all cryptographic key data associated with this peer,
|
||||
including both public and private keys.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def record_latency(self, new_latency: float) -> None:
|
||||
"""
|
||||
Records a new latency measurement using
|
||||
Exponentially Weighted Moving Average (EWMA).
|
||||
|
||||
Parameters
|
||||
----------
|
||||
new_latency : float
|
||||
The new round-trip time (RTT) latency value to incorporate
|
||||
into the EWMA calculation.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def latency_EWMA(self) -> float:
|
||||
"""
|
||||
Returns the current EWMA value of the recorded latency.
|
||||
|
||||
Returns
|
||||
-------
|
||||
float
|
||||
The current latency estimate based on EWMA.
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def clear_metrics(self) -> None:
|
||||
"""
|
||||
Clears all latency-related metrics and resets the internal state.
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def update_last_identified(self) -> None:
|
||||
"""
|
||||
@ -2162,7 +1640,6 @@ class IMultiselectMuxer(ABC):
|
||||
|
||||
"""
|
||||
|
||||
@abstractmethod
|
||||
def get_protocols(self) -> tuple[TProtocol | None, ...]:
|
||||
"""
|
||||
Retrieve the protocols for which handlers have been registered.
|
||||
@ -2173,6 +1650,7 @@ class IMultiselectMuxer(ABC):
|
||||
A tuple of registered protocol names.
|
||||
|
||||
"""
|
||||
return tuple(self.handlers.keys())
|
||||
|
||||
@abstractmethod
|
||||
async def negotiate(
|
||||
|
||||
@ -1,26 +0,0 @@
|
||||
from collections.abc import (
|
||||
Callable,
|
||||
)
|
||||
|
||||
from libp2p.abc import (
|
||||
PeerInfo,
|
||||
)
|
||||
|
||||
TTL: int = 60 * 60 # Time-to-live for discovered peers in seconds
|
||||
|
||||
|
||||
class PeerDiscovery:
|
||||
def __init__(self) -> None:
|
||||
self._peer_discovered_handlers: list[Callable[[PeerInfo], None]] = []
|
||||
|
||||
def register_peer_discovered_handler(
|
||||
self, handler: Callable[[PeerInfo], None]
|
||||
) -> None:
|
||||
self._peer_discovered_handlers.append(handler)
|
||||
|
||||
def emit_peer_discovered(self, peer_info: PeerInfo) -> None:
|
||||
for handler in self._peer_discovered_handlers:
|
||||
handler(peer_info)
|
||||
|
||||
|
||||
peerDiscovery = PeerDiscovery()
|
||||
@ -1,91 +0,0 @@
|
||||
import logging
|
||||
import socket
|
||||
|
||||
from zeroconf import (
|
||||
EventLoopBlocked,
|
||||
ServiceInfo,
|
||||
Zeroconf,
|
||||
)
|
||||
|
||||
logger = logging.getLogger("libp2p.discovery.mdns.broadcaster")
|
||||
|
||||
|
||||
class PeerBroadcaster:
|
||||
"""
|
||||
Broadcasts this peer's presence on the local network using mDNS/zeroconf.
|
||||
Registers a service with the peer's ID in the TXT record as per libp2p spec.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
zeroconf: Zeroconf,
|
||||
service_type: str,
|
||||
service_name: str,
|
||||
peer_id: str,
|
||||
port: int,
|
||||
):
|
||||
self.zeroconf = zeroconf
|
||||
self.service_type = service_type
|
||||
self.peer_id = peer_id
|
||||
self.port = port
|
||||
self.service_name = service_name
|
||||
|
||||
# Get the local IP address
|
||||
local_ip = self._get_local_ip()
|
||||
hostname = socket.gethostname()
|
||||
|
||||
self.service_info = ServiceInfo(
|
||||
type_=self.service_type,
|
||||
name=self.service_name,
|
||||
port=self.port,
|
||||
properties={b"id": self.peer_id.encode()},
|
||||
server=f"{hostname}.local.",
|
||||
addresses=[socket.inet_aton(local_ip)],
|
||||
)
|
||||
|
||||
def _get_local_ip(self) -> str:
|
||||
"""Get the local IP address of this machine"""
|
||||
try:
|
||||
# Connect to a remote address to determine the local IP
|
||||
# This doesn't actually send data
|
||||
with socket.socket(socket.AF_INET, socket.SOCK_DGRAM) as s:
|
||||
s.connect(("8.8.8.8", 80))
|
||||
local_ip = s.getsockname()[0]
|
||||
return local_ip
|
||||
except Exception:
|
||||
# Fallback to localhost if we can't determine the IP
|
||||
return "127.0.0.1"
|
||||
|
||||
def register(self) -> None:
|
||||
"""Register the peer's mDNS service on the network."""
|
||||
try:
|
||||
self.zeroconf.register_service(self.service_info)
|
||||
logger.debug(f"mDNS service registered: {self.service_name}")
|
||||
except EventLoopBlocked as e:
|
||||
logger.warning(
|
||||
"EventLoopBlocked while registering mDNS '%s': %s", self.service_name, e
|
||||
)
|
||||
except Exception as e:
|
||||
logger.error(
|
||||
"Unexpected error during mDNS registration for '%s': %r",
|
||||
self.service_name,
|
||||
e,
|
||||
)
|
||||
|
||||
def unregister(self) -> None:
|
||||
"""Unregister the peer's mDNS service from the network."""
|
||||
try:
|
||||
self.zeroconf.unregister_service(self.service_info)
|
||||
logger.debug(f"mDNS service unregistered: {self.service_name}")
|
||||
except EventLoopBlocked as e:
|
||||
logger.warning(
|
||||
"EventLoopBlocked while unregistering mDNS '%s': %s",
|
||||
self.service_name,
|
||||
e,
|
||||
)
|
||||
except Exception as e:
|
||||
logger.error(
|
||||
"Unexpected error during mDNS unregistration for '%s': %r",
|
||||
self.service_name,
|
||||
e,
|
||||
)
|
||||
@ -1,83 +0,0 @@
|
||||
import logging
|
||||
import socket
|
||||
|
||||
from zeroconf import (
|
||||
ServiceBrowser,
|
||||
ServiceInfo,
|
||||
ServiceListener,
|
||||
Zeroconf,
|
||||
)
|
||||
|
||||
from libp2p.abc import IPeerStore, Multiaddr
|
||||
from libp2p.discovery.events.peerDiscovery import peerDiscovery
|
||||
from libp2p.peer.id import ID
|
||||
from libp2p.peer.peerinfo import PeerInfo
|
||||
|
||||
logger = logging.getLogger("libp2p.discovery.mdns.listener")
|
||||
|
||||
|
||||
class PeerListener(ServiceListener):
|
||||
"""mDNS listener — now a true ServiceListener subclass."""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
peerstore: IPeerStore,
|
||||
zeroconf: Zeroconf,
|
||||
service_type: str,
|
||||
service_name: str,
|
||||
) -> None:
|
||||
self.peerstore = peerstore
|
||||
self.zeroconf = zeroconf
|
||||
self.service_type = service_type
|
||||
self.service_name = service_name
|
||||
self.discovered_services: dict[str, ID] = {}
|
||||
self.browser = ServiceBrowser(self.zeroconf, self.service_type, listener=self)
|
||||
|
||||
def add_service(self, zc: Zeroconf, type_: str, name: str) -> None:
|
||||
if name == self.service_name:
|
||||
return
|
||||
logger.debug(f"Adding service: {name}")
|
||||
info = zc.get_service_info(type_, name, timeout=5000)
|
||||
if not info:
|
||||
return
|
||||
peer_info = self._extract_peer_info(info)
|
||||
if peer_info:
|
||||
self.discovered_services[name] = peer_info.peer_id
|
||||
self.peerstore.add_addrs(peer_info.peer_id, peer_info.addrs, 10)
|
||||
peerDiscovery.emit_peer_discovered(peer_info)
|
||||
logger.debug(f"Discovered Peer: {peer_info.peer_id}")
|
||||
|
||||
def remove_service(self, zc: Zeroconf, type_: str, name: str) -> None:
|
||||
if name == self.service_name:
|
||||
return
|
||||
logger.debug(f"Removing service: {name}")
|
||||
peer_id = self.discovered_services.pop(name)
|
||||
self.peerstore.clear_addrs(peer_id)
|
||||
logger.debug(f"Removed Peer: {peer_id}")
|
||||
|
||||
def update_service(self, zc: Zeroconf, type_: str, name: str) -> None:
|
||||
info = zc.get_service_info(type_, name, timeout=5000)
|
||||
if not info:
|
||||
return
|
||||
peer_info = self._extract_peer_info(info)
|
||||
if peer_info:
|
||||
self.peerstore.clear_addrs(peer_info.peer_id)
|
||||
self.peerstore.add_addrs(peer_info.peer_id, peer_info.addrs, 10)
|
||||
logger.debug(f"Updated Peer {peer_info.peer_id}")
|
||||
|
||||
def _extract_peer_info(self, info: ServiceInfo) -> PeerInfo | None:
|
||||
try:
|
||||
addrs = [
|
||||
Multiaddr(f"/ip4/{socket.inet_ntoa(addr)}/tcp/{info.port}")
|
||||
for addr in info.addresses
|
||||
]
|
||||
pid_bytes = info.properties.get(b"id")
|
||||
if not pid_bytes:
|
||||
return None
|
||||
pid = ID.from_base58(pid_bytes.decode())
|
||||
return PeerInfo(peer_id=pid, addrs=addrs)
|
||||
except Exception:
|
||||
return None
|
||||
|
||||
def stop(self) -> None:
|
||||
self.browser.cancel()
|
||||
@ -1,73 +0,0 @@
|
||||
"""
|
||||
mDNS-based peer discovery for py-libp2p.
|
||||
Conforms to https://github.com/libp2p/specs/blob/master/discovery/mdns.md
|
||||
Uses zeroconf for mDNS broadcast/listen. Async operations use trio.
|
||||
"""
|
||||
|
||||
import logging
|
||||
|
||||
from zeroconf import (
|
||||
Zeroconf,
|
||||
)
|
||||
|
||||
from libp2p.abc import (
|
||||
INetworkService,
|
||||
)
|
||||
|
||||
from .broadcaster import (
|
||||
PeerBroadcaster,
|
||||
)
|
||||
from .listener import (
|
||||
PeerListener,
|
||||
)
|
||||
from .utils import (
|
||||
stringGen,
|
||||
)
|
||||
|
||||
logger = logging.getLogger("libp2p.discovery.mdns")
|
||||
|
||||
SERVICE_TYPE = "_p2p._udp.local."
|
||||
MCAST_PORT = 5353
|
||||
MCAST_ADDR = "224.0.0.251"
|
||||
|
||||
|
||||
class MDNSDiscovery:
|
||||
"""
|
||||
mDNS-based peer discovery for py-libp2p, using zeroconf.
|
||||
Conforms to the libp2p mDNS discovery spec.
|
||||
"""
|
||||
|
||||
def __init__(self, swarm: INetworkService, port: int = 8000):
|
||||
self.peer_id = str(swarm.get_peer_id())
|
||||
self.port = port
|
||||
self.zeroconf = Zeroconf()
|
||||
self.serviceName = f"{stringGen()}.{SERVICE_TYPE}"
|
||||
self.peerstore = swarm.peerstore
|
||||
self.swarm = swarm
|
||||
self.broadcaster = PeerBroadcaster(
|
||||
zeroconf=self.zeroconf,
|
||||
service_type=SERVICE_TYPE,
|
||||
service_name=self.serviceName,
|
||||
peer_id=self.peer_id,
|
||||
port=self.port,
|
||||
)
|
||||
self.listener = PeerListener(
|
||||
zeroconf=self.zeroconf,
|
||||
peerstore=self.peerstore,
|
||||
service_type=SERVICE_TYPE,
|
||||
service_name=self.serviceName,
|
||||
)
|
||||
|
||||
def start(self) -> None:
|
||||
"""Register this peer and start listening for others."""
|
||||
logger.debug(
|
||||
f"Starting mDNS discovery for peer {self.peer_id} on port {self.port}"
|
||||
)
|
||||
self.broadcaster.register()
|
||||
# Listener is started in constructor
|
||||
|
||||
def stop(self) -> None:
|
||||
"""Unregister this peer and clean up zeroconf resources."""
|
||||
logger.debug("Stopping mDNS discovery")
|
||||
self.broadcaster.unregister()
|
||||
self.zeroconf.close()
|
||||
@ -1,11 +0,0 @@
|
||||
import random
|
||||
import string
|
||||
|
||||
|
||||
def stringGen(len: int = 63) -> str:
|
||||
"""Generate a random string of lowercase letters and digits."""
|
||||
charset = string.ascii_lowercase + string.digits
|
||||
result = []
|
||||
for _ in range(len):
|
||||
result.append(random.choice(charset))
|
||||
return "".join(result)
|
||||
@ -29,7 +29,6 @@ from libp2p.custom_types import (
|
||||
StreamHandlerFn,
|
||||
TProtocol,
|
||||
)
|
||||
from libp2p.discovery.mdns.mdns import MDNSDiscovery
|
||||
from libp2p.host.defaults import (
|
||||
get_default_protocols,
|
||||
)
|
||||
@ -71,7 +70,6 @@ if TYPE_CHECKING:
|
||||
|
||||
|
||||
logger = logging.getLogger("libp2p.network.basic_host")
|
||||
DEFAULT_NEGOTIATE_TIMEOUT = 5
|
||||
|
||||
|
||||
class BasicHost(IHost):
|
||||
@ -91,20 +89,15 @@ class BasicHost(IHost):
|
||||
def __init__(
|
||||
self,
|
||||
network: INetworkService,
|
||||
enable_mDNS: bool = False,
|
||||
default_protocols: Optional["OrderedDict[TProtocol, StreamHandlerFn]"] = None,
|
||||
negotitate_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
) -> None:
|
||||
self._network = network
|
||||
self._network.set_stream_handler(self._swarm_stream_handler)
|
||||
self.peerstore = self._network.peerstore
|
||||
self.negotiate_timeout = negotitate_timeout
|
||||
# Protocol muxing
|
||||
default_protocols = default_protocols or get_default_protocols(self)
|
||||
self.multiselect = Multiselect(dict(default_protocols.items()))
|
||||
self.multiselect_client = MultiselectClient()
|
||||
if enable_mDNS:
|
||||
self.mDNS = MDNSDiscovery(network)
|
||||
|
||||
def get_id(self) -> ID:
|
||||
"""
|
||||
@ -169,14 +162,7 @@ class BasicHost(IHost):
|
||||
network = self.get_network()
|
||||
async with background_trio_service(network):
|
||||
await network.listen(*listen_addrs)
|
||||
if hasattr(self, "mDNS") and self.mDNS is not None:
|
||||
logger.debug("Starting mDNS Discovery")
|
||||
self.mDNS.start()
|
||||
try:
|
||||
yield
|
||||
finally:
|
||||
if hasattr(self, "mDNS") and self.mDNS is not None:
|
||||
self.mDNS.stop()
|
||||
yield
|
||||
|
||||
return _run()
|
||||
|
||||
@ -192,10 +178,7 @@ class BasicHost(IHost):
|
||||
self.multiselect.add_handler(protocol_id, stream_handler)
|
||||
|
||||
async def new_stream(
|
||||
self,
|
||||
peer_id: ID,
|
||||
protocol_ids: Sequence[TProtocol],
|
||||
negotitate_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
self, peer_id: ID, protocol_ids: Sequence[TProtocol]
|
||||
) -> INetStream:
|
||||
"""
|
||||
:param peer_id: peer_id that host is connecting
|
||||
@ -207,9 +190,7 @@ class BasicHost(IHost):
|
||||
# Perform protocol muxing to determine protocol to use
|
||||
try:
|
||||
selected_protocol = await self.multiselect_client.select_one_of(
|
||||
list(protocol_ids),
|
||||
MultiselectCommunicator(net_stream),
|
||||
negotitate_timeout,
|
||||
list(protocol_ids), MultiselectCommunicator(net_stream)
|
||||
)
|
||||
except MultiselectClientError as error:
|
||||
logger.debug("fail to open a stream to peer %s, error=%s", peer_id, error)
|
||||
@ -219,12 +200,7 @@ class BasicHost(IHost):
|
||||
net_stream.set_protocol(selected_protocol)
|
||||
return net_stream
|
||||
|
||||
async def send_command(
|
||||
self,
|
||||
peer_id: ID,
|
||||
command: str,
|
||||
response_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
) -> list[str]:
|
||||
async def send_command(self, peer_id: ID, command: str) -> list[str]:
|
||||
"""
|
||||
Send a multistream-select command to the specified peer and return
|
||||
the response.
|
||||
@ -238,7 +214,7 @@ class BasicHost(IHost):
|
||||
|
||||
try:
|
||||
response = await self.multiselect_client.query_multistream_command(
|
||||
MultiselectCommunicator(new_stream), command, response_timeout
|
||||
MultiselectCommunicator(new_stream), command
|
||||
)
|
||||
except MultiselectClientError as error:
|
||||
logger.debug("fail to open a stream to peer %s, error=%s", peer_id, error)
|
||||
@ -277,7 +253,7 @@ class BasicHost(IHost):
|
||||
# Perform protocol muxing to determine protocol to use
|
||||
try:
|
||||
protocol, handler = await self.multiselect.negotiate(
|
||||
MultiselectCommunicator(net_stream), self.negotiate_timeout
|
||||
MultiselectCommunicator(net_stream)
|
||||
)
|
||||
except MultiselectError as error:
|
||||
peer_id = net_stream.muxed_conn.peer_id
|
||||
|
||||
@ -26,8 +26,5 @@ if TYPE_CHECKING:
|
||||
|
||||
def get_default_protocols(host: IHost) -> "OrderedDict[TProtocol, StreamHandlerFn]":
|
||||
return OrderedDict(
|
||||
(
|
||||
(IdentifyID, identify_handler_for(host, use_varint_format=True)),
|
||||
(PingID, handle_ping),
|
||||
)
|
||||
((IdentifyID, identify_handler_for(host)), (PingID, handle_ping))
|
||||
)
|
||||
|
||||
@ -18,10 +18,8 @@ from libp2p.peer.peerinfo import (
|
||||
class RoutedHost(BasicHost):
|
||||
_router: IPeerRouting
|
||||
|
||||
def __init__(
|
||||
self, network: INetworkService, router: IPeerRouting, enable_mDNS: bool = False
|
||||
):
|
||||
super().__init__(network, enable_mDNS)
|
||||
def __init__(self, network: INetworkService, router: IPeerRouting):
|
||||
super().__init__(network)
|
||||
self._router = router
|
||||
|
||||
async def connect(self, peer_info: PeerInfo) -> None:
|
||||
|
||||
@ -16,9 +16,7 @@ from libp2p.network.stream.exceptions import (
|
||||
StreamClosed,
|
||||
)
|
||||
from libp2p.utils import (
|
||||
decode_varint_with_size,
|
||||
get_agent_version,
|
||||
varint,
|
||||
)
|
||||
|
||||
from .pb.identify_pb2 import (
|
||||
@ -61,7 +59,7 @@ def _mk_identify_protobuf(
|
||||
) -> Identify:
|
||||
public_key = host.get_public_key()
|
||||
laddrs = host.get_addrs()
|
||||
protocols = tuple(str(p) for p in host.get_mux().get_protocols() if p is not None)
|
||||
protocols = host.get_mux().get_protocols()
|
||||
|
||||
observed_addr = observed_multiaddr.to_bytes() if observed_multiaddr else b""
|
||||
return Identify(
|
||||
@ -74,47 +72,7 @@ def _mk_identify_protobuf(
|
||||
)
|
||||
|
||||
|
||||
def parse_identify_response(response: bytes) -> Identify:
|
||||
"""
|
||||
Parse identify response that could be either:
|
||||
- Old format: raw protobuf
|
||||
- New format: length-prefixed protobuf
|
||||
|
||||
This function provides backward and forward compatibility.
|
||||
"""
|
||||
# Try new format first: length-prefixed protobuf
|
||||
if len(response) >= 1:
|
||||
length, varint_size = decode_varint_with_size(response)
|
||||
if varint_size > 0 and length > 0 and varint_size + length <= len(response):
|
||||
protobuf_data = response[varint_size : varint_size + length]
|
||||
try:
|
||||
identify_response = Identify()
|
||||
identify_response.ParseFromString(protobuf_data)
|
||||
# Sanity check: must have agent_version (protocol_version is optional)
|
||||
if identify_response.agent_version:
|
||||
logger.debug(
|
||||
"Parsed length-prefixed identify response (new format)"
|
||||
)
|
||||
return identify_response
|
||||
except Exception:
|
||||
pass # Fall through to old format
|
||||
|
||||
# Fall back to old format: raw protobuf
|
||||
try:
|
||||
identify_response = Identify()
|
||||
identify_response.ParseFromString(response)
|
||||
logger.debug("Parsed raw protobuf identify response (old format)")
|
||||
return identify_response
|
||||
except Exception as e:
|
||||
logger.error(f"Failed to parse identify response: {e}")
|
||||
logger.error(f"Response length: {len(response)}")
|
||||
logger.error(f"Response hex: {response.hex()}")
|
||||
raise
|
||||
|
||||
|
||||
def identify_handler_for(
|
||||
host: IHost, use_varint_format: bool = False
|
||||
) -> StreamHandlerFn:
|
||||
def identify_handler_for(host: IHost) -> StreamHandlerFn:
|
||||
async def handle_identify(stream: INetStream) -> None:
|
||||
# get observed address from ``stream``
|
||||
peer_id = (
|
||||
@ -142,21 +100,7 @@ def identify_handler_for(
|
||||
response = protobuf.SerializeToString()
|
||||
|
||||
try:
|
||||
if use_varint_format:
|
||||
# Send length-prefixed protobuf message (new format)
|
||||
await stream.write(varint.encode_uvarint(len(response)))
|
||||
await stream.write(response)
|
||||
logger.debug(
|
||||
"Sent new format (length-prefixed) identify response to %s",
|
||||
peer_id,
|
||||
)
|
||||
else:
|
||||
# Send raw protobuf message (old format for backward compatibility)
|
||||
await stream.write(response)
|
||||
logger.debug(
|
||||
"Sent old format (raw protobuf) identify response to %s",
|
||||
peer_id,
|
||||
)
|
||||
await stream.write(response)
|
||||
except StreamClosed:
|
||||
logger.debug("Fail to respond to %s request: stream closed", ID)
|
||||
else:
|
||||
|
||||
@ -25,10 +25,6 @@ from libp2p.peer.id import (
|
||||
)
|
||||
from libp2p.utils import (
|
||||
get_agent_version,
|
||||
varint,
|
||||
)
|
||||
from libp2p.utils.varint import (
|
||||
decode_varint_from_bytes,
|
||||
)
|
||||
|
||||
from ..identify.identify import (
|
||||
@ -44,72 +40,22 @@ logger = logging.getLogger(__name__)
|
||||
ID_PUSH = TProtocol("/ipfs/id/push/1.0.0")
|
||||
PROTOCOL_VERSION = "ipfs/0.1.0"
|
||||
AGENT_VERSION = get_agent_version()
|
||||
CONCURRENCY_LIMIT = 10
|
||||
|
||||
|
||||
def identify_push_handler_for(
|
||||
host: IHost, use_varint_format: bool = True
|
||||
) -> StreamHandlerFn:
|
||||
def identify_push_handler_for(host: IHost) -> StreamHandlerFn:
|
||||
"""
|
||||
Create a handler for the identify/push protocol.
|
||||
|
||||
This handler receives pushed identify messages from remote peers and updates
|
||||
the local peerstore with the new information.
|
||||
|
||||
Args:
|
||||
host: The libp2p host.
|
||||
use_varint_format: True=length-prefixed, False=raw protobuf.
|
||||
|
||||
"""
|
||||
|
||||
async def handle_identify_push(stream: INetStream) -> None:
|
||||
peer_id = stream.muxed_conn.peer_id
|
||||
|
||||
try:
|
||||
if use_varint_format:
|
||||
# Read length-prefixed identify message from the stream
|
||||
# First read the varint length prefix
|
||||
length_bytes = b""
|
||||
while True:
|
||||
b = await stream.read(1)
|
||||
if not b:
|
||||
break
|
||||
length_bytes += b
|
||||
if b[0] & 0x80 == 0:
|
||||
break
|
||||
|
||||
if not length_bytes:
|
||||
logger.warning("No length prefix received from peer %s", peer_id)
|
||||
return
|
||||
|
||||
msg_length = decode_varint_from_bytes(length_bytes)
|
||||
|
||||
# Read the protobuf message
|
||||
data = await stream.read(msg_length)
|
||||
if len(data) != msg_length:
|
||||
logger.warning("Incomplete message received from peer %s", peer_id)
|
||||
return
|
||||
else:
|
||||
# Read raw protobuf message from the stream
|
||||
# For raw format, we need to read all data before the stream is closed
|
||||
data = b""
|
||||
try:
|
||||
# Read all available data in a single operation
|
||||
data = await stream.read()
|
||||
except StreamClosed:
|
||||
# Try to read any remaining data
|
||||
try:
|
||||
data = await stream.read()
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
# If we got no data, log a warning and return
|
||||
if not data:
|
||||
logger.warning(
|
||||
"No data received in raw format from peer %s", peer_id
|
||||
)
|
||||
return
|
||||
|
||||
# Read the identify message from the stream
|
||||
data = await stream.read()
|
||||
identify_msg = Identify()
|
||||
identify_msg.ParseFromString(data)
|
||||
|
||||
@ -186,11 +132,7 @@ async def _update_peerstore_from_identify(
|
||||
|
||||
|
||||
async def push_identify_to_peer(
|
||||
host: IHost,
|
||||
peer_id: ID,
|
||||
observed_multiaddr: Multiaddr | None = None,
|
||||
limit: trio.Semaphore = trio.Semaphore(CONCURRENCY_LIMIT),
|
||||
use_varint_format: bool = True,
|
||||
host: IHost, peer_id: ID, observed_multiaddr: Multiaddr | None = None
|
||||
) -> bool:
|
||||
"""
|
||||
Push an identify message to a specific peer.
|
||||
@ -198,78 +140,52 @@ async def push_identify_to_peer(
|
||||
This function opens a stream to the peer using the identify/push protocol,
|
||||
sends the identify message, and closes the stream.
|
||||
|
||||
Args:
|
||||
host: The libp2p host.
|
||||
peer_id: The peer ID to push to.
|
||||
observed_multiaddr: The observed multiaddress (optional).
|
||||
limit: Semaphore for concurrency control.
|
||||
use_varint_format: True=length-prefixed, False=raw protobuf.
|
||||
|
||||
Returns:
|
||||
bool: True if the push was successful, False otherwise.
|
||||
Returns
|
||||
-------
|
||||
bool
|
||||
True if the push was successful, False otherwise.
|
||||
|
||||
"""
|
||||
async with limit:
|
||||
try:
|
||||
# Create a new stream to the peer using the identify/push protocol
|
||||
stream = await host.new_stream(peer_id, [ID_PUSH])
|
||||
try:
|
||||
# Create a new stream to the peer using the identify/push protocol
|
||||
stream = await host.new_stream(peer_id, [ID_PUSH])
|
||||
|
||||
# Create the identify message
|
||||
identify_msg = _mk_identify_protobuf(host, observed_multiaddr)
|
||||
response = identify_msg.SerializeToString()
|
||||
# Create the identify message
|
||||
identify_msg = _mk_identify_protobuf(host, observed_multiaddr)
|
||||
response = identify_msg.SerializeToString()
|
||||
|
||||
if use_varint_format:
|
||||
# Send length-prefixed identify message
|
||||
await stream.write(varint.encode_uvarint(len(response)))
|
||||
await stream.write(response)
|
||||
else:
|
||||
# Send raw protobuf message
|
||||
await stream.write(response)
|
||||
# Send the identify message
|
||||
await stream.write(response)
|
||||
|
||||
# Close the stream
|
||||
await stream.close()
|
||||
# Close the stream
|
||||
await stream.close()
|
||||
|
||||
logger.debug("Successfully pushed identify to peer %s", peer_id)
|
||||
return True
|
||||
except Exception as e:
|
||||
logger.error("Error pushing identify to peer %s: %s", peer_id, e)
|
||||
return False
|
||||
logger.debug("Successfully pushed identify to peer %s", peer_id)
|
||||
return True
|
||||
except Exception as e:
|
||||
logger.error("Error pushing identify to peer %s: %s", peer_id, e)
|
||||
return False
|
||||
|
||||
|
||||
async def push_identify_to_peers(
|
||||
host: IHost,
|
||||
peer_ids: set[ID] | None = None,
|
||||
observed_multiaddr: Multiaddr | None = None,
|
||||
use_varint_format: bool = True,
|
||||
) -> None:
|
||||
"""
|
||||
Push an identify message to multiple peers in parallel.
|
||||
|
||||
If peer_ids is None, push to all connected peers.
|
||||
|
||||
Args:
|
||||
host: The libp2p host.
|
||||
peer_ids: Set of peer IDs to push to (if None, push to all connected peers).
|
||||
observed_multiaddr: The observed multiaddress (optional).
|
||||
use_varint_format: True=length-prefixed, False=raw protobuf.
|
||||
|
||||
"""
|
||||
if peer_ids is None:
|
||||
# Get all connected peers
|
||||
peer_ids = set(host.get_connected_peers())
|
||||
|
||||
# Create a single shared semaphore for concurrency control
|
||||
limit = trio.Semaphore(CONCURRENCY_LIMIT)
|
||||
peer_ids = set(host.get_peerstore().peer_ids())
|
||||
|
||||
# Push to each peer in parallel using a trio.Nursery
|
||||
# limiting concurrent connections to CONCURRENCY_LIMIT
|
||||
# TODO: Consider using a bounded nursery to limit concurrency
|
||||
# and avoid overwhelming the network. This can be done by using
|
||||
# trio.open_nursery(max_concurrent=10) or similar.
|
||||
# For now, we will use an unbounded nursery for simplicity.
|
||||
async with trio.open_nursery() as nursery:
|
||||
for peer_id in peer_ids:
|
||||
nursery.start_soon(
|
||||
push_identify_to_peer,
|
||||
host,
|
||||
peer_id,
|
||||
observed_multiaddr,
|
||||
limit,
|
||||
use_varint_format,
|
||||
)
|
||||
nursery.start_soon(push_identify_to_peer, host, peer_id, observed_multiaddr)
|
||||
|
||||
@ -18,13 +18,6 @@ from libp2p.crypto.keys import (
|
||||
PublicKey,
|
||||
)
|
||||
|
||||
"""
|
||||
Latency EWMA Smoothing governs the deacy of the EWMA (the speed at which
|
||||
is changes). This must be a normalized (0-1) value.
|
||||
1 is 100% change, 0 is no change.
|
||||
"""
|
||||
LATENCY_EWMA_SMOOTHING = 0.1
|
||||
|
||||
|
||||
class PeerData(IPeerData):
|
||||
pubkey: PublicKey | None
|
||||
@ -34,7 +27,6 @@ class PeerData(IPeerData):
|
||||
addrs: list[Multiaddr]
|
||||
last_identified: int
|
||||
ttl: int # Keep ttl=0 by default for always valid
|
||||
latmap: float
|
||||
|
||||
def __init__(self) -> None:
|
||||
self.pubkey = None
|
||||
@ -44,9 +36,6 @@ class PeerData(IPeerData):
|
||||
self.addrs = []
|
||||
self.last_identified = int(time.time())
|
||||
self.ttl = 0
|
||||
self.latmap = 0
|
||||
|
||||
# --------PROTO-BOOK--------
|
||||
|
||||
def get_protocols(self) -> list[str]:
|
||||
"""
|
||||
@ -66,37 +55,6 @@ class PeerData(IPeerData):
|
||||
"""
|
||||
self.protocols = list(protocols)
|
||||
|
||||
def remove_protocols(self, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
:param protocols: protocols to remove
|
||||
"""
|
||||
for protocol in protocols:
|
||||
if protocol in self.protocols:
|
||||
self.protocols.remove(protocol)
|
||||
|
||||
def supports_protocols(self, protocols: Sequence[str]) -> list[str]:
|
||||
"""
|
||||
:param protocols: protocols to check from
|
||||
:return: all supported protocols in the given list
|
||||
"""
|
||||
return [proto for proto in protocols if proto in self.protocols]
|
||||
|
||||
def first_supported_protocol(self, protocols: Sequence[str]) -> str:
|
||||
"""
|
||||
:param protocols: protocols to check from
|
||||
:return: first supported protocol in the given list
|
||||
"""
|
||||
for protocol in protocols:
|
||||
if protocol in self.protocols:
|
||||
return protocol
|
||||
|
||||
return "None supported"
|
||||
|
||||
def clear_protocol_data(self) -> None:
|
||||
"""Clear all protocols"""
|
||||
self.protocols = []
|
||||
|
||||
# -------ADDR-BOOK---------
|
||||
def add_addrs(self, addrs: Sequence[Multiaddr]) -> None:
|
||||
"""
|
||||
:param addrs: multiaddresses to add
|
||||
@ -115,7 +73,6 @@ class PeerData(IPeerData):
|
||||
"""Clear all addresses."""
|
||||
self.addrs = []
|
||||
|
||||
# -------METADATA-----------
|
||||
def put_metadata(self, key: str, val: Any) -> None:
|
||||
"""
|
||||
:param key: key in KV pair
|
||||
@ -133,11 +90,6 @@ class PeerData(IPeerData):
|
||||
return self.metadata[key]
|
||||
raise PeerDataError("key not found")
|
||||
|
||||
def clear_metadata(self) -> None:
|
||||
"""Clears metadata."""
|
||||
self.metadata = {}
|
||||
|
||||
# -------KEY-BOOK---------------
|
||||
def add_pubkey(self, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
:param pubkey:
|
||||
@ -168,41 +120,9 @@ class PeerData(IPeerData):
|
||||
raise PeerDataError("private key not found")
|
||||
return self.privkey
|
||||
|
||||
def clear_keydata(self) -> None:
|
||||
"""Clears keydata"""
|
||||
self.pubkey = None
|
||||
self.privkey = None
|
||||
|
||||
# ----------METRICS--------------
|
||||
def record_latency(self, new_latency: float) -> None:
|
||||
"""
|
||||
Records a new latency measurement for the given peer
|
||||
using Exponentially Weighted Moving Average (EWMA)
|
||||
:param new_latency: the new latency value
|
||||
"""
|
||||
s = LATENCY_EWMA_SMOOTHING
|
||||
if s > 1 or s < 0:
|
||||
s = 0.1
|
||||
|
||||
if self.latmap == 0:
|
||||
self.latmap = new_latency
|
||||
else:
|
||||
prev = self.latmap
|
||||
updated = ((1.0 - s) * prev) + (s * new_latency)
|
||||
self.latmap = updated
|
||||
|
||||
def latency_EWMA(self) -> float:
|
||||
"""Returns the latency EWMA value"""
|
||||
return self.latmap
|
||||
|
||||
def clear_metrics(self) -> None:
|
||||
"""Clear the latency metrics"""
|
||||
self.latmap = 0
|
||||
|
||||
def update_last_identified(self) -> None:
|
||||
self.last_identified = int(time.time())
|
||||
|
||||
# ----------TTL------------------
|
||||
def get_last_identified(self) -> int:
|
||||
"""
|
||||
:return: last identified timestamp
|
||||
|
||||
@ -3,11 +3,9 @@ from collections.abc import (
|
||||
)
|
||||
from typing import (
|
||||
Any,
|
||||
cast,
|
||||
)
|
||||
|
||||
import multiaddr
|
||||
from multiaddr.protocols import Protocol
|
||||
|
||||
from .id import (
|
||||
ID,
|
||||
@ -44,8 +42,7 @@ def info_from_p2p_addr(addr: multiaddr.Multiaddr) -> PeerInfo:
|
||||
p2p_protocols = p2p_part.protocols()
|
||||
if not p2p_protocols:
|
||||
raise InvalidAddrError("The last part of the address has no protocols")
|
||||
last_protocol = cast(Protocol, p2p_part.protocols()[0])
|
||||
|
||||
last_protocol = p2p_protocols[0]
|
||||
if last_protocol is None:
|
||||
raise InvalidAddrError("The last protocol is None")
|
||||
|
||||
|
||||
@ -2,7 +2,6 @@ from collections import (
|
||||
defaultdict,
|
||||
)
|
||||
from collections.abc import (
|
||||
AsyncIterable,
|
||||
Sequence,
|
||||
)
|
||||
from typing import (
|
||||
@ -12,8 +11,6 @@ from typing import (
|
||||
from multiaddr import (
|
||||
Multiaddr,
|
||||
)
|
||||
import trio
|
||||
from trio import MemoryReceiveChannel, MemorySendChannel
|
||||
|
||||
from libp2p.abc import (
|
||||
IPeerStore,
|
||||
@ -43,7 +40,6 @@ class PeerStore(IPeerStore):
|
||||
|
||||
def __init__(self) -> None:
|
||||
self.peer_data_map = defaultdict(PeerData)
|
||||
self.addr_update_channels: dict[ID, MemorySendChannel[Multiaddr]] = {}
|
||||
|
||||
def peer_info(self, peer_id: ID) -> PeerInfo:
|
||||
"""
|
||||
@ -57,33 +53,6 @@ class PeerStore(IPeerStore):
|
||||
return PeerInfo(peer_id, peer_data.get_addrs())
|
||||
raise PeerStoreError("peer ID not found")
|
||||
|
||||
def peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
:return: all of the peer IDs stored in peer store
|
||||
"""
|
||||
return list(self.peer_data_map.keys())
|
||||
|
||||
def clear_peerdata(self, peer_id: ID) -> None:
|
||||
"""Clears all data associated with the given peer_id."""
|
||||
if peer_id in self.peer_data_map:
|
||||
del self.peer_data_map[peer_id]
|
||||
else:
|
||||
raise PeerStoreError("peer ID not found")
|
||||
|
||||
def valid_peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
:return: all of the valid peer IDs stored in peer store
|
||||
"""
|
||||
valid_peer_ids: list[ID] = []
|
||||
for peer_id, peer_data in self.peer_data_map.items():
|
||||
if not peer_data.is_expired():
|
||||
valid_peer_ids.append(peer_id)
|
||||
else:
|
||||
peer_data.clear_addrs()
|
||||
return valid_peer_ids
|
||||
|
||||
# --------PROTO-BOOK--------
|
||||
|
||||
def get_protocols(self, peer_id: ID) -> list[str]:
|
||||
"""
|
||||
:param peer_id: peer ID to get protocols for
|
||||
@ -110,31 +79,23 @@ class PeerStore(IPeerStore):
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.set_protocols(list(protocols))
|
||||
|
||||
def remove_protocols(self, peer_id: ID, protocols: Sequence[str]) -> None:
|
||||
"""
|
||||
:param peer_id: peer ID to get info for
|
||||
:param protocols: unsupported protocols to remove
|
||||
"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.remove_protocols(protocols)
|
||||
|
||||
def supports_protocols(self, peer_id: ID, protocols: Sequence[str]) -> list[str]:
|
||||
def peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
:return: all of the peer IDs stored in peer store
|
||||
"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
return peer_data.supports_protocols(protocols)
|
||||
return list(self.peer_data_map.keys())
|
||||
|
||||
def first_supported_protocol(self, peer_id: ID, protocols: Sequence[str]) -> str:
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
return peer_data.first_supported_protocol(protocols)
|
||||
|
||||
def clear_protocol_data(self, peer_id: ID) -> None:
|
||||
"""Clears prtocoldata"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.clear_protocol_data()
|
||||
|
||||
# ------METADATA---------
|
||||
def valid_peer_ids(self) -> list[ID]:
|
||||
"""
|
||||
:return: all of the valid peer IDs stored in peer store
|
||||
"""
|
||||
valid_peer_ids: list[ID] = []
|
||||
for peer_id, peer_data in self.peer_data_map.items():
|
||||
if not peer_data.is_expired():
|
||||
valid_peer_ids.append(peer_id)
|
||||
else:
|
||||
peer_data.clear_addrs()
|
||||
return valid_peer_ids
|
||||
|
||||
def get(self, peer_id: ID, key: str) -> Any:
|
||||
"""
|
||||
@ -160,13 +121,6 @@ class PeerStore(IPeerStore):
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.put_metadata(key, val)
|
||||
|
||||
def clear_metadata(self, peer_id: ID) -> None:
|
||||
"""Clears metadata"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.clear_metadata()
|
||||
|
||||
# -------ADDR-BOOK--------
|
||||
|
||||
def add_addr(self, peer_id: ID, addr: Multiaddr, ttl: int = 0) -> None:
|
||||
"""
|
||||
:param peer_id: peer ID to add address for
|
||||
@ -186,13 +140,6 @@ class PeerStore(IPeerStore):
|
||||
peer_data.set_ttl(ttl)
|
||||
peer_data.update_last_identified()
|
||||
|
||||
if peer_id in self.addr_update_channels:
|
||||
for addr in addrs:
|
||||
try:
|
||||
self.addr_update_channels[peer_id].send_nowait(addr)
|
||||
except trio.WouldBlock:
|
||||
pass # Or consider logging / dropping / replacing stream
|
||||
|
||||
def addrs(self, peer_id: ID) -> list[Multiaddr]:
|
||||
"""
|
||||
:param peer_id: peer ID to get addrs for
|
||||
@ -218,7 +165,7 @@ class PeerStore(IPeerStore):
|
||||
|
||||
def peers_with_addrs(self) -> list[ID]:
|
||||
"""
|
||||
:return: all of the peer IDs which has addrsfloat stored in peer store
|
||||
:return: all of the peer IDs which has addrs stored in peer store
|
||||
"""
|
||||
# Add all peers with addrs at least 1 to output
|
||||
output: list[ID] = []
|
||||
@ -232,27 +179,6 @@ class PeerStore(IPeerStore):
|
||||
peer_data.clear_addrs()
|
||||
return output
|
||||
|
||||
async def addr_stream(self, peer_id: ID) -> AsyncIterable[Multiaddr]:
|
||||
"""
|
||||
Returns an async stream of newly added addresses for the given peer.
|
||||
|
||||
This function allows consumers to subscribe to address updates for a peer
|
||||
and receive each new address as it is added via `add_addr` or `add_addrs`.
|
||||
|
||||
:param peer_id: The ID of the peer to monitor address updates for.
|
||||
:return: An async iterator yielding Multiaddr instances as they are added.
|
||||
"""
|
||||
send: MemorySendChannel[Multiaddr]
|
||||
receive: MemoryReceiveChannel[Multiaddr]
|
||||
|
||||
send, receive = trio.open_memory_channel(0)
|
||||
self.addr_update_channels[peer_id] = send
|
||||
|
||||
async for addr in receive:
|
||||
yield addr
|
||||
|
||||
# -------KEY-BOOK---------
|
||||
|
||||
def add_pubkey(self, peer_id: ID, pubkey: PublicKey) -> None:
|
||||
"""
|
||||
:param peer_id: peer ID to add public key for
|
||||
@ -313,45 +239,6 @@ class PeerStore(IPeerStore):
|
||||
self.add_pubkey(peer_id, key_pair.public_key)
|
||||
self.add_privkey(peer_id, key_pair.private_key)
|
||||
|
||||
def peer_with_keys(self) -> list[ID]:
|
||||
"""Returns the peer_ids for which keys are stored"""
|
||||
return [
|
||||
peer_id
|
||||
for peer_id, pdata in self.peer_data_map.items()
|
||||
if pdata.pubkey is not None
|
||||
]
|
||||
|
||||
def clear_keydata(self, peer_id: ID) -> None:
|
||||
"""Clears the keys of the peer"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.clear_keydata()
|
||||
|
||||
# --------METRICS--------
|
||||
|
||||
def record_latency(self, peer_id: ID, RTT: float) -> None:
|
||||
"""
|
||||
Records a new latency measurement for the given peer
|
||||
using Exponentially Weighted Moving Average (EWMA)
|
||||
|
||||
:param peer_id: peer ID to get private key for
|
||||
:param RTT: the new latency value (round trip time)
|
||||
"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.record_latency(RTT)
|
||||
|
||||
def latency_EWMA(self, peer_id: ID) -> float:
|
||||
"""
|
||||
:param peer_id: peer ID to get private key for
|
||||
:return: The latency EWMA value for that peer
|
||||
"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
return peer_data.latency_EWMA()
|
||||
|
||||
def clear_metrics(self, peer_id: ID) -> None:
|
||||
"""Clear the latency metrics"""
|
||||
peer_data = self.peer_data_map[peer_id]
|
||||
peer_data.clear_metrics()
|
||||
|
||||
|
||||
class PeerStoreError(KeyError):
|
||||
"""Raised when peer ID is not found in peer store."""
|
||||
|
||||
@ -1,5 +1,3 @@
|
||||
import trio
|
||||
|
||||
from libp2p.abc import (
|
||||
IMultiselectCommunicator,
|
||||
IMultiselectMuxer,
|
||||
@ -16,7 +14,6 @@ from .exceptions import (
|
||||
|
||||
MULTISELECT_PROTOCOL_ID = "/multistream/1.0.0"
|
||||
PROTOCOL_NOT_FOUND_MSG = "na"
|
||||
DEFAULT_NEGOTIATE_TIMEOUT = 5
|
||||
|
||||
|
||||
class Multiselect(IMultiselectMuxer):
|
||||
@ -50,68 +47,47 @@ class Multiselect(IMultiselectMuxer):
|
||||
|
||||
# FIXME: Make TProtocol Optional[TProtocol] to keep types consistent
|
||||
async def negotiate(
|
||||
self,
|
||||
communicator: IMultiselectCommunicator,
|
||||
negotiate_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
self, communicator: IMultiselectCommunicator
|
||||
) -> tuple[TProtocol, StreamHandlerFn | None]:
|
||||
"""
|
||||
Negotiate performs protocol selection.
|
||||
|
||||
:param stream: stream to negotiate on
|
||||
:param negotiate_timeout: timeout for negotiation
|
||||
:return: selected protocol name, handler function
|
||||
:raise MultiselectError: raised when negotiation failed
|
||||
"""
|
||||
try:
|
||||
with trio.fail_after(negotiate_timeout):
|
||||
await self.handshake(communicator)
|
||||
await self.handshake(communicator)
|
||||
|
||||
while True:
|
||||
while True:
|
||||
try:
|
||||
command = await communicator.read()
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
if command == "ls":
|
||||
supported_protocols = [p for p in self.handlers.keys() if p is not None]
|
||||
response = "\n".join(supported_protocols) + "\n"
|
||||
|
||||
try:
|
||||
await communicator.write(response)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
else:
|
||||
protocol = TProtocol(command)
|
||||
if protocol in self.handlers:
|
||||
try:
|
||||
command = await communicator.read()
|
||||
await communicator.write(protocol)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
if command == "ls":
|
||||
supported_protocols = [
|
||||
p for p in self.handlers.keys() if p is not None
|
||||
]
|
||||
response = "\n".join(supported_protocols) + "\n"
|
||||
return protocol, self.handlers[protocol]
|
||||
try:
|
||||
await communicator.write(PROTOCOL_NOT_FOUND_MSG)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
try:
|
||||
await communicator.write(response)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
else:
|
||||
protocol = TProtocol(command)
|
||||
if protocol in self.handlers:
|
||||
try:
|
||||
await communicator.write(protocol)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
return protocol, self.handlers[protocol]
|
||||
try:
|
||||
await communicator.write(PROTOCOL_NOT_FOUND_MSG)
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectError() from error
|
||||
|
||||
raise MultiselectError("Negotiation failed: no matching protocol")
|
||||
except trio.TooSlowError:
|
||||
raise MultiselectError("handshake read timeout")
|
||||
|
||||
def get_protocols(self) -> tuple[TProtocol | None, ...]:
|
||||
"""
|
||||
Retrieve the protocols for which handlers have been registered.
|
||||
|
||||
Returns
|
||||
-------
|
||||
tuple[TProtocol, ...]
|
||||
A tuple of registered protocol names.
|
||||
|
||||
"""
|
||||
return tuple(self.handlers.keys())
|
||||
raise MultiselectError("Negotiation failed: no matching protocol")
|
||||
|
||||
async def handshake(self, communicator: IMultiselectCommunicator) -> None:
|
||||
"""
|
||||
|
||||
@ -2,8 +2,6 @@ from collections.abc import (
|
||||
Sequence,
|
||||
)
|
||||
|
||||
import trio
|
||||
|
||||
from libp2p.abc import (
|
||||
IMultiselectClient,
|
||||
IMultiselectCommunicator,
|
||||
@ -19,7 +17,6 @@ from .exceptions import (
|
||||
|
||||
MULTISELECT_PROTOCOL_ID = "/multistream/1.0.0"
|
||||
PROTOCOL_NOT_FOUND_MSG = "na"
|
||||
DEFAULT_NEGOTIATE_TIMEOUT = 5
|
||||
|
||||
|
||||
class MultiselectClient(IMultiselectClient):
|
||||
@ -43,7 +40,6 @@ class MultiselectClient(IMultiselectClient):
|
||||
|
||||
try:
|
||||
handshake_contents = await communicator.read()
|
||||
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
|
||||
@ -51,10 +47,7 @@ class MultiselectClient(IMultiselectClient):
|
||||
raise MultiselectClientError("multiselect protocol ID mismatch")
|
||||
|
||||
async def select_one_of(
|
||||
self,
|
||||
protocols: Sequence[TProtocol],
|
||||
communicator: IMultiselectCommunicator,
|
||||
negotitate_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
self, protocols: Sequence[TProtocol], communicator: IMultiselectCommunicator
|
||||
) -> TProtocol:
|
||||
"""
|
||||
For each protocol, send message to multiselect selecting protocol and
|
||||
@ -63,32 +56,22 @@ class MultiselectClient(IMultiselectClient):
|
||||
|
||||
:param protocol: protocol to select
|
||||
:param communicator: communicator to use to communicate with counterparty
|
||||
:param negotiate_timeout: timeout for negotiation
|
||||
:return: selected protocol
|
||||
:raise MultiselectClientError: raised when protocol negotiation failed
|
||||
"""
|
||||
try:
|
||||
with trio.fail_after(negotitate_timeout):
|
||||
await self.handshake(communicator)
|
||||
await self.handshake(communicator)
|
||||
|
||||
for protocol in protocols:
|
||||
try:
|
||||
selected_protocol = await self.try_select(
|
||||
communicator, protocol
|
||||
)
|
||||
return selected_protocol
|
||||
except MultiselectClientError:
|
||||
pass
|
||||
for protocol in protocols:
|
||||
try:
|
||||
selected_protocol = await self.try_select(communicator, protocol)
|
||||
return selected_protocol
|
||||
except MultiselectClientError:
|
||||
pass
|
||||
|
||||
raise MultiselectClientError("protocols not supported")
|
||||
except trio.TooSlowError:
|
||||
raise MultiselectClientError("response timed out")
|
||||
raise MultiselectClientError("protocols not supported")
|
||||
|
||||
async def query_multistream_command(
|
||||
self,
|
||||
communicator: IMultiselectCommunicator,
|
||||
command: str,
|
||||
response_timeout: int = DEFAULT_NEGOTIATE_TIMEOUT,
|
||||
self, communicator: IMultiselectCommunicator, command: str
|
||||
) -> list[str]:
|
||||
"""
|
||||
Send a multistream-select command over the given communicator and return
|
||||
@ -96,32 +79,26 @@ class MultiselectClient(IMultiselectClient):
|
||||
|
||||
:param communicator: communicator to use to communicate with counterparty
|
||||
:param command: supported multistream-select command(e.g., ls)
|
||||
:param negotiate_timeout: timeout for negotiation
|
||||
:raise MultiselectClientError: If the communicator fails to process data.
|
||||
:return: list of strings representing the response from peer.
|
||||
"""
|
||||
await self.handshake(communicator)
|
||||
|
||||
if command == "ls":
|
||||
try:
|
||||
await communicator.write("ls")
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
else:
|
||||
raise ValueError("Command not supported")
|
||||
|
||||
try:
|
||||
with trio.fail_after(response_timeout):
|
||||
await self.handshake(communicator)
|
||||
response = await communicator.read()
|
||||
response_list = response.strip().splitlines()
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
|
||||
if command == "ls":
|
||||
try:
|
||||
await communicator.write("ls")
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
else:
|
||||
raise ValueError("Command not supported")
|
||||
|
||||
try:
|
||||
response = await communicator.read()
|
||||
response_list = response.strip().splitlines()
|
||||
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
|
||||
return response_list
|
||||
except trio.TooSlowError:
|
||||
raise MultiselectClientError("command response timed out")
|
||||
return response_list
|
||||
|
||||
async def try_select(
|
||||
self, communicator: IMultiselectCommunicator, protocol: TProtocol
|
||||
@ -141,7 +118,6 @@ class MultiselectClient(IMultiselectClient):
|
||||
|
||||
try:
|
||||
response = await communicator.read()
|
||||
|
||||
except MultiselectCommunicatorError as error:
|
||||
raise MultiselectClientError() from error
|
||||
|
||||
|
||||
@ -12,9 +12,15 @@ from libp2p.abc import (
|
||||
from libp2p.custom_types import (
|
||||
TProtocol,
|
||||
)
|
||||
from libp2p.network.stream.exceptions import (
|
||||
StreamClosed,
|
||||
)
|
||||
from libp2p.peer.id import (
|
||||
ID,
|
||||
)
|
||||
from libp2p.utils import (
|
||||
encode_varint_prefixed,
|
||||
)
|
||||
|
||||
from .exceptions import (
|
||||
PubsubRouterError,
|
||||
@ -114,7 +120,13 @@ class FloodSub(IPubsubRouter):
|
||||
if peer_id not in pubsub.peers:
|
||||
continue
|
||||
stream = pubsub.peers[peer_id]
|
||||
await pubsub.write_msg(stream, rpc_msg)
|
||||
# FIXME: We should add a `WriteMsg` similar to write delimited messages.
|
||||
# Ref: https://github.com/libp2p/go-libp2p-pubsub/blob/master/comm.go#L107
|
||||
try:
|
||||
await stream.write(encode_varint_prefixed(rpc_msg.SerializeToString()))
|
||||
except StreamClosed:
|
||||
logger.debug("Fail to publish message to %s: stream closed", peer_id)
|
||||
pubsub._handle_dead_peer(peer_id)
|
||||
|
||||
async def join(self, topic: str) -> None:
|
||||
"""
|
||||
|
||||
@ -24,6 +24,9 @@ from libp2p.abc import (
|
||||
from libp2p.custom_types import (
|
||||
TProtocol,
|
||||
)
|
||||
from libp2p.network.stream.exceptions import (
|
||||
StreamClosed,
|
||||
)
|
||||
from libp2p.peer.id import (
|
||||
ID,
|
||||
)
|
||||
@ -41,6 +44,9 @@ from libp2p.pubsub import (
|
||||
from libp2p.tools.async_service import (
|
||||
Service,
|
||||
)
|
||||
from libp2p.utils import (
|
||||
encode_varint_prefixed,
|
||||
)
|
||||
|
||||
from .exceptions import (
|
||||
NoPubsubAttached,
|
||||
@ -261,10 +267,13 @@ class GossipSub(IPubsubRouter, Service):
|
||||
if peer_id not in self.pubsub.peers:
|
||||
continue
|
||||
stream = self.pubsub.peers[peer_id]
|
||||
|
||||
# TODO: Go use `sendRPC`, which possibly piggybacks gossip/control messages.
|
||||
await self.pubsub.write_msg(stream, rpc_msg)
|
||||
|
||||
# FIXME: We should add a `WriteMsg` similar to write delimited messages.
|
||||
# Ref: https://github.com/libp2p/go-libp2p-pubsub/blob/master/comm.go#L107
|
||||
try:
|
||||
await stream.write(encode_varint_prefixed(rpc_msg.SerializeToString()))
|
||||
except StreamClosed:
|
||||
logger.debug("Fail to publish message to %s: stream closed", peer_id)
|
||||
self.pubsub._handle_dead_peer(peer_id)
|
||||
for topic in pubsub_msg.topicIDs:
|
||||
self.time_since_last_publish[topic] = int(time.time())
|
||||
|
||||
@ -820,6 +829,8 @@ class GossipSub(IPubsubRouter, Service):
|
||||
|
||||
packet.publish.extend(msgs_to_forward)
|
||||
|
||||
# 2) Serialize that packet
|
||||
rpc_msg: bytes = packet.SerializeToString()
|
||||
if self.pubsub is None:
|
||||
raise NoPubsubAttached
|
||||
|
||||
@ -833,7 +844,14 @@ class GossipSub(IPubsubRouter, Service):
|
||||
peer_stream = self.pubsub.peers[sender_peer_id]
|
||||
|
||||
# 4) And write the packet to the stream
|
||||
await self.pubsub.write_msg(peer_stream, packet)
|
||||
try:
|
||||
await peer_stream.write(encode_varint_prefixed(rpc_msg))
|
||||
except StreamClosed:
|
||||
logger.debug(
|
||||
"Fail to responed to iwant request from %s: stream closed",
|
||||
sender_peer_id,
|
||||
)
|
||||
self.pubsub._handle_dead_peer(sender_peer_id)
|
||||
|
||||
async def handle_graft(
|
||||
self, graft_msg: rpc_pb2.ControlGraft, sender_peer_id: ID
|
||||
@ -975,6 +993,8 @@ class GossipSub(IPubsubRouter, Service):
|
||||
packet: rpc_pb2.RPC = rpc_pb2.RPC()
|
||||
packet.control.CopyFrom(control_msg)
|
||||
|
||||
rpc_msg: bytes = packet.SerializeToString()
|
||||
|
||||
# Get stream for peer from pubsub
|
||||
if to_peer not in self.pubsub.peers:
|
||||
logger.debug(
|
||||
@ -984,4 +1004,8 @@ class GossipSub(IPubsubRouter, Service):
|
||||
peer_stream = self.pubsub.peers[to_peer]
|
||||
|
||||
# Write rpc to stream
|
||||
await self.pubsub.write_msg(peer_stream, packet)
|
||||
try:
|
||||
await peer_stream.write(encode_varint_prefixed(rpc_msg))
|
||||
except StreamClosed:
|
||||
logger.debug("Fail to emit control message to %s: stream closed", to_peer)
|
||||
self.pubsub._handle_dead_peer(to_peer)
|
||||
|
||||
@ -11,6 +11,10 @@ import functools
|
||||
import hashlib
|
||||
import logging
|
||||
import time
|
||||
from typing import (
|
||||
NamedTuple,
|
||||
cast,
|
||||
)
|
||||
|
||||
import base58
|
||||
import trio
|
||||
@ -26,6 +30,8 @@ from libp2p.crypto.keys import (
|
||||
PrivateKey,
|
||||
)
|
||||
from libp2p.custom_types import (
|
||||
AsyncValidatorFn,
|
||||
SyncValidatorFn,
|
||||
TProtocol,
|
||||
ValidatorFn,
|
||||
)
|
||||
@ -60,7 +66,6 @@ from libp2p.utils import (
|
||||
encode_varint_prefixed,
|
||||
read_varint_prefixed_bytes,
|
||||
)
|
||||
from libp2p.utils.varint import encode_uvarint
|
||||
|
||||
from .pb import (
|
||||
rpc_pb2,
|
||||
@ -71,11 +76,6 @@ from .pubsub_notifee import (
|
||||
from .subscription import (
|
||||
TrioSubscriptionAPI,
|
||||
)
|
||||
from .validation_throttler import (
|
||||
TopicValidator,
|
||||
ValidationResult,
|
||||
ValidationThrottler,
|
||||
)
|
||||
from .validators import (
|
||||
PUBSUB_SIGNING_PREFIX,
|
||||
signature_validator,
|
||||
@ -96,6 +96,11 @@ def get_content_addressed_msg_id(msg: rpc_pb2.Message) -> bytes:
|
||||
return base64.b64encode(hashlib.sha256(msg.data).digest())
|
||||
|
||||
|
||||
class TopicValidator(NamedTuple):
|
||||
validator: ValidatorFn
|
||||
is_async: bool
|
||||
|
||||
|
||||
class Pubsub(Service, IPubsub):
|
||||
host: IHost
|
||||
|
||||
@ -137,11 +142,6 @@ class Pubsub(Service, IPubsub):
|
||||
msg_id_constructor: Callable[
|
||||
[rpc_pb2.Message], bytes
|
||||
] = get_peer_and_seqno_msg_id,
|
||||
# TODO: these values have been copied from Go, but try to tune these dynamically
|
||||
validation_queue_size: int = 32,
|
||||
global_throttle_limit: int = 8192,
|
||||
default_topic_throttle_limit: int = 1024,
|
||||
validation_worker_count: int | None = None,
|
||||
) -> None:
|
||||
"""
|
||||
Construct a new Pubsub object, which is responsible for handling all
|
||||
@ -202,15 +202,7 @@ class Pubsub(Service, IPubsub):
|
||||
# Create peers map, which maps peer_id (as string) to stream (to a given peer)
|
||||
self.peers = {}
|
||||
|
||||
# Validation Throttler
|
||||
self.validation_throttler = ValidationThrottler(
|
||||
queue_size=validation_queue_size,
|
||||
global_throttle_limit=global_throttle_limit,
|
||||
default_topic_throttle_limit=default_topic_throttle_limit,
|
||||
worker_count=validation_worker_count or 4,
|
||||
)
|
||||
|
||||
# Keep a mapping of topic -> TopicValidator for easier lookup
|
||||
# Map of topic to topic validator
|
||||
self.topic_validators = {}
|
||||
|
||||
self.counter = int(time.time())
|
||||
@ -222,19 +214,10 @@ class Pubsub(Service, IPubsub):
|
||||
self.event_handle_dead_peer_queue_started = trio.Event()
|
||||
|
||||
async def run(self) -> None:
|
||||
self.manager.run_daemon_task(self._start_validation_throttler)
|
||||
self.manager.run_daemon_task(self.handle_peer_queue)
|
||||
self.manager.run_daemon_task(self.handle_dead_peer_queue)
|
||||
await self.manager.wait_finished()
|
||||
|
||||
async def _start_validation_throttler(self) -> None:
|
||||
"""Start validation throttler in current nursery context"""
|
||||
async with trio.open_nursery() as nursery:
|
||||
await self.validation_throttler.start(nursery)
|
||||
# Keep nursery alive until service stops
|
||||
while self.manager.is_running:
|
||||
await self.manager.wait_finished()
|
||||
|
||||
@property
|
||||
def my_id(self) -> ID:
|
||||
return self.host.get_id()
|
||||
@ -314,12 +297,7 @@ class Pubsub(Service, IPubsub):
|
||||
)
|
||||
|
||||
def set_topic_validator(
|
||||
self,
|
||||
topic: str,
|
||||
validator: ValidatorFn,
|
||||
is_async_validator: bool,
|
||||
timeout: float | None = None,
|
||||
throttle_limit: int | None = None,
|
||||
self, topic: str, validator: ValidatorFn, is_async_validator: bool
|
||||
) -> None:
|
||||
"""
|
||||
Register a validator under the given topic. One topic can only have one
|
||||
@ -328,18 +306,8 @@ class Pubsub(Service, IPubsub):
|
||||
:param topic: the topic to register validator under
|
||||
:param validator: the validator used to validate messages published to the topic
|
||||
:param is_async_validator: indicate if the validator is an asynchronous validator
|
||||
:param timeout: optional timeout for the validator
|
||||
:param throttle_limit: optional throttle limit for the validator
|
||||
""" # noqa: E501
|
||||
# Create throttled topic validator
|
||||
topic_validator = self.validation_throttler.create_topic_validator(
|
||||
topic=topic,
|
||||
validator=validator,
|
||||
is_async=is_async_validator,
|
||||
timeout=timeout,
|
||||
throttle_limit=throttle_limit,
|
||||
)
|
||||
self.topic_validators[topic] = topic_validator
|
||||
self.topic_validators[topic] = TopicValidator(validator, is_async_validator)
|
||||
|
||||
def remove_topic_validator(self, topic: str) -> None:
|
||||
"""
|
||||
@ -349,18 +317,17 @@ class Pubsub(Service, IPubsub):
|
||||
"""
|
||||
self.topic_validators.pop(topic, None)
|
||||
|
||||
def get_msg_validators(self, msg: rpc_pb2.Message) -> list[TopicValidator]:
|
||||
def get_msg_validators(self, msg: rpc_pb2.Message) -> tuple[TopicValidator, ...]:
|
||||
"""
|
||||
Get all validators corresponding to the topics in the message.
|
||||
|
||||
:param msg: the message published to the topic
|
||||
:return: list of topic validators for the message's topics
|
||||
"""
|
||||
return [
|
||||
return tuple(
|
||||
self.topic_validators[topic]
|
||||
for topic in msg.topicIDs
|
||||
if topic in self.topic_validators
|
||||
]
|
||||
)
|
||||
|
||||
def add_to_blacklist(self, peer_id: ID) -> None:
|
||||
"""
|
||||
@ -696,56 +663,38 @@ class Pubsub(Service, IPubsub):
|
||||
:param msg_forwarder: the peer who forward us the message.
|
||||
:param msg: the message.
|
||||
"""
|
||||
# Get applicable validators for this message
|
||||
validators = self.get_msg_validators(msg)
|
||||
sync_topic_validators: list[SyncValidatorFn] = []
|
||||
async_topic_validators: list[AsyncValidatorFn] = []
|
||||
for topic_validator in self.get_msg_validators(msg):
|
||||
if topic_validator.is_async:
|
||||
async_topic_validators.append(
|
||||
cast(AsyncValidatorFn, topic_validator.validator)
|
||||
)
|
||||
else:
|
||||
sync_topic_validators.append(
|
||||
cast(SyncValidatorFn, topic_validator.validator)
|
||||
)
|
||||
|
||||
if not validators:
|
||||
# No validators, accept immediately
|
||||
return
|
||||
for validator in sync_topic_validators:
|
||||
if not validator(msg_forwarder, msg):
|
||||
raise ValidationError(f"Validation failed for msg={msg}")
|
||||
|
||||
# Use trio.Event for async coordination
|
||||
validation_event = trio.Event()
|
||||
result_container: dict[str, ValidationResult | None | Exception] = {
|
||||
"result": None,
|
||||
"error": None,
|
||||
}
|
||||
# TODO: Implement throttle on async validators
|
||||
|
||||
def handle_validation_result(
|
||||
result: ValidationResult, error: Exception | None
|
||||
) -> None:
|
||||
result_container["result"] = result
|
||||
result_container["error"] = error
|
||||
validation_event.set()
|
||||
if len(async_topic_validators) > 0:
|
||||
# Appends to lists are thread safe in CPython
|
||||
results = []
|
||||
|
||||
# Submit for throttled validation
|
||||
success = await self.validation_throttler.submit_validation(
|
||||
validators=validators,
|
||||
msg_forwarder=msg_forwarder,
|
||||
msg=msg,
|
||||
result_callback=handle_validation_result,
|
||||
)
|
||||
async def run_async_validator(func: AsyncValidatorFn) -> None:
|
||||
result = await func(msg_forwarder, msg)
|
||||
results.append(result)
|
||||
|
||||
if not success:
|
||||
# Validation was throttled at queue level
|
||||
raise ValidationError("Validation throttled at queue level")
|
||||
async with trio.open_nursery() as nursery:
|
||||
for async_validator in async_topic_validators:
|
||||
nursery.start_soon(run_async_validator, async_validator)
|
||||
|
||||
# Wait for validation result
|
||||
await validation_event.wait()
|
||||
|
||||
result = result_container["result"]
|
||||
error = result_container["error"]
|
||||
|
||||
if error:
|
||||
raise ValidationError(f"Validation error: {error}")
|
||||
|
||||
if result == ValidationResult.REJECT:
|
||||
raise ValidationError("Message validation rejected")
|
||||
elif result == ValidationResult.THROTTLED:
|
||||
raise ValidationError("Message validation throttled")
|
||||
elif result == ValidationResult.IGNORE:
|
||||
# Treat IGNORE as rejection for now, or you could silently drop
|
||||
raise ValidationError("Message validation ignored")
|
||||
# ACCEPT case - just return normally
|
||||
if not all(results):
|
||||
raise ValidationError(f"Validation failed for msg={msg}")
|
||||
|
||||
async def push_msg(self, msg_forwarder: ID, msg: rpc_pb2.Message) -> None:
|
||||
"""
|
||||
@ -829,43 +778,3 @@ class Pubsub(Service, IPubsub):
|
||||
|
||||
def _is_subscribed_to_msg(self, msg: rpc_pb2.Message) -> bool:
|
||||
return any(topic in self.topic_ids for topic in msg.topicIDs)
|
||||
|
||||
async def write_msg(self, stream: INetStream, rpc_msg: rpc_pb2.RPC) -> bool:
|
||||
"""
|
||||
Write an RPC message to a stream with proper error handling.
|
||||
|
||||
Implements WriteMsg similar to go-msgio which is used in go-libp2p
|
||||
Ref: https://github.com/libp2p/go-msgio/blob/master/protoio/uvarint_writer.go#L56
|
||||
|
||||
|
||||
:param stream: stream to write the message to
|
||||
:param rpc_msg: RPC message to write
|
||||
:return: True if successful, False if stream was closed
|
||||
"""
|
||||
try:
|
||||
# Calculate message size first
|
||||
msg_bytes = rpc_msg.SerializeToString()
|
||||
msg_size = len(msg_bytes)
|
||||
|
||||
# Calculate varint size and allocate exact buffer size needed
|
||||
|
||||
varint_bytes = encode_uvarint(msg_size)
|
||||
varint_size = len(varint_bytes)
|
||||
|
||||
# Allocate buffer with exact size (like Go's pool.Get())
|
||||
buf = bytearray(varint_size + msg_size)
|
||||
|
||||
# Write varint length prefix to buffer (like Go's binary.PutUvarint())
|
||||
buf[:varint_size] = varint_bytes
|
||||
|
||||
# Write serialized message after varint (like Go's rpc.MarshalTo())
|
||||
buf[varint_size:] = msg_bytes
|
||||
|
||||
# Single write operation (like Go's s.Write(buf))
|
||||
await stream.write(bytes(buf))
|
||||
return True
|
||||
except StreamClosed:
|
||||
peer_id = stream.muxed_conn.peer_id
|
||||
logger.debug("Fail to write message to %s: stream closed", peer_id)
|
||||
self._handle_dead_peer(peer_id)
|
||||
return False
|
||||
|
||||
@ -1,314 +0,0 @@
|
||||
from collections.abc import (
|
||||
Callable,
|
||||
)
|
||||
from dataclasses import dataclass
|
||||
from enum import Enum
|
||||
import logging
|
||||
from typing import (
|
||||
NamedTuple,
|
||||
cast,
|
||||
)
|
||||
|
||||
import trio
|
||||
|
||||
from libp2p.custom_types import AsyncValidatorFn, ValidatorFn
|
||||
from libp2p.peer.id import (
|
||||
ID,
|
||||
)
|
||||
|
||||
from .pb import (
|
||||
rpc_pb2,
|
||||
)
|
||||
|
||||
logger = logging.getLogger("libp2p.pubsub.validation")
|
||||
|
||||
|
||||
class ValidationResult(Enum):
|
||||
ACCEPT = "accept"
|
||||
REJECT = "reject"
|
||||
IGNORE = "ignore"
|
||||
THROTTLED = "throttled"
|
||||
|
||||
|
||||
@dataclass
|
||||
class ValidationRequest:
|
||||
"""Request for message validation"""
|
||||
|
||||
validators: list["TopicValidator"]
|
||||
msg_forwarder: ID # peer ID
|
||||
msg: rpc_pb2.Message # message object
|
||||
result_callback: Callable[[ValidationResult, Exception | None], None]
|
||||
|
||||
|
||||
class TopicValidator(NamedTuple):
|
||||
topic: str
|
||||
validator: ValidatorFn
|
||||
is_async: bool
|
||||
timeout: float | None = None
|
||||
# Per-topic throttle semaphore
|
||||
throttle_semaphore: trio.Semaphore | None = None
|
||||
|
||||
|
||||
class ValidationThrottler:
|
||||
"""Manages all validation throttling mechanisms"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
queue_size: int = 32,
|
||||
global_throttle_limit: int = 8192,
|
||||
default_topic_throttle_limit: int = 1024,
|
||||
worker_count: int | None = None,
|
||||
):
|
||||
# 1. Queue-level throttling - bounded memory channel
|
||||
self._validation_send, self._validation_receive = trio.open_memory_channel[
|
||||
ValidationRequest
|
||||
](queue_size)
|
||||
|
||||
# 2. Global validation throttling - limits total concurrent async validations
|
||||
self._global_throttle = trio.Semaphore(global_throttle_limit)
|
||||
|
||||
# 3. Per-topic throttling - each validator gets its own semaphore
|
||||
self._default_topic_throttle_limit = default_topic_throttle_limit
|
||||
|
||||
# Worker management
|
||||
# TODO: Find a better way to manage worker count
|
||||
self._worker_count = worker_count or 4
|
||||
self._running = False
|
||||
|
||||
async def start(self, nursery: trio.Nursery) -> None:
|
||||
"""Start the validation workers"""
|
||||
self._running = True
|
||||
|
||||
# Start validation worker tasks
|
||||
for i in range(self._worker_count):
|
||||
nursery.start_soon(self._validation_worker, f"worker-{i}")
|
||||
|
||||
async def stop(self) -> None:
|
||||
"""Stop the validation system"""
|
||||
self._running = False
|
||||
await self._validation_send.aclose()
|
||||
|
||||
def create_topic_validator(
|
||||
self,
|
||||
topic: str,
|
||||
validator: ValidatorFn,
|
||||
is_async: bool,
|
||||
timeout: float | None = None,
|
||||
throttle_limit: int | None = None,
|
||||
) -> TopicValidator:
|
||||
"""Create a new topic validator with its own throttle"""
|
||||
limit = throttle_limit or self._default_topic_throttle_limit
|
||||
throttle_sem = trio.Semaphore(limit)
|
||||
|
||||
return TopicValidator(
|
||||
topic=topic,
|
||||
validator=validator,
|
||||
is_async=is_async,
|
||||
timeout=timeout,
|
||||
throttle_semaphore=throttle_sem,
|
||||
)
|
||||
|
||||
async def submit_validation(
|
||||
self,
|
||||
validators: list[TopicValidator],
|
||||
msg_forwarder: ID,
|
||||
msg: rpc_pb2.Message,
|
||||
result_callback: Callable[[ValidationResult, Exception | None], None],
|
||||
) -> bool:
|
||||
"""
|
||||
Submit a message for validation.
|
||||
Returns True if queued successfully, False if queue is full (throttled).
|
||||
"""
|
||||
if not self._running:
|
||||
result_callback(
|
||||
ValidationResult.REJECT, Exception("Validation system not running")
|
||||
)
|
||||
return False
|
||||
|
||||
request = ValidationRequest(
|
||||
validators=validators,
|
||||
msg_forwarder=msg_forwarder,
|
||||
msg=msg,
|
||||
result_callback=result_callback,
|
||||
)
|
||||
|
||||
try:
|
||||
# This will raise trio.WouldBlock if queue is full
|
||||
self._validation_send.send_nowait(request)
|
||||
return True
|
||||
except trio.WouldBlock:
|
||||
# Queue-level throttling: drop the message
|
||||
logger.debug(
|
||||
"Validation queue full, dropping message from %s", msg_forwarder
|
||||
)
|
||||
result_callback(
|
||||
ValidationResult.THROTTLED, Exception("Validation queue full")
|
||||
)
|
||||
return False
|
||||
|
||||
async def _validation_worker(self, worker_id: str) -> None:
|
||||
"""Worker that processes validation requests"""
|
||||
logger.debug("Validation worker %s started", worker_id)
|
||||
|
||||
async with self._validation_receive:
|
||||
async for request in self._validation_receive:
|
||||
if not self._running:
|
||||
break
|
||||
|
||||
try:
|
||||
# Process the validation request
|
||||
result = await self._validate_message(request)
|
||||
request.result_callback(result, None)
|
||||
except Exception as e:
|
||||
logger.exception("Error in validation worker %s", worker_id)
|
||||
request.result_callback(ValidationResult.REJECT, e)
|
||||
|
||||
logger.debug("Validation worker %s stopped", worker_id)
|
||||
|
||||
async def _validate_message(self, request: ValidationRequest) -> ValidationResult:
|
||||
"""Core validation logic with throttling"""
|
||||
validators = request.validators
|
||||
msg_forwarder = request.msg_forwarder
|
||||
msg = request.msg
|
||||
|
||||
if not validators:
|
||||
return ValidationResult.ACCEPT
|
||||
|
||||
# Separate sync and async validators
|
||||
sync_validators = [v for v in validators if not v.is_async]
|
||||
async_validators = [v for v in validators if v.is_async]
|
||||
|
||||
# Run synchronous validators first
|
||||
for validator in sync_validators:
|
||||
try:
|
||||
# Apply per-topic throttling even for sync validators
|
||||
if validator.throttle_semaphore:
|
||||
validator.throttle_semaphore.acquire_nowait()
|
||||
try:
|
||||
result = validator.validator(msg_forwarder, msg)
|
||||
if not result:
|
||||
return ValidationResult.REJECT
|
||||
finally:
|
||||
validator.throttle_semaphore.release()
|
||||
else:
|
||||
result = validator.validator(msg_forwarder, msg)
|
||||
if not result:
|
||||
return ValidationResult.REJECT
|
||||
except trio.WouldBlock:
|
||||
# Per-topic throttling for sync validator
|
||||
logger.debug("Sync validation throttled for topic %s", validator.topic)
|
||||
return ValidationResult.THROTTLED
|
||||
except Exception as e:
|
||||
logger.exception(
|
||||
"Sync validator failed for topic %s: %s", validator.topic, e
|
||||
)
|
||||
return ValidationResult.REJECT
|
||||
|
||||
# Handle async validators with global + per-topic throttling
|
||||
if async_validators:
|
||||
return await self._validate_async_validators(
|
||||
async_validators, msg_forwarder, msg
|
||||
)
|
||||
|
||||
return ValidationResult.ACCEPT
|
||||
|
||||
async def _validate_async_validators(
|
||||
self, validators: list[TopicValidator], msg_forwarder: ID, msg: rpc_pb2.Message
|
||||
) -> ValidationResult:
|
||||
"""Handle async validators with proper throttling"""
|
||||
if len(validators) == 1:
|
||||
# Fast path for single validator
|
||||
return await self._validate_single_async_validator(
|
||||
validators[0], msg_forwarder, msg
|
||||
)
|
||||
|
||||
# Multiple async validators - run them concurrently
|
||||
try:
|
||||
# Try to acquire global throttle slot
|
||||
self._global_throttle.acquire_nowait()
|
||||
except trio.WouldBlock:
|
||||
logger.debug(
|
||||
"Global validation throttle exceeded, dropping message from %s",
|
||||
msg_forwarder,
|
||||
)
|
||||
return ValidationResult.THROTTLED
|
||||
|
||||
try:
|
||||
async with trio.open_nursery() as nursery:
|
||||
results = {}
|
||||
|
||||
async def run_validator(validator: TopicValidator, index: int) -> None:
|
||||
"""Run a single async validator and store the result"""
|
||||
nonlocal results
|
||||
result = await self._validate_single_async_validator(
|
||||
validator, msg_forwarder, msg
|
||||
)
|
||||
results[index] = result
|
||||
|
||||
# Start all validators concurrently
|
||||
for i, validator in enumerate(validators):
|
||||
nursery.start_soon(run_validator, validator, i)
|
||||
|
||||
# Process results - any reject or throttle causes overall failure
|
||||
final_result = ValidationResult.ACCEPT
|
||||
for result in results.values():
|
||||
if result == ValidationResult.REJECT:
|
||||
return ValidationResult.REJECT
|
||||
elif result == ValidationResult.THROTTLED:
|
||||
final_result = ValidationResult.THROTTLED
|
||||
elif (
|
||||
result == ValidationResult.IGNORE
|
||||
and final_result == ValidationResult.ACCEPT
|
||||
):
|
||||
final_result = ValidationResult.IGNORE
|
||||
|
||||
return final_result
|
||||
|
||||
finally:
|
||||
self._global_throttle.release()
|
||||
|
||||
return ValidationResult.IGNORE
|
||||
|
||||
async def _validate_single_async_validator(
|
||||
self, validator: TopicValidator, msg_forwarder: ID, msg: rpc_pb2.Message
|
||||
) -> ValidationResult:
|
||||
"""Validate with a single async validator"""
|
||||
# Apply per-topic throttling
|
||||
if validator.throttle_semaphore:
|
||||
try:
|
||||
validator.throttle_semaphore.acquire_nowait()
|
||||
except trio.WouldBlock:
|
||||
logger.debug(
|
||||
"Per-topic validation throttled for topic %s", validator.topic
|
||||
)
|
||||
return ValidationResult.THROTTLED
|
||||
else:
|
||||
# Fallback if no throttle semaphore configured
|
||||
pass
|
||||
|
||||
try:
|
||||
# Apply timeout if configured
|
||||
result: bool
|
||||
if validator.timeout:
|
||||
with trio.fail_after(validator.timeout):
|
||||
func = cast(AsyncValidatorFn, validator.validator)
|
||||
result = await func(msg_forwarder, msg)
|
||||
else:
|
||||
func = cast(AsyncValidatorFn, validator.validator)
|
||||
result = await func(msg_forwarder, msg)
|
||||
|
||||
return ValidationResult.ACCEPT if result else ValidationResult.REJECT
|
||||
|
||||
except trio.TooSlowError:
|
||||
logger.debug("Validation timeout for topic %s", validator.topic)
|
||||
return ValidationResult.IGNORE
|
||||
except Exception as e:
|
||||
logger.exception(
|
||||
"Async validator failed for topic %s: %s", validator.topic, e
|
||||
)
|
||||
return ValidationResult.REJECT
|
||||
finally:
|
||||
if validator.throttle_semaphore:
|
||||
validator.throttle_semaphore.release()
|
||||
|
||||
return ValidationResult.IGNORE
|
||||
@ -234,8 +234,7 @@ class RelayDiscovery(Service):
|
||||
|
||||
if not callable(proto_getter):
|
||||
return None
|
||||
if peer_id not in peerstore.peer_ids():
|
||||
return None
|
||||
|
||||
try:
|
||||
# Try to get protocols
|
||||
proto_result = proto_getter(peer_id)
|
||||
@ -284,6 +283,8 @@ class RelayDiscovery(Service):
|
||||
return None
|
||||
|
||||
mux = self.host.get_mux()
|
||||
if not hasattr(mux, "protocols"):
|
||||
return None
|
||||
|
||||
peer_protocols = set()
|
||||
# Get protocols from mux with proper type safety
|
||||
@ -292,9 +293,7 @@ class RelayDiscovery(Service):
|
||||
# Get protocols with proper typing
|
||||
mux_protocols = mux.get_protocols()
|
||||
if isinstance(mux_protocols, (list, tuple)):
|
||||
available_protocols = [
|
||||
p for p in mux.get_protocols() if p is not None
|
||||
]
|
||||
available_protocols = list(mux_protocols)
|
||||
|
||||
for protocol in available_protocols:
|
||||
try:
|
||||
@ -314,7 +313,7 @@ class RelayDiscovery(Service):
|
||||
|
||||
self._protocol_cache[peer_id] = peer_protocols
|
||||
protocol_str = str(PROTOCOL_ID)
|
||||
for protocol in map(TProtocol, peer_protocols):
|
||||
for protocol in peer_protocols:
|
||||
if protocol == protocol_str:
|
||||
return True
|
||||
return False
|
||||
|
||||
@ -31,6 +31,9 @@ from libp2p.stream_muxer.yamux.yamux import (
|
||||
Yamux,
|
||||
)
|
||||
|
||||
# FIXME: add negotiate timeout to `MuxerMultistream`
|
||||
DEFAULT_NEGOTIATE_TIMEOUT = 60
|
||||
|
||||
|
||||
class MuxerMultistream:
|
||||
"""
|
||||
|
||||
@ -98,31 +98,15 @@ class YamuxStream(IMuxedStream):
|
||||
# Flow control: Check if we have enough send window
|
||||
total_len = len(data)
|
||||
sent = 0
|
||||
logging.debug(f"Stream {self.stream_id}: Starts writing {total_len} bytes ")
|
||||
while sent < total_len:
|
||||
# Wait for available window with timeout
|
||||
timeout = False
|
||||
async with self.window_lock:
|
||||
if self.send_window == 0:
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Window is zero, waiting for update"
|
||||
)
|
||||
# Release lock and wait with timeout
|
||||
self.window_lock.release()
|
||||
# To avoid re-acquiring the lock immediately,
|
||||
with trio.move_on_after(5.0) as cancel_scope:
|
||||
while self.send_window == 0 and not self.closed:
|
||||
await trio.sleep(0.01)
|
||||
# If we timed out, cancel the scope
|
||||
timeout = cancel_scope.cancelled_caught
|
||||
# Re-acquire lock
|
||||
await self.window_lock.acquire()
|
||||
|
||||
# If we timed out waiting for window update, raise an error
|
||||
if timeout:
|
||||
raise MuxedStreamError(
|
||||
"Timed out waiting for window update after 5 seconds."
|
||||
)
|
||||
while sent < total_len:
|
||||
async with self.window_lock:
|
||||
# Wait for available window
|
||||
while self.send_window == 0 and not self.closed:
|
||||
# Release lock while waiting
|
||||
self.window_lock.release()
|
||||
await trio.sleep(0.01)
|
||||
await self.window_lock.acquire()
|
||||
|
||||
if self.closed:
|
||||
raise MuxedStreamError("Stream is closed")
|
||||
@ -139,45 +123,25 @@ class YamuxStream(IMuxedStream):
|
||||
await self.conn.secured_conn.write(header + chunk)
|
||||
sent += to_send
|
||||
|
||||
async def send_window_update(self, increment: int, skip_lock: bool = False) -> None:
|
||||
"""
|
||||
Send a window update to peer.
|
||||
# If window is getting low, consider updating
|
||||
if self.send_window < DEFAULT_WINDOW_SIZE // 2:
|
||||
await self.send_window_update()
|
||||
|
||||
async def send_window_update(self, increment: int | None = None) -> None:
|
||||
"""Send a window update to peer."""
|
||||
if increment is None:
|
||||
increment = DEFAULT_WINDOW_SIZE - self.recv_window
|
||||
|
||||
param:increment: The amount to increment the window size by.
|
||||
If None, uses the difference between DEFAULT_WINDOW_SIZE
|
||||
and current receive window.
|
||||
param:skip_lock (bool): If True, skips acquiring window_lock.
|
||||
This should only be used when calling from a context
|
||||
that already holds the lock.
|
||||
"""
|
||||
if increment <= 0:
|
||||
# If increment is zero or negative, skip sending update
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Skipping window update"
|
||||
f"(increment={increment})"
|
||||
)
|
||||
return
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Sending window update with increment={increment}"
|
||||
)
|
||||
|
||||
async def _do_window_update() -> None:
|
||||
async with self.window_lock:
|
||||
self.recv_window += increment
|
||||
header = struct.pack(
|
||||
YAMUX_HEADER_FORMAT,
|
||||
0,
|
||||
TYPE_WINDOW_UPDATE,
|
||||
0,
|
||||
self.stream_id,
|
||||
increment,
|
||||
YAMUX_HEADER_FORMAT, 0, TYPE_WINDOW_UPDATE, 0, self.stream_id, increment
|
||||
)
|
||||
await self.conn.secured_conn.write(header)
|
||||
|
||||
if skip_lock:
|
||||
await _do_window_update()
|
||||
else:
|
||||
async with self.window_lock:
|
||||
await _do_window_update()
|
||||
|
||||
async def read(self, n: int | None = -1) -> bytes:
|
||||
# Handle None value for n by converting it to -1
|
||||
if n is None:
|
||||
@ -190,68 +154,55 @@ class YamuxStream(IMuxedStream):
|
||||
)
|
||||
raise MuxedStreamEOF("Stream is closed for receiving")
|
||||
|
||||
# If reading until EOF (n == -1), block until stream is closed
|
||||
if n == -1:
|
||||
data = b""
|
||||
while not self.conn.event_shutting_down.is_set():
|
||||
while not self.recv_closed and not self.conn.event_shutting_down.is_set():
|
||||
# Check if there's data in the buffer
|
||||
buffer = self.conn.stream_buffers.get(self.stream_id)
|
||||
if buffer and len(buffer) > 0:
|
||||
# Wait for closure even if data is available
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}:Waiting for FIN before returning data"
|
||||
)
|
||||
await self.conn.stream_events[self.stream_id].wait()
|
||||
self.conn.stream_events[self.stream_id] = trio.Event()
|
||||
else:
|
||||
# No data, wait for data or closure
|
||||
logging.debug(f"Stream {self.stream_id}: Waiting for data or FIN")
|
||||
await self.conn.stream_events[self.stream_id].wait()
|
||||
self.conn.stream_events[self.stream_id] = trio.Event()
|
||||
|
||||
# If buffer is not available, check if stream is closed
|
||||
# After loop, check if stream is closed or shutting down
|
||||
async with self.conn.streams_lock:
|
||||
if self.conn.event_shutting_down.is_set():
|
||||
logging.debug(f"Stream {self.stream_id}: Connection shutting down")
|
||||
raise MuxedStreamEOF("Connection shut down")
|
||||
if self.closed:
|
||||
if self.reset_received:
|
||||
logging.debug(f"Stream {self.stream_id}: Stream was reset")
|
||||
raise MuxedStreamReset("Stream was reset")
|
||||
else:
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Stream closed cleanly (EOF)"
|
||||
)
|
||||
raise MuxedStreamEOF("Stream closed cleanly (EOF)")
|
||||
buffer = self.conn.stream_buffers.get(self.stream_id)
|
||||
if buffer is None:
|
||||
logging.debug(f"Stream {self.stream_id}: No buffer available")
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Buffer gone, assuming closed"
|
||||
)
|
||||
raise MuxedStreamEOF("Stream buffer closed")
|
||||
|
||||
# If we have data in buffer, process it
|
||||
if len(buffer) > 0:
|
||||
chunk = bytes(buffer)
|
||||
buffer.clear()
|
||||
data += chunk
|
||||
|
||||
# Send window update for the chunk we just read
|
||||
async with self.window_lock:
|
||||
self.recv_window += len(chunk)
|
||||
logging.debug(f"Stream {self.stream_id}: Update {len(chunk)}")
|
||||
await self.send_window_update(len(chunk), skip_lock=True)
|
||||
|
||||
# If stream is closed (FIN received) and buffer is empty, break
|
||||
if self.recv_closed and len(buffer) == 0:
|
||||
logging.debug(f"Stream {self.stream_id}: Closed with empty buffer")
|
||||
break
|
||||
|
||||
# If stream was reset, raise reset error
|
||||
if self.reset_received:
|
||||
logging.debug(f"Stream {self.stream_id}: Stream was reset")
|
||||
raise MuxedStreamReset("Stream was reset")
|
||||
|
||||
# Wait for more data or stream closure
|
||||
logging.debug(f"Stream {self.stream_id}: Waiting for data or FIN")
|
||||
await self.conn.stream_events[self.stream_id].wait()
|
||||
self.conn.stream_events[self.stream_id] = trio.Event()
|
||||
|
||||
# After loop exit, first check if we have data to return
|
||||
if data:
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Returning {len(data)} bytes after loop"
|
||||
)
|
||||
logging.debug(f"Stream {self.stream_id}: EOF reached")
|
||||
raise MuxedStreamEOF("Stream is closed for receiving")
|
||||
# Return all buffered data
|
||||
data = bytes(buffer)
|
||||
buffer.clear()
|
||||
logging.debug(f"Stream {self.stream_id}: Returning {len(data)} bytes")
|
||||
return data
|
||||
|
||||
# No data accumulated, now check why we exited the loop
|
||||
if self.conn.event_shutting_down.is_set():
|
||||
logging.debug(f"Stream {self.stream_id}: Connection shutting down")
|
||||
raise MuxedStreamEOF("Connection shut down")
|
||||
|
||||
# Return empty data
|
||||
return b""
|
||||
else:
|
||||
data = await self.conn.read_stream(self.stream_id, n)
|
||||
async with self.window_lock:
|
||||
self.recv_window += len(data)
|
||||
logging.debug(
|
||||
f"Stream {self.stream_id}: Sending window update after read, "
|
||||
f"increment={len(data)}"
|
||||
)
|
||||
await self.send_window_update(len(data), skip_lock=True)
|
||||
return data
|
||||
# For specific size read (n > 0), return available data immediately
|
||||
return await self.conn.read_stream(self.stream_id, n)
|
||||
|
||||
async def close(self) -> None:
|
||||
if not self.send_closed:
|
||||
@ -542,7 +493,7 @@ class Yamux(IMuxedConn):
|
||||
f"type={typ}, flags={flags}, stream_id={stream_id},"
|
||||
f"length={length}"
|
||||
)
|
||||
if (typ == TYPE_DATA or typ == TYPE_WINDOW_UPDATE) and flags & FLAG_SYN:
|
||||
if typ == TYPE_DATA and flags & FLAG_SYN:
|
||||
async with self.streams_lock:
|
||||
if stream_id not in self.streams:
|
||||
stream = YamuxStream(stream_id, self, False)
|
||||
|
||||
@ -7,8 +7,6 @@ from libp2p.utils.varint import (
|
||||
encode_varint_prefixed,
|
||||
read_delim,
|
||||
read_varint_prefixed_bytes,
|
||||
decode_varint_from_bytes,
|
||||
decode_varint_with_size,
|
||||
)
|
||||
from libp2p.utils.version import (
|
||||
get_agent_version,
|
||||
@ -22,6 +20,4 @@ __all__ = [
|
||||
"get_agent_version",
|
||||
"read_delim",
|
||||
"read_varint_prefixed_bytes",
|
||||
"decode_varint_from_bytes",
|
||||
"decode_varint_with_size",
|
||||
]
|
||||
|
||||
@ -39,38 +39,12 @@ def encode_uvarint(number: int) -> bytes:
|
||||
return buf
|
||||
|
||||
|
||||
def decode_varint_from_bytes(data: bytes) -> int:
|
||||
"""
|
||||
Decode a varint from bytes and return the value.
|
||||
|
||||
This is a synchronous version of decode_uvarint_from_stream for already-read bytes.
|
||||
"""
|
||||
res = 0
|
||||
for shift in itertools.count(0, 7):
|
||||
if shift > SHIFT_64_BIT_MAX:
|
||||
raise ParseError("Integer is too large...")
|
||||
|
||||
if not data:
|
||||
raise ParseError("Unexpected end of data")
|
||||
|
||||
value = data[0]
|
||||
data = data[1:]
|
||||
|
||||
res += (value & LOW_MASK) << shift
|
||||
|
||||
if not value & HIGH_MASK:
|
||||
break
|
||||
return res
|
||||
|
||||
|
||||
async def decode_uvarint_from_stream(reader: Reader) -> int:
|
||||
"""https://en.wikipedia.org/wiki/LEB128."""
|
||||
res = 0
|
||||
for shift in itertools.count(0, 7):
|
||||
if shift > SHIFT_64_BIT_MAX:
|
||||
raise ParseError(
|
||||
"Varint decoding error: integer exceeds maximum size of 64 bits."
|
||||
)
|
||||
raise ParseError("TODO: better exception msg: Integer is too large...")
|
||||
|
||||
byte = await read_exactly(reader, 1)
|
||||
value = byte[0]
|
||||
@ -82,33 +56,6 @@ async def decode_uvarint_from_stream(reader: Reader) -> int:
|
||||
return res
|
||||
|
||||
|
||||
def decode_varint_with_size(data: bytes) -> tuple[int, int]:
|
||||
"""
|
||||
Decode a varint from bytes and return (value, bytes_consumed).
|
||||
Returns (0, 0) if the data doesn't start with a valid varint.
|
||||
"""
|
||||
try:
|
||||
# Calculate how many bytes the varint consumes
|
||||
varint_size = 0
|
||||
for i, byte in enumerate(data):
|
||||
varint_size += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
if varint_size == 0:
|
||||
return 0, 0
|
||||
|
||||
# Extract just the varint bytes
|
||||
varint_bytes = data[:varint_size]
|
||||
|
||||
# Decode the varint
|
||||
value = decode_varint_from_bytes(varint_bytes)
|
||||
|
||||
return value, varint_size
|
||||
except Exception:
|
||||
return 0, 0
|
||||
|
||||
|
||||
def encode_varint_prefixed(msg_bytes: bytes) -> bytes:
|
||||
varint_len = encode_uvarint(len(msg_bytes))
|
||||
return varint_len + msg_bytes
|
||||
|
||||
1
newsfragments/579.feature.rst
Normal file
1
newsfragments/579.feature.rst
Normal file
@ -0,0 +1 @@
|
||||
Added support for ``Kademlia DHT`` in py-libp2p.
|
||||
7
newsfragments/631.feature.rst
Normal file
7
newsfragments/631.feature.rst
Normal file
@ -0,0 +1,7 @@
|
||||
Store public key and peer ID in peerstore during handshake
|
||||
|
||||
Modified the InsecureTransport class to accept an optional peerstore parameter and updated the handshake process to store the received public key and peer ID in the peerstore when available.
|
||||
|
||||
Added test cases to verify:
|
||||
1. The peerstore remains unchanged when handshake fails due to peer ID mismatch
|
||||
2. The handshake correctly adds a public key to a peer ID that already exists in the peerstore but doesn't have a public key yet
|
||||
1
newsfragments/678.misc.rst
Normal file
1
newsfragments/678.misc.rst
Normal file
@ -0,0 +1 @@
|
||||
Refactored gossipsub heartbeat logic to use a single helper method `_handle_topic_heartbeat` that handles both fanout and gossip heartbeats.
|
||||
1
newsfragments/679.feature.rst
Normal file
1
newsfragments/679.feature.rst
Normal file
@ -0,0 +1 @@
|
||||
Added sparse connect utility function to pubsub test utilities for creating test networks with configurable connectivity.
|
||||
2
newsfragments/681.breaking.rst
Normal file
2
newsfragments/681.breaking.rst
Normal file
@ -0,0 +1,2 @@
|
||||
Reordered the arguments to `upgrade_security` to place `is_initiator` before `peer_id`, and made `peer_id` optional.
|
||||
This allows the method to reflect the fact that peer identity is not required for inbound connections.
|
||||
1
newsfragments/684.misc.rst
Normal file
1
newsfragments/684.misc.rst
Normal file
@ -0,0 +1 @@
|
||||
Uses the `decapsulate` method of the `Multiaddr` class to clean up the observed address.
|
||||
1
newsfragments/685.feature.rst
Normal file
1
newsfragments/685.feature.rst
Normal file
@ -0,0 +1 @@
|
||||
Optimized pubsub publishing to send multiple topics in a single message instead of separate messages per topic.
|
||||
1
newsfragments/690.feature.rst
Normal file
1
newsfragments/690.feature.rst
Normal file
@ -0,0 +1 @@
|
||||
added peer exchange and backoff logic as part of Gossipsub v1.1 upgrade
|
||||
1
newsfragments/702.bugfix.rst
Normal file
1
newsfragments/702.bugfix.rst
Normal file
@ -0,0 +1 @@
|
||||
Fixed an issue in `Pubsub` where async validators were not handled reliably under concurrency. Now uses a safe aggregator list for consistent behavior.
|
||||
@ -1,3 +0,0 @@
|
||||
Improved type safety in `get_mux()` and `get_protocols()` by returning properly typed values instead
|
||||
of `Any`. Also updated `identify.py` and `discovery.py` to handle `None` values safely and
|
||||
compare protocols correctly.
|
||||
@ -1 +0,0 @@
|
||||
Add comprehensive tests for relay_discovery method in circuit_relay_v2
|
||||
@ -1 +0,0 @@
|
||||
Add logic to clear_peerdata method in peerstore
|
||||
@ -1 +0,0 @@
|
||||
fixed malformed PeerId in test_peerinfo
|
||||
@ -1 +0,0 @@
|
||||
fixed a typecheck error using cast in peerinfo.py
|
||||
@ -1 +0,0 @@
|
||||
Improve error message under the function decode_uvarint_from_stream in libp2p/utils/varint.py file
|
||||
@ -1 +0,0 @@
|
||||
identify protocol use now prefix-length messages by default. use use_varint_format param for old raw messages
|
||||
@ -1 +0,0 @@
|
||||
add length-prefixed support to identify protocol
|
||||
@ -1 +0,0 @@
|
||||
Fix raw format reading in identify/push protocol and add comprehensive test coverage for both varint and raw formats
|
||||
@ -1,10 +1,11 @@
|
||||
|
||||
[build-system]
|
||||
requires = ["setuptools>=42", "wheel"]
|
||||
build-backend = "setuptools.build_meta"
|
||||
|
||||
[project]
|
||||
name = "libp2p"
|
||||
version = "0.2.9"
|
||||
version = "0.2.8"
|
||||
description = "libp2p: The Python implementation of the libp2p networking stack"
|
||||
readme = "README.md"
|
||||
requires-python = ">=3.10, <4.0"
|
||||
@ -22,7 +23,7 @@ dependencies = [
|
||||
"multiaddr>=0.0.9",
|
||||
"mypy-protobuf>=3.0.0",
|
||||
"noiseprotocol>=0.3.0",
|
||||
"protobuf>=4.21.0,<5.0.0",
|
||||
"protobuf>=3.20.1,<4.0.0",
|
||||
"pycryptodome>=3.9.2",
|
||||
"pymultihash>=0.8.2",
|
||||
"pynacl>=1.3.0",
|
||||
@ -30,7 +31,6 @@ dependencies = [
|
||||
"trio-typing>=0.0.4",
|
||||
"trio>=0.26.0",
|
||||
"fastecdsa==2.3.2; sys_platform != 'win32'",
|
||||
"zeroconf (>=0.147.0,<0.148.0)",
|
||||
]
|
||||
classifiers = [
|
||||
"Development Status :: 4 - Beta",
|
||||
@ -54,7 +54,6 @@ identify-demo = "examples.identify.identify:main"
|
||||
identify-push-demo = "examples.identify_push.identify_push_demo:run_main"
|
||||
identify-push-listener-dialer-demo = "examples.identify_push.identify_push_listener_dialer:main"
|
||||
pubsub-demo = "examples.pubsub.pubsub:main"
|
||||
mdns-demo = "examples.mDNS.mDNS:main"
|
||||
|
||||
[project.optional-dependencies]
|
||||
dev = [
|
||||
@ -188,7 +187,7 @@ name = "Removals"
|
||||
showcontent = true
|
||||
|
||||
[tool.bumpversion]
|
||||
current_version = "0.2.9"
|
||||
current_version = "0.2.8"
|
||||
parse = """
|
||||
(?P<major>\\d+)
|
||||
\\.(?P<minor>\\d+)
|
||||
|
||||
@ -11,7 +11,9 @@ from libp2p.identity.identify.identify import (
|
||||
PROTOCOL_VERSION,
|
||||
_mk_identify_protobuf,
|
||||
_multiaddr_to_bytes,
|
||||
parse_identify_response,
|
||||
)
|
||||
from libp2p.identity.identify.pb.identify_pb2 import (
|
||||
Identify,
|
||||
)
|
||||
from tests.utils.factories import (
|
||||
host_pair_factory,
|
||||
@ -27,18 +29,14 @@ async def test_identify_protocol(security_protocol):
|
||||
host_b,
|
||||
):
|
||||
# Here, host_b is the requester and host_a is the responder.
|
||||
# observed_addr represent host_b's address as observed by host_a
|
||||
# (i.e., the address from which host_b's request was received).
|
||||
# observed_addr represent host_b’s address as observed by host_a
|
||||
# (i.e., the address from which host_b’s request was received).
|
||||
stream = await host_b.new_stream(host_a.get_id(), (ID,))
|
||||
|
||||
# Read the response (could be either format)
|
||||
# Read a larger chunk to get all the data before stream closes
|
||||
response = await stream.read(8192) # Read enough data in one go
|
||||
|
||||
response = await stream.read()
|
||||
await stream.close()
|
||||
|
||||
# Parse the response (handles both old and new formats)
|
||||
identify_response = parse_identify_response(response)
|
||||
identify_response = Identify()
|
||||
identify_response.ParseFromString(response)
|
||||
|
||||
logger.debug("host_a: %s", host_a.get_addrs())
|
||||
logger.debug("host_b: %s", host_b.get_addrs())
|
||||
@ -64,9 +62,8 @@ async def test_identify_protocol(security_protocol):
|
||||
|
||||
logger.debug("observed_addr: %s", Multiaddr(identify_response.observed_addr))
|
||||
logger.debug("host_b.get_addrs()[0]: %s", host_b.get_addrs()[0])
|
||||
|
||||
# The observed address should match the cleaned address
|
||||
assert Multiaddr(identify_response.observed_addr) == cleaned_addr
|
||||
logger.debug("cleaned_addr= %s", cleaned_addr)
|
||||
assert identify_response.observed_addr == _multiaddr_to_bytes(cleaned_addr)
|
||||
|
||||
# Check protocols
|
||||
assert set(identify_response.protocols) == set(host_a.get_mux().get_protocols())
|
||||
|
||||
@ -1,410 +0,0 @@
|
||||
import pytest
|
||||
|
||||
from libp2p.identity.identify.identify import (
|
||||
_mk_identify_protobuf,
|
||||
)
|
||||
from libp2p.identity.identify.pb.identify_pb2 import (
|
||||
Identify,
|
||||
)
|
||||
from libp2p.io.abc import Closer, Reader, Writer
|
||||
from libp2p.utils.varint import (
|
||||
decode_varint_from_bytes,
|
||||
encode_varint_prefixed,
|
||||
)
|
||||
from tests.utils.factories import (
|
||||
host_pair_factory,
|
||||
)
|
||||
|
||||
|
||||
class MockStream(Reader, Writer, Closer):
|
||||
"""Mock stream for testing identify protocol compatibility."""
|
||||
|
||||
def __init__(self, data: bytes):
|
||||
self.data = data
|
||||
self.position = 0
|
||||
self.closed = False
|
||||
|
||||
async def read(self, n: int | None = None) -> bytes:
|
||||
if self.closed or self.position >= len(self.data):
|
||||
return b""
|
||||
if n is None:
|
||||
n = len(self.data) - self.position
|
||||
result = self.data[self.position : self.position + n]
|
||||
self.position += len(result)
|
||||
return result
|
||||
|
||||
async def write(self, data: bytes) -> None:
|
||||
# Mock write - just store the data
|
||||
pass
|
||||
|
||||
async def close(self) -> None:
|
||||
self.closed = True
|
||||
|
||||
|
||||
def create_identify_message(host, observed_multiaddr=None):
|
||||
"""Create an identify protobuf message."""
|
||||
return _mk_identify_protobuf(host, observed_multiaddr)
|
||||
|
||||
|
||||
def create_new_format_message(identify_msg):
|
||||
"""Create a new format (length-prefixed) identify message."""
|
||||
msg_bytes = identify_msg.SerializeToString()
|
||||
return encode_varint_prefixed(msg_bytes)
|
||||
|
||||
|
||||
def create_old_format_message(identify_msg):
|
||||
"""Create an old format (raw protobuf) identify message."""
|
||||
return identify_msg.SerializeToString()
|
||||
|
||||
|
||||
async def read_new_format_message(stream) -> bytes:
|
||||
"""Read a new format (length-prefixed) identify message."""
|
||||
# Read varint length prefix
|
||||
length_bytes = b""
|
||||
while True:
|
||||
b = await stream.read(1)
|
||||
if not b:
|
||||
break
|
||||
length_bytes += b
|
||||
if b[0] & 0x80 == 0:
|
||||
break
|
||||
|
||||
if not length_bytes:
|
||||
raise ValueError("No length prefix received")
|
||||
|
||||
msg_length = decode_varint_from_bytes(length_bytes)
|
||||
|
||||
# Read the protobuf message
|
||||
response = await stream.read(msg_length)
|
||||
if len(response) != msg_length:
|
||||
raise ValueError("Incomplete message received")
|
||||
|
||||
return response
|
||||
|
||||
|
||||
async def read_old_format_message(stream) -> bytes:
|
||||
"""Read an old format (raw protobuf) identify message."""
|
||||
# Read all available data
|
||||
response = b""
|
||||
while True:
|
||||
chunk = await stream.read(4096)
|
||||
if not chunk:
|
||||
break
|
||||
response += chunk
|
||||
|
||||
return response
|
||||
|
||||
|
||||
async def read_compatible_message(stream) -> bytes:
|
||||
"""Read an identify message in either old or new format."""
|
||||
# Try to read a few bytes to detect the format
|
||||
first_bytes = await stream.read(10)
|
||||
if not first_bytes:
|
||||
raise ValueError("No data received")
|
||||
|
||||
# Try to decode as varint length prefix (new format)
|
||||
try:
|
||||
msg_length = decode_varint_from_bytes(first_bytes)
|
||||
|
||||
# Validate that the length is reasonable (not too large)
|
||||
if msg_length > 0 and msg_length <= 1024 * 1024: # Max 1MB
|
||||
# Calculate how many bytes the varint consumed
|
||||
varint_len = 0
|
||||
for i, byte in enumerate(first_bytes):
|
||||
varint_len += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
# Read the remaining protobuf message
|
||||
remaining_bytes = await stream.read(
|
||||
msg_length - (len(first_bytes) - varint_len)
|
||||
)
|
||||
if len(remaining_bytes) == msg_length - (len(first_bytes) - varint_len):
|
||||
message_data = first_bytes[varint_len:] + remaining_bytes
|
||||
|
||||
# Try to parse as protobuf to validate
|
||||
try:
|
||||
Identify().ParseFromString(message_data)
|
||||
return message_data
|
||||
except Exception:
|
||||
# If protobuf parsing fails, fall back to old format
|
||||
pass
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
# Fall back to old format (raw protobuf)
|
||||
response = first_bytes
|
||||
|
||||
# Read more data if available
|
||||
while True:
|
||||
chunk = await stream.read(4096)
|
||||
if not chunk:
|
||||
break
|
||||
response += chunk
|
||||
|
||||
return response
|
||||
|
||||
|
||||
async def read_compatible_message_simple(stream) -> bytes:
|
||||
"""Read a message in either old or new format (simplified version for testing)."""
|
||||
# Try to read a few bytes to detect the format
|
||||
first_bytes = await stream.read(10)
|
||||
if not first_bytes:
|
||||
raise ValueError("No data received")
|
||||
|
||||
# Try to decode as varint length prefix (new format)
|
||||
try:
|
||||
msg_length = decode_varint_from_bytes(first_bytes)
|
||||
|
||||
# Validate that the length is reasonable (not too large)
|
||||
if msg_length > 0 and msg_length <= 1024 * 1024: # Max 1MB
|
||||
# Calculate how many bytes the varint consumed
|
||||
varint_len = 0
|
||||
for i, byte in enumerate(first_bytes):
|
||||
varint_len += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
# Read the remaining message
|
||||
remaining_bytes = await stream.read(
|
||||
msg_length - (len(first_bytes) - varint_len)
|
||||
)
|
||||
if len(remaining_bytes) == msg_length - (len(first_bytes) - varint_len):
|
||||
return first_bytes[varint_len:] + remaining_bytes
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
# Fall back to old format (raw data)
|
||||
response = first_bytes
|
||||
|
||||
# Read more data if available
|
||||
while True:
|
||||
chunk = await stream.read(4096)
|
||||
if not chunk:
|
||||
break
|
||||
response += chunk
|
||||
|
||||
return response
|
||||
|
||||
|
||||
def detect_format(data):
|
||||
"""Detect if data is in new or old format (varint-prefixed or raw protobuf)."""
|
||||
if not data:
|
||||
return "unknown"
|
||||
|
||||
# Try to decode as varint
|
||||
try:
|
||||
msg_length = decode_varint_from_bytes(data)
|
||||
|
||||
# Validate that the length is reasonable
|
||||
if msg_length > 0 and msg_length <= 1024 * 1024: # Max 1MB
|
||||
# Calculate varint length
|
||||
varint_len = 0
|
||||
for i, byte in enumerate(data):
|
||||
varint_len += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
# Check if we have enough data for the message
|
||||
if len(data) >= varint_len + msg_length:
|
||||
# Additional check: try to parse the message as protobuf
|
||||
try:
|
||||
message_data = data[varint_len : varint_len + msg_length]
|
||||
Identify().ParseFromString(message_data)
|
||||
return "new"
|
||||
except Exception:
|
||||
# If protobuf parsing fails, it's probably not a valid new format
|
||||
pass
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
# If varint decoding fails or length is unreasonable, assume old format
|
||||
return "old"
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_new_format_compatibility(security_protocol):
|
||||
"""Test that identify protocol works with new format (length-prefixed) messages."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Create new format message
|
||||
new_format_data = create_new_format_message(identify_msg)
|
||||
|
||||
# Create mock stream with new format data
|
||||
stream = MockStream(new_format_data)
|
||||
|
||||
# Read using new format reader
|
||||
response = await read_new_format_message(stream)
|
||||
|
||||
# Parse the response
|
||||
parsed_msg = Identify()
|
||||
parsed_msg.ParseFromString(response)
|
||||
|
||||
# Verify the message content
|
||||
assert parsed_msg.protocol_version == identify_msg.protocol_version
|
||||
assert parsed_msg.agent_version == identify_msg.agent_version
|
||||
assert parsed_msg.public_key == identify_msg.public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_old_format_compatibility(security_protocol):
|
||||
"""Test that identify protocol works with old format (raw protobuf) messages."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Create old format message
|
||||
old_format_data = create_old_format_message(identify_msg)
|
||||
|
||||
# Create mock stream with old format data
|
||||
stream = MockStream(old_format_data)
|
||||
|
||||
# Read using old format reader
|
||||
response = await read_old_format_message(stream)
|
||||
|
||||
# Parse the response
|
||||
parsed_msg = Identify()
|
||||
parsed_msg.ParseFromString(response)
|
||||
|
||||
# Verify the message content
|
||||
assert parsed_msg.protocol_version == identify_msg.protocol_version
|
||||
assert parsed_msg.agent_version == identify_msg.agent_version
|
||||
assert parsed_msg.public_key == identify_msg.public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_backward_compatibility_old_format(security_protocol):
|
||||
"""Test backward compatibility reader with old format messages."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Create old format message
|
||||
old_format_data = create_old_format_message(identify_msg)
|
||||
|
||||
# Create mock stream with old format data
|
||||
stream = MockStream(old_format_data)
|
||||
|
||||
# Read using old format reader (which should work reliably)
|
||||
response = await read_old_format_message(stream)
|
||||
|
||||
# Parse the response
|
||||
parsed_msg = Identify()
|
||||
parsed_msg.ParseFromString(response)
|
||||
|
||||
# Verify the message content
|
||||
assert parsed_msg.protocol_version == identify_msg.protocol_version
|
||||
assert parsed_msg.agent_version == identify_msg.agent_version
|
||||
assert parsed_msg.public_key == identify_msg.public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_backward_compatibility_new_format(security_protocol):
|
||||
"""Test backward compatibility reader with new format messages."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Create new format message
|
||||
new_format_data = create_new_format_message(identify_msg)
|
||||
|
||||
# Create mock stream with new format data
|
||||
stream = MockStream(new_format_data)
|
||||
|
||||
# Read using new format reader (which should work reliably)
|
||||
response = await read_new_format_message(stream)
|
||||
|
||||
# Parse the response
|
||||
parsed_msg = Identify()
|
||||
parsed_msg.ParseFromString(response)
|
||||
|
||||
# Verify the message content
|
||||
assert parsed_msg.protocol_version == identify_msg.protocol_version
|
||||
assert parsed_msg.agent_version == identify_msg.agent_version
|
||||
assert parsed_msg.public_key == identify_msg.public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_format_detection(security_protocol):
|
||||
"""Test that the format detection works correctly."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Test new format detection
|
||||
new_format_data = create_new_format_message(identify_msg)
|
||||
format_type = detect_format(new_format_data)
|
||||
assert format_type == "new", "New format should be detected correctly"
|
||||
|
||||
# Test old format detection
|
||||
old_format_data = create_old_format_message(identify_msg)
|
||||
format_type = detect_format(old_format_data)
|
||||
assert format_type == "old", "Old format should be detected correctly"
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_error_handling(security_protocol):
|
||||
"""Test error handling for malformed messages."""
|
||||
from libp2p.exceptions import ParseError
|
||||
|
||||
# Test with empty data
|
||||
stream = MockStream(b"")
|
||||
with pytest.raises(ValueError, match="No data received"):
|
||||
await read_compatible_message(stream)
|
||||
|
||||
# Test with incomplete varint
|
||||
stream = MockStream(b"\x80") # Incomplete varint
|
||||
with pytest.raises(ParseError, match="Unexpected end of data"):
|
||||
await read_new_format_message(stream)
|
||||
|
||||
# Test with invalid protobuf data
|
||||
stream = MockStream(b"\x05invalid") # Length prefix but invalid protobuf
|
||||
with pytest.raises(Exception): # Should fail when parsing protobuf
|
||||
response = await read_new_format_message(stream)
|
||||
Identify().ParseFromString(response)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_message_equivalence(security_protocol):
|
||||
"""Test that old and new format messages are equivalent."""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Create identify message
|
||||
identify_msg = create_identify_message(host_a)
|
||||
|
||||
# Create both formats
|
||||
new_format_data = create_new_format_message(identify_msg)
|
||||
old_format_data = create_old_format_message(identify_msg)
|
||||
|
||||
# Extract the protobuf message from new format
|
||||
varint_len = 0
|
||||
for i, byte in enumerate(new_format_data):
|
||||
varint_len += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
new_format_protobuf = new_format_data[varint_len:]
|
||||
|
||||
# The protobuf messages should be identical
|
||||
assert new_format_protobuf == old_format_data, (
|
||||
"Protobuf messages should be identical in both formats"
|
||||
)
|
||||
@ -1,7 +1,4 @@
|
||||
import logging
|
||||
from unittest.mock import (
|
||||
patch,
|
||||
)
|
||||
|
||||
import pytest
|
||||
import multiaddr
|
||||
@ -20,7 +17,6 @@ from libp2p.identity.identify.pb.identify_pb2 import (
|
||||
Identify,
|
||||
)
|
||||
from libp2p.identity.identify_push.identify_push import (
|
||||
CONCURRENCY_LIMIT,
|
||||
ID_PUSH,
|
||||
_update_peerstore_from_identify,
|
||||
identify_push_handler_for,
|
||||
@ -33,11 +29,6 @@ from libp2p.peer.peerinfo import (
|
||||
from tests.utils.factories import (
|
||||
host_pair_factory,
|
||||
)
|
||||
from tests.utils.utils import (
|
||||
create_mock_connections,
|
||||
run_host_forever,
|
||||
wait_until_listening,
|
||||
)
|
||||
|
||||
logger = logging.getLogger("libp2p.identity.identify-push-test")
|
||||
|
||||
@ -184,7 +175,6 @@ async def test_identify_push_to_peers(security_protocol):
|
||||
host_c = new_host(key_pair=key_pair_c)
|
||||
|
||||
# Set up the identify/push handlers
|
||||
host_a.set_stream_handler(ID_PUSH, identify_push_handler_for(host_a))
|
||||
host_b.set_stream_handler(ID_PUSH, identify_push_handler_for(host_b))
|
||||
host_c.set_stream_handler(ID_PUSH, identify_push_handler_for(host_c))
|
||||
|
||||
@ -214,20 +204,6 @@ async def test_identify_push_to_peers(security_protocol):
|
||||
# Check that the peer is in the peerstore
|
||||
assert peer_id_a in peerstore_c.peer_ids()
|
||||
|
||||
# Test for push_identify to only connected peers and not all peers
|
||||
# Disconnect a from c.
|
||||
await host_c.disconnect(host_a.get_id())
|
||||
|
||||
await push_identify_to_peers(host_c)
|
||||
|
||||
# Wait a bit for the push to complete
|
||||
await trio.sleep(0.1)
|
||||
|
||||
# Check that host_a's peerstore has not been updated with host_c's info
|
||||
assert host_c.get_id() not in host_a.get_peerstore().peer_ids()
|
||||
# Check that host_b's peerstore has been updated with host_c's info
|
||||
assert host_c.get_id() in host_b.get_peerstore().peer_ids()
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_push_identify_to_peers_with_explicit_params(security_protocol):
|
||||
@ -436,265 +412,3 @@ async def test_partial_update_peerstore_from_identify(security_protocol):
|
||||
host_a_public_key = host_a.get_public_key().serialize()
|
||||
peerstore_public_key = peerstore.pubkey(peer_id).serialize()
|
||||
assert host_a_public_key == peerstore_public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_push_identify_to_peers_respects_concurrency_limit():
|
||||
"""
|
||||
Test bounded concurrency for the identify/push protocol to prevent
|
||||
network congestion.
|
||||
|
||||
This test verifies:
|
||||
1. The number of concurrent tasks executing the identify push is always
|
||||
less than or equal to CONCURRENCY_LIMIT.
|
||||
2. An error is raised if concurrency exceeds the defined limit.
|
||||
|
||||
It mocks `push_identify_to_peer` to simulate delay using sleep,
|
||||
allowing the test to measure and assert actual concurrency behavior.
|
||||
"""
|
||||
state = {
|
||||
"concurrency_counter": 0,
|
||||
"max_observed": 0,
|
||||
}
|
||||
lock = trio.Lock()
|
||||
|
||||
async def mock_push_identify_to_peer(
|
||||
host,
|
||||
peer_id,
|
||||
observed_multiaddr=None,
|
||||
limit=trio.Semaphore(CONCURRENCY_LIMIT),
|
||||
use_varint_format=True,
|
||||
) -> bool:
|
||||
"""
|
||||
Mock function to test concurrency by simulating an identify message.
|
||||
|
||||
This function patches push_identify_to_peer for testing purpose
|
||||
|
||||
Returns
|
||||
-------
|
||||
bool
|
||||
True if the push was successful, False otherwise.
|
||||
|
||||
"""
|
||||
async with limit:
|
||||
async with lock:
|
||||
state["concurrency_counter"] += 1
|
||||
if state["concurrency_counter"] > CONCURRENCY_LIMIT:
|
||||
raise RuntimeError(
|
||||
f"Concurrency limit exceeded: {state['concurrency_counter']}"
|
||||
)
|
||||
state["max_observed"] = max(
|
||||
state["max_observed"], state["concurrency_counter"]
|
||||
)
|
||||
|
||||
logger.debug("Successfully pushed identify to peer %s", peer_id)
|
||||
await trio.sleep(0.05)
|
||||
|
||||
async with lock:
|
||||
state["concurrency_counter"] -= 1
|
||||
|
||||
return True
|
||||
|
||||
# Create a mock host.
|
||||
key_pair_host = create_new_key_pair()
|
||||
host = new_host(key_pair=key_pair_host)
|
||||
|
||||
# Create a mock network and add mock connections to the host
|
||||
host.get_network().connections = create_mock_connections()
|
||||
with patch(
|
||||
"libp2p.identity.identify_push.identify_push.push_identify_to_peer",
|
||||
new=mock_push_identify_to_peer,
|
||||
):
|
||||
await push_identify_to_peers(host)
|
||||
assert state["max_observed"] <= CONCURRENCY_LIMIT, (
|
||||
f"Max concurrency observed: {state['max_observed']}"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_all_peers_receive_identify_push_with_semaphore(security_protocol):
|
||||
dummy_peers = []
|
||||
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (host_a, _):
|
||||
# Create dummy peers
|
||||
for _ in range(50):
|
||||
key_pair = create_new_key_pair()
|
||||
dummy_host = new_host(key_pair=key_pair)
|
||||
dummy_host.set_stream_handler(
|
||||
ID_PUSH, identify_push_handler_for(dummy_host)
|
||||
)
|
||||
listen_addr = multiaddr.Multiaddr("/ip4/127.0.0.1/tcp/0")
|
||||
dummy_peers.append((dummy_host, listen_addr))
|
||||
|
||||
async with trio.open_nursery() as nursery:
|
||||
# Start all dummy hosts
|
||||
for host, listen_addr in dummy_peers:
|
||||
nursery.start_soon(run_host_forever, host, listen_addr)
|
||||
|
||||
# Wait for all hosts to finish setting up listeners
|
||||
for host, _ in dummy_peers:
|
||||
await wait_until_listening(host)
|
||||
|
||||
# Now connect host_a → dummy peers
|
||||
for host, _ in dummy_peers:
|
||||
await host_a.connect(info_from_p2p_addr(host.get_addrs()[0]))
|
||||
|
||||
await push_identify_to_peers(
|
||||
host_a,
|
||||
)
|
||||
|
||||
await trio.sleep(0.5)
|
||||
|
||||
peer_id_a = host_a.get_id()
|
||||
for host, _ in dummy_peers:
|
||||
dummy_peerstore = host.get_peerstore()
|
||||
assert peer_id_a in dummy_peerstore.peer_ids()
|
||||
|
||||
nursery.cancel_scope.cancel()
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_all_peers_receive_identify_push_with_semaphore_under_high_peer_load(
|
||||
security_protocol,
|
||||
):
|
||||
dummy_peers = []
|
||||
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (host_a, _):
|
||||
# Create dummy peers
|
||||
# Breaking with more than 500 peers
|
||||
# Trio have a async tasks limit of 1000
|
||||
for _ in range(499):
|
||||
key_pair = create_new_key_pair()
|
||||
dummy_host = new_host(key_pair=key_pair)
|
||||
dummy_host.set_stream_handler(
|
||||
ID_PUSH, identify_push_handler_for(dummy_host)
|
||||
)
|
||||
listen_addr = multiaddr.Multiaddr("/ip4/127.0.0.1/tcp/0")
|
||||
dummy_peers.append((dummy_host, listen_addr))
|
||||
|
||||
async with trio.open_nursery() as nursery:
|
||||
# Start all dummy hosts
|
||||
for host, listen_addr in dummy_peers:
|
||||
nursery.start_soon(run_host_forever, host, listen_addr)
|
||||
|
||||
# Wait for all hosts to finish setting up listeners
|
||||
for host, _ in dummy_peers:
|
||||
await wait_until_listening(host)
|
||||
|
||||
# Now connect host_a → dummy peers
|
||||
for host, _ in dummy_peers:
|
||||
await host_a.connect(info_from_p2p_addr(host.get_addrs()[0]))
|
||||
|
||||
await push_identify_to_peers(
|
||||
host_a,
|
||||
)
|
||||
|
||||
await trio.sleep(0.5)
|
||||
|
||||
peer_id_a = host_a.get_id()
|
||||
for host, _ in dummy_peers:
|
||||
dummy_peerstore = host.get_peerstore()
|
||||
assert peer_id_a in dummy_peerstore.peer_ids()
|
||||
|
||||
nursery.cancel_scope.cancel()
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_push_default_varint_format(security_protocol):
|
||||
"""
|
||||
Test that the identify/push protocol uses varint format by default.
|
||||
|
||||
This test verifies that:
|
||||
1. The default behavior uses length-prefixed messages (varint format)
|
||||
2. Messages are correctly encoded with varint length prefix
|
||||
3. Messages are correctly decoded with varint length prefix
|
||||
4. The peerstore is updated correctly with the received information
|
||||
"""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Set up the identify/push handlers with default settings
|
||||
# (use_varint_format=True)
|
||||
host_b.set_stream_handler(ID_PUSH, identify_push_handler_for(host_b))
|
||||
|
||||
# Push identify information from host_a to host_b using default settings
|
||||
success = await push_identify_to_peer(host_a, host_b.get_id())
|
||||
assert success, "Identify push should succeed with default varint format"
|
||||
|
||||
# Wait a bit for the push to complete
|
||||
await trio.sleep(0.1)
|
||||
|
||||
# Get the peerstore from host_b
|
||||
peerstore = host_b.get_peerstore()
|
||||
peer_id = host_a.get_id()
|
||||
|
||||
# Verify that the peerstore was updated correctly
|
||||
assert peer_id in peerstore.peer_ids()
|
||||
|
||||
# Check that addresses have been updated
|
||||
host_a_addrs = set(host_a.get_addrs())
|
||||
peerstore_addrs = set(peerstore.addrs(peer_id))
|
||||
assert all(addr in peerstore_addrs for addr in host_a_addrs)
|
||||
|
||||
# Check that protocols have been updated
|
||||
host_a_protocols = set(host_a.get_mux().get_protocols())
|
||||
peerstore_protocols = set(peerstore.get_protocols(peer_id))
|
||||
assert all(protocol in peerstore_protocols for protocol in host_a_protocols)
|
||||
|
||||
# Check that the public key has been updated
|
||||
host_a_public_key = host_a.get_public_key().serialize()
|
||||
peerstore_public_key = peerstore.pubkey(peer_id).serialize()
|
||||
assert host_a_public_key == peerstore_public_key
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_identify_push_legacy_raw_format(security_protocol):
|
||||
"""
|
||||
Test that the identify/push protocol can use legacy raw format when specified.
|
||||
|
||||
This test verifies that:
|
||||
1. When use_varint_format=False, messages are sent without length prefix
|
||||
2. Raw protobuf messages are correctly encoded and decoded
|
||||
3. The peerstore is updated correctly with the received information
|
||||
4. The legacy format is backward compatible
|
||||
"""
|
||||
async with host_pair_factory(security_protocol=security_protocol) as (
|
||||
host_a,
|
||||
host_b,
|
||||
):
|
||||
# Set up the identify/push handlers with legacy format (use_varint_format=False)
|
||||
host_b.set_stream_handler(
|
||||
ID_PUSH, identify_push_handler_for(host_b, use_varint_format=False)
|
||||
)
|
||||
|
||||
# Push identify information from host_a to host_b using legacy format
|
||||
success = await push_identify_to_peer(
|
||||
host_a, host_b.get_id(), use_varint_format=False
|
||||
)
|
||||
assert success, "Identify push should succeed with legacy raw format"
|
||||
|
||||
# Wait a bit for the push to complete
|
||||
await trio.sleep(0.1)
|
||||
|
||||
# Get the peerstore from host_b
|
||||
peerstore = host_b.get_peerstore()
|
||||
peer_id = host_a.get_id()
|
||||
|
||||
# Verify that the peerstore was updated correctly
|
||||
assert peer_id in peerstore.peer_ids()
|
||||
|
||||
# Check that addresses have been updated
|
||||
host_a_addrs = set(host_a.get_addrs())
|
||||
peerstore_addrs = set(peerstore.addrs(peer_id))
|
||||
assert all(addr in peerstore_addrs for addr in host_a_addrs)
|
||||
|
||||
# Check that protocols have been updated
|
||||
host_a_protocols = set(host_a.get_mux().get_protocols())
|
||||
peerstore_protocols = set(peerstore.get_protocols(peer_id))
|
||||
assert all(protocol in peerstore_protocols for protocol in host_a_protocols)
|
||||
|
||||
# Check that the public key has been updated
|
||||
host_a_public_key = host_a.get_public_key().serialize()
|
||||
peerstore_public_key = peerstore.pubkey(peer_id).serialize()
|
||||
assert host_a_public_key == peerstore_public_key
|
||||
|
||||
@ -6,12 +6,10 @@ from multiaddr import Multiaddr
|
||||
from libp2p.crypto.secp256k1 import (
|
||||
create_new_key_pair,
|
||||
)
|
||||
from libp2p.peer.id import ID
|
||||
from libp2p.peer.peerdata import (
|
||||
PeerData,
|
||||
PeerDataError,
|
||||
)
|
||||
from libp2p.peer.peerstore import PeerStore
|
||||
|
||||
MOCK_ADDR = Multiaddr("/ip4/127.0.0.1/tcp/4001")
|
||||
MOCK_KEYPAIR = create_new_key_pair()
|
||||
@ -41,59 +39,6 @@ def test_set_protocols():
|
||||
assert peer_data.get_protocols() == protocols
|
||||
|
||||
|
||||
# Test case when removing protocols:
|
||||
def test_remove_protocols():
|
||||
peer_data = PeerData()
|
||||
protocols: Sequence[str] = ["protocol1", "protocol2"]
|
||||
peer_data.set_protocols(protocols)
|
||||
|
||||
peer_data.remove_protocols(["protocol1"])
|
||||
assert peer_data.get_protocols() == ["protocol2"]
|
||||
|
||||
|
||||
# Test case when clearing the protocol list:
|
||||
def test_clear_protocol_data():
|
||||
peer_data = PeerData()
|
||||
protocols: Sequence[str] = ["protocol1", "protocol2"]
|
||||
peer_data.set_protocols(protocols)
|
||||
|
||||
peer_data.clear_protocol_data()
|
||||
assert peer_data.get_protocols() == []
|
||||
|
||||
|
||||
# Test case when supports protocols:
|
||||
def test_supports_protocols():
|
||||
peer_data = PeerData()
|
||||
peer_data.set_protocols(["protocol1", "protocol2", "protocol3"])
|
||||
|
||||
input_protocols = ["protocol1", "protocol4", "protocol2"]
|
||||
supported = peer_data.supports_protocols(input_protocols)
|
||||
|
||||
assert supported == ["protocol1", "protocol2"]
|
||||
|
||||
|
||||
# Test case for first supported protocol is found
|
||||
def test_first_supported_protocol_found():
|
||||
peer_data = PeerData()
|
||||
peer_data.set_protocols(["protocolA", "protocolB"])
|
||||
|
||||
input_protocols = ["protocolC", "protocolB", "protocolA"]
|
||||
first = peer_data.first_supported_protocol(input_protocols)
|
||||
|
||||
assert first == "protocolB"
|
||||
|
||||
|
||||
# Test case for first supported protocol not found
|
||||
def test_first_supported_protocol_none():
|
||||
peer_data = PeerData()
|
||||
peer_data.set_protocols(["protocolX", "protocolY"])
|
||||
|
||||
input_protocols = ["protocolA", "protocolB"]
|
||||
first = peer_data.first_supported_protocol(input_protocols)
|
||||
|
||||
assert first == "None supported"
|
||||
|
||||
|
||||
# Test case when adding addresses
|
||||
def test_add_addrs():
|
||||
peer_data = PeerData()
|
||||
@ -136,15 +81,6 @@ def test_get_metadata_key_not_found():
|
||||
peer_data.get_metadata("nonexistent_key")
|
||||
|
||||
|
||||
# Test case for clearing metadata
|
||||
def test_clear_metadata():
|
||||
peer_data = PeerData()
|
||||
peer_data.metadata = {"key1": "value1", "key2": "value2"}
|
||||
|
||||
peer_data.clear_metadata()
|
||||
assert peer_data.metadata == {}
|
||||
|
||||
|
||||
# Test case for adding public key
|
||||
def test_add_pubkey():
|
||||
peer_data = PeerData()
|
||||
@ -171,71 +107,3 @@ def test_get_privkey_not_found():
|
||||
peer_data = PeerData()
|
||||
with pytest.raises(PeerDataError):
|
||||
peer_data.get_privkey()
|
||||
|
||||
|
||||
# Test case for returning all the peers with stored keys
|
||||
def test_peer_with_keys():
|
||||
peer_store = PeerStore()
|
||||
peer_id_1 = ID(b"peer1")
|
||||
peer_id_2 = ID(b"peer2")
|
||||
|
||||
peer_data_1 = PeerData()
|
||||
peer_data_2 = PeerData()
|
||||
|
||||
peer_data_1.pubkey = MOCK_PUBKEY
|
||||
peer_data_2.pubkey = None
|
||||
|
||||
peer_store.peer_data_map = {
|
||||
peer_id_1: peer_data_1,
|
||||
peer_id_2: peer_data_2,
|
||||
}
|
||||
|
||||
assert peer_store.peer_with_keys() == [peer_id_1]
|
||||
|
||||
|
||||
# Test case for clearing the key book
|
||||
def test_clear_keydata():
|
||||
peer_store = PeerStore()
|
||||
peer_id = ID(b"peer123")
|
||||
peer_data = PeerData()
|
||||
|
||||
peer_data.pubkey = MOCK_PUBKEY
|
||||
peer_data.privkey = MOCK_PRIVKEY
|
||||
peer_store.peer_data_map = {peer_id: peer_data}
|
||||
|
||||
peer_store.clear_keydata(peer_id)
|
||||
|
||||
assert peer_data.pubkey is None
|
||||
assert peer_data.privkey is None
|
||||
|
||||
|
||||
# Test case for recording latency for the first time
|
||||
def test_record_latency_initial():
|
||||
peer_data = PeerData()
|
||||
assert peer_data.latency_EWMA() == 0
|
||||
|
||||
peer_data.record_latency(100.0)
|
||||
assert peer_data.latency_EWMA() == 100.0
|
||||
|
||||
|
||||
# Test case for updating latency
|
||||
def test_record_latency_updates_ewma():
|
||||
peer_data = PeerData()
|
||||
peer_data.record_latency(100.0) # first measurement
|
||||
first = peer_data.latency_EWMA()
|
||||
|
||||
peer_data.record_latency(50.0) # second measurement
|
||||
second = peer_data.latency_EWMA()
|
||||
|
||||
assert second < first # EWMA should have smoothed downward
|
||||
assert second > 50.0 # Not as low as the new latency
|
||||
assert second != first
|
||||
|
||||
|
||||
def test_clear_metrics():
|
||||
peer_data = PeerData()
|
||||
peer_data.record_latency(200.0)
|
||||
assert peer_data.latency_EWMA() == 200.0
|
||||
|
||||
peer_data.clear_metrics()
|
||||
assert peer_data.latency_EWMA() == 0
|
||||
|
||||
@ -13,9 +13,7 @@ from libp2p.peer.peerinfo import (
|
||||
)
|
||||
|
||||
ALPHABETS = "123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz"
|
||||
VALID_MULTI_ADDR_STR = (
|
||||
"/ip4/127.0.0.1/tcp/8000/p2p/QmWQqHcMi6Cay5M6KWSNVYSDnxzfqWb1aGFQFSRzBNe49t"
|
||||
)
|
||||
VALID_MULTI_ADDR_STR = "/ip4/127.0.0.1/tcp/8000/p2p/3YgLAeMKSAPcGqZkAt8mREqhQXmJT8SN8VCMN4T6ih4GNX9wvK8mWJnWZ1qA2mLdCQ" # noqa: E501
|
||||
|
||||
|
||||
def test_init_():
|
||||
@ -52,6 +50,9 @@ def test_info_from_p2p_addr_invalid(addr):
|
||||
def test_info_from_p2p_addr_valid():
|
||||
m_addr = multiaddr.Multiaddr(VALID_MULTI_ADDR_STR)
|
||||
info = info_from_p2p_addr(m_addr)
|
||||
assert info.peer_id.pretty() == "QmWQqHcMi6Cay5M6KWSNVYSDnxzfqWb1aGFQFSRzBNe49t"
|
||||
assert (
|
||||
info.peer_id.pretty()
|
||||
== "3YgLAeMKSAPcGqZkAt8mREqhQXmJT8SN8VCMN4T6ih4GNX9wvK8mWJnWZ1qA2mLdCQ"
|
||||
)
|
||||
assert len(info.addrs) == 1
|
||||
assert str(info.addrs[0]) == "/ip4/127.0.0.1/tcp/8000"
|
||||
|
||||
@ -2,7 +2,6 @@ import time
|
||||
|
||||
import pytest
|
||||
from multiaddr import Multiaddr
|
||||
import trio
|
||||
|
||||
from libp2p.peer.id import ID
|
||||
from libp2p.peer.peerstore import (
|
||||
@ -90,33 +89,3 @@ def test_peers():
|
||||
store.add_addr(ID(b"peer3"), Multiaddr("/ip4/127.0.0.1/tcp/4001"), 10)
|
||||
|
||||
assert set(store.peer_ids()) == {ID(b"peer1"), ID(b"peer2"), ID(b"peer3")}
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_addr_stream_yields_new_addrs():
|
||||
store = PeerStore()
|
||||
peer_id = ID(b"peer1")
|
||||
addr1 = Multiaddr("/ip4/127.0.0.1/tcp/4001")
|
||||
addr2 = Multiaddr("/ip4/127.0.0.1/tcp/4002")
|
||||
|
||||
collected = []
|
||||
|
||||
async def consume_addrs():
|
||||
async for addr in store.addr_stream(peer_id):
|
||||
collected.append(addr)
|
||||
if len(collected) == 2:
|
||||
break
|
||||
|
||||
async with trio.open_nursery() as nursery:
|
||||
nursery.start_soon(consume_addrs)
|
||||
await trio.sleep(2) # Give time for the stream to start
|
||||
|
||||
store.add_addr(peer_id, addr1, ttl=10)
|
||||
await trio.sleep(0.2)
|
||||
store.add_addr(peer_id, addr2, ttl=10)
|
||||
await trio.sleep(0.2)
|
||||
|
||||
# After collecting expected addresses, cancel the stream
|
||||
nursery.cancel_scope.cancel()
|
||||
|
||||
assert collected == [addr1, addr2]
|
||||
|
||||
@ -1,59 +0,0 @@
|
||||
import pytest
|
||||
import trio
|
||||
|
||||
from libp2p.abc import (
|
||||
IMultiselectCommunicator,
|
||||
)
|
||||
from libp2p.custom_types import TProtocol
|
||||
from libp2p.protocol_muxer.exceptions import (
|
||||
MultiselectClientError,
|
||||
MultiselectError,
|
||||
)
|
||||
from libp2p.protocol_muxer.multiselect import Multiselect
|
||||
from libp2p.protocol_muxer.multiselect_client import MultiselectClient
|
||||
|
||||
|
||||
class DummyMultiselectCommunicator(IMultiselectCommunicator):
|
||||
"""
|
||||
Dummy MultiSelectCommunicator to test out negotiate timmeout.
|
||||
"""
|
||||
|
||||
def __init__(self) -> None:
|
||||
return
|
||||
|
||||
async def write(self, msg_str: str) -> None:
|
||||
"""Goes into infinite loop when .write is called"""
|
||||
await trio.sleep_forever()
|
||||
|
||||
async def read(self) -> str:
|
||||
"""Returns a dummy read"""
|
||||
return "dummy_read"
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_select_one_of_timeout():
|
||||
ECHO = TProtocol("/echo/1.0.0")
|
||||
communicator = DummyMultiselectCommunicator()
|
||||
|
||||
client = MultiselectClient()
|
||||
|
||||
with pytest.raises(MultiselectClientError, match="response timed out"):
|
||||
await client.select_one_of([ECHO], communicator, 2)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_query_multistream_command_timeout():
|
||||
communicator = DummyMultiselectCommunicator()
|
||||
client = MultiselectClient()
|
||||
|
||||
with pytest.raises(MultiselectClientError, match="response timed out"):
|
||||
await client.query_multistream_command(communicator, "ls", 2)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_negotiate_timeout():
|
||||
communicator = DummyMultiselectCommunicator()
|
||||
server = Multiselect()
|
||||
|
||||
with pytest.raises(MultiselectError, match="handshake read timeout"):
|
||||
await server.negotiate(communicator, 2)
|
||||
@ -3,7 +3,6 @@ import pytest
|
||||
from libp2p.custom_types import (
|
||||
TProtocol,
|
||||
)
|
||||
from libp2p.protocol_muxer.multiselect import Multiselect
|
||||
from libp2p.tools.utils import (
|
||||
create_echo_stream_handler,
|
||||
)
|
||||
@ -139,23 +138,3 @@ async def test_multistream_command(security_protocol):
|
||||
# Dialer asks for unspoorted command
|
||||
with pytest.raises(ValueError, match="Command not supported"):
|
||||
await dialer.send_command(listener.get_id(), "random")
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_get_protocols_returns_all_registered_protocols():
|
||||
ms = Multiselect()
|
||||
|
||||
async def dummy_handler(stream):
|
||||
pass
|
||||
|
||||
p1 = TProtocol("/echo/1.0.0")
|
||||
p2 = TProtocol("/foo/1.0.0")
|
||||
p3 = TProtocol("/bar/1.0.0")
|
||||
|
||||
ms.add_handler(p1, dummy_handler)
|
||||
ms.add_handler(p2, dummy_handler)
|
||||
ms.add_handler(p3, dummy_handler)
|
||||
|
||||
protocols = ms.get_protocols()
|
||||
|
||||
assert set(protocols) == {p1, p2, p3}
|
||||
|
||||
@ -15,7 +15,6 @@ from tests.utils.factories import (
|
||||
PubsubFactory,
|
||||
)
|
||||
from tests.utils.pubsub.utils import (
|
||||
connect_some,
|
||||
dense_connect,
|
||||
one_to_all_connect,
|
||||
sparse_connect,
|
||||
@ -591,166 +590,3 @@ async def test_sparse_connect():
|
||||
f"received the message. Ideally all nodes should receive it, but at "
|
||||
f"minimum {min_required} required for sparse network scalability."
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_connect_some_with_fewer_hosts_than_degree():
|
||||
"""Test connect_some when there are fewer hosts than degree."""
|
||||
# Create 3 hosts with degree=5
|
||||
async with PubsubFactory.create_batch_with_floodsub(3) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
degree = 5
|
||||
|
||||
await connect_some(hosts, degree)
|
||||
await trio.sleep(0.1) # Allow connections to establish
|
||||
|
||||
# Each host should connect to all other hosts (since there are only 2 others)
|
||||
for i, pubsub in enumerate(pubsubs_fsub):
|
||||
connected_peers = len(pubsub.peers)
|
||||
expected_max_connections = len(hosts) - 1 # All others
|
||||
assert connected_peers <= expected_max_connections, (
|
||||
f"Host {i} has {connected_peers} connections, "
|
||||
f"but can only connect to {expected_max_connections} others"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_connect_some_degree_limit_enforced():
|
||||
"""Test that connect_some enforces degree limits and creates expected topology."""
|
||||
# Test with small network where we can verify exact behavior
|
||||
async with PubsubFactory.create_batch_with_floodsub(6) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
degree = 2
|
||||
|
||||
await connect_some(hosts, degree)
|
||||
await trio.sleep(0.1)
|
||||
|
||||
# With 6 hosts and degree=2, expected connections:
|
||||
# Host 0 → connects to hosts 1,2 (2 peers total)
|
||||
# Host 1 → connects to hosts 2,3 (3 peers: 0,2,3)
|
||||
# Host 2 → connects to hosts 3,4 (4 peers: 0,1,3,4)
|
||||
# Host 3 → connects to hosts 4,5 (3 peers: 1,2,4,5) - wait, that's 4!
|
||||
# Host 4 → connects to host 5 (3 peers: 2,3,5)
|
||||
# Host 5 → (2 peers: 3,4)
|
||||
|
||||
peer_counts = [len(pubsub.peers) for pubsub in pubsubs_fsub]
|
||||
|
||||
# First and last hosts should have exactly degree connections
|
||||
assert peer_counts[0] == degree, (
|
||||
f"Host 0 should have {degree} peers, got {peer_counts[0]}"
|
||||
)
|
||||
assert peer_counts[-1] <= degree, (
|
||||
f"Last host should have ≤ {degree} peers, got {peer_counts[-1]}"
|
||||
)
|
||||
|
||||
# Middle hosts may have more due to bidirectional connections
|
||||
# but the pattern should be consistent with degree limit
|
||||
total_connections = sum(peer_counts)
|
||||
|
||||
# Should be less than full mesh (each host connected to all others)
|
||||
full_mesh_connections = len(hosts) * (len(hosts) - 1)
|
||||
assert total_connections < full_mesh_connections, (
|
||||
f"Got {total_connections} total connections, "
|
||||
f"but full mesh would be {full_mesh_connections}"
|
||||
)
|
||||
|
||||
# Should be more than just a chain (each host connected to next only)
|
||||
chain_connections = 2 * (len(hosts) - 1) # bidirectional chain
|
||||
assert total_connections > chain_connections, (
|
||||
f"Got {total_connections} total connections, which is too few "
|
||||
f"(chain would be {chain_connections})"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_connect_some_degree_zero():
|
||||
"""Test edge case: degree=0 should result in no connections."""
|
||||
# Create 5 hosts with degree=0
|
||||
async with PubsubFactory.create_batch_with_floodsub(5) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
degree = 0
|
||||
|
||||
await connect_some(hosts, degree)
|
||||
await trio.sleep(0.1) # Allow any potential connections to establish
|
||||
|
||||
# Verify no connections were made
|
||||
for i, pubsub in enumerate(pubsubs_fsub):
|
||||
connected_peers = len(pubsub.peers)
|
||||
assert connected_peers == 0, (
|
||||
f"Host {i} has {connected_peers} connections, "
|
||||
f"but degree=0 should result in no connections"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_connect_some_negative_degree():
|
||||
"""Test edge case: negative degree should be handled gracefully."""
|
||||
# Create 5 hosts with degree=-1
|
||||
async with PubsubFactory.create_batch_with_floodsub(5) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
degree = -1
|
||||
|
||||
await connect_some(hosts, degree)
|
||||
await trio.sleep(0.1) # Allow any potential connections to establish
|
||||
|
||||
# Verify no connections were made (negative degree should behave like 0)
|
||||
for i, pubsub in enumerate(pubsubs_fsub):
|
||||
connected_peers = len(pubsub.peers)
|
||||
assert connected_peers == 0, (
|
||||
f"Host {i} has {connected_peers} connections, "
|
||||
f"but negative degree should result in no connections"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_sparse_connect_degree_zero():
|
||||
"""Test sparse_connect with degree=0."""
|
||||
async with PubsubFactory.create_batch_with_floodsub(8) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
degree = 0
|
||||
|
||||
await sparse_connect(hosts, degree)
|
||||
await trio.sleep(0.1) # Allow connections to establish
|
||||
|
||||
# With degree=0, sparse_connect should still create neighbor connections
|
||||
# for connectivity (this is part of the algorithm design)
|
||||
for i, pubsub in enumerate(pubsubs_fsub):
|
||||
connected_peers = len(pubsub.peers)
|
||||
# Should have some connections due to neighbor connectivity
|
||||
# (each node connects to immediate neighbors)
|
||||
expected_neighbors = 2 # previous and next in ring
|
||||
assert connected_peers >= expected_neighbors, (
|
||||
f"Host {i} has {connected_peers} connections, "
|
||||
f"expected at least {expected_neighbors} neighbor connections"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_empty_host_list():
|
||||
"""Test edge case: empty host list should be handled gracefully."""
|
||||
hosts = []
|
||||
|
||||
# All functions should handle empty lists gracefully
|
||||
await connect_some(hosts, 5)
|
||||
await sparse_connect(hosts, 3)
|
||||
await dense_connect(hosts)
|
||||
|
||||
# If we reach here without exceptions, the test passes
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_single_host():
|
||||
"""Test edge case: single host should be handled gracefully."""
|
||||
async with PubsubFactory.create_batch_with_floodsub(1) as pubsubs_fsub:
|
||||
hosts = [pubsub.host for pubsub in pubsubs_fsub]
|
||||
|
||||
# All functions should handle single host gracefully
|
||||
await connect_some(hosts, 5)
|
||||
await sparse_connect(hosts, 3)
|
||||
await dense_connect(hosts)
|
||||
|
||||
# Single host should have no connections
|
||||
connected_peers = len(pubsubs_fsub[0].peers)
|
||||
assert connected_peers == 0, (
|
||||
f"Single host has {connected_peers} connections, expected 0"
|
||||
)
|
||||
|
||||
@ -105,11 +105,11 @@ async def test_relay_discovery_initialization():
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_relay_discovery_find_relay_peerstore_method():
|
||||
"""Test finding a relay node via discovery using the peerstore method."""
|
||||
async def test_relay_discovery_find_relay():
|
||||
"""Test finding a relay node via discovery."""
|
||||
async with HostFactory.create_batch_and_listen(2) as hosts:
|
||||
relay_host, client_host = hosts
|
||||
logger.info("Created host for test_relay_discovery_find_relay_peerstore_method")
|
||||
logger.info("Created hosts for test_relay_discovery_find_relay")
|
||||
logger.info("Relay host ID: %s", relay_host.get_id())
|
||||
logger.info("Client host ID: %s", client_host.get_id())
|
||||
|
||||
@ -144,19 +144,19 @@ async def test_relay_discovery_find_relay_peerstore_method():
|
||||
# Start discovery service
|
||||
async with background_trio_service(client_discovery):
|
||||
await client_discovery.event_started.wait()
|
||||
logger.info("Client discovery service started (peerstore method)")
|
||||
logger.info("Client discovery service started")
|
||||
|
||||
# Wait for discovery to find the relay using the peerstore method
|
||||
logger.info("Waiting for relay discovery using peerstore...")
|
||||
# Wait for discovery to find the relay
|
||||
logger.info("Waiting for relay discovery...")
|
||||
|
||||
# Manually trigger discovery which uses peerstore as default
|
||||
# Manually trigger discovery instead of waiting
|
||||
await client_discovery.discover_relays()
|
||||
|
||||
# Check if relay was found
|
||||
with trio.fail_after(DISCOVERY_TIMEOUT):
|
||||
for _ in range(20): # Try multiple times
|
||||
if relay_host.get_id() in client_discovery._discovered_relays:
|
||||
logger.info("Relay discovered successfully (peerstore method)")
|
||||
logger.info("Relay discovered successfully")
|
||||
break
|
||||
|
||||
# Wait and try again
|
||||
@ -164,194 +164,14 @@ async def test_relay_discovery_find_relay_peerstore_method():
|
||||
# Manually trigger discovery again
|
||||
await client_discovery.discover_relays()
|
||||
else:
|
||||
pytest.fail(
|
||||
"Failed to discover relay node within timeout(peerstore method)"
|
||||
)
|
||||
pytest.fail("Failed to discover relay node within timeout")
|
||||
|
||||
# Verify that relay was found and is valid
|
||||
assert relay_host.get_id() in client_discovery._discovered_relays, (
|
||||
"Relay should be discovered (peerstore method)"
|
||||
"Relay should be discovered"
|
||||
)
|
||||
relay_info = client_discovery._discovered_relays[relay_host.get_id()]
|
||||
assert relay_info.peer_id == relay_host.get_id(), (
|
||||
"Peer ID should match (peerstore method)"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_relay_discovery_find_relay_direct_connection_method():
|
||||
"""Test finding a relay node via discovery using the direct connection method."""
|
||||
async with HostFactory.create_batch_and_listen(2) as hosts:
|
||||
relay_host, client_host = hosts
|
||||
logger.info("Created hosts for test_relay_discovery_find_relay_direct_method")
|
||||
logger.info("Relay host ID: %s", relay_host.get_id())
|
||||
logger.info("Client host ID: %s", client_host.get_id())
|
||||
|
||||
# Explicitly register the protocol handlers on relay_host
|
||||
relay_host.set_stream_handler(PROTOCOL_ID, simple_stream_handler)
|
||||
relay_host.set_stream_handler(STOP_PROTOCOL_ID, simple_stream_handler)
|
||||
|
||||
# Manually add protocol to peerstore for testing, then remove to force fallback
|
||||
client_host.get_peerstore().add_protocols(
|
||||
relay_host.get_id(), [str(PROTOCOL_ID)]
|
||||
)
|
||||
|
||||
# Set up discovery on the client host
|
||||
client_discovery = RelayDiscovery(
|
||||
client_host, discovery_interval=5
|
||||
) # Use shorter interval for testing
|
||||
|
||||
try:
|
||||
# Connect peers so they can discover each other
|
||||
with trio.fail_after(CONNECT_TIMEOUT):
|
||||
logger.info("Connecting client host to relay host")
|
||||
await connect(client_host, relay_host)
|
||||
assert relay_host.get_network().connections[client_host.get_id()], (
|
||||
"Peers not connected"
|
||||
)
|
||||
logger.info("Connection established between peers")
|
||||
except Exception as e:
|
||||
logger.error("Failed to connect peers: %s", str(e))
|
||||
raise
|
||||
|
||||
# Remove the relay from the peerstore to test fallback to direct connection
|
||||
client_host.get_peerstore().clear_peerdata(relay_host.get_id())
|
||||
# Make sure that peer_id is not present in peerstore
|
||||
assert relay_host.get_id() not in client_host.get_peerstore().peer_ids()
|
||||
|
||||
# Start discovery service
|
||||
async with background_trio_service(client_discovery):
|
||||
await client_discovery.event_started.wait()
|
||||
logger.info("Client discovery service started (direct connection method)")
|
||||
|
||||
# Wait for discovery to find the relay using the direct connection method
|
||||
logger.info(
|
||||
"Waiting for relay discovery using direct connection fallback..."
|
||||
)
|
||||
|
||||
# Manually trigger discovery which should fallback to direct connection
|
||||
await client_discovery.discover_relays()
|
||||
|
||||
# Check if relay was found
|
||||
with trio.fail_after(DISCOVERY_TIMEOUT):
|
||||
for _ in range(20): # Try multiple times
|
||||
if relay_host.get_id() in client_discovery._discovered_relays:
|
||||
logger.info("Relay discovered successfully (direct method)")
|
||||
break
|
||||
|
||||
# Wait and try again
|
||||
await trio.sleep(1)
|
||||
# Manually trigger discovery again
|
||||
await client_discovery.discover_relays()
|
||||
else:
|
||||
pytest.fail(
|
||||
"Failed to discover relay node within timeout (direct method)"
|
||||
)
|
||||
|
||||
# Verify that relay was found and is valid
|
||||
assert relay_host.get_id() in client_discovery._discovered_relays, (
|
||||
"Relay should be discovered (direct method)"
|
||||
)
|
||||
relay_info = client_discovery._discovered_relays[relay_host.get_id()]
|
||||
assert relay_info.peer_id == relay_host.get_id(), (
|
||||
"Peer ID should match (direct method)"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_relay_discovery_find_relay_mux_method():
|
||||
"""
|
||||
Test finding a relay node via discovery using the mux method
|
||||
(fallback after direct connection fails).
|
||||
"""
|
||||
async with HostFactory.create_batch_and_listen(2) as hosts:
|
||||
relay_host, client_host = hosts
|
||||
logger.info("Created hosts for test_relay_discovery_find_relay_mux_method")
|
||||
logger.info("Relay host ID: %s", relay_host.get_id())
|
||||
logger.info("Client host ID: %s", client_host.get_id())
|
||||
|
||||
# Explicitly register the protocol handlers on relay_host
|
||||
relay_host.set_stream_handler(PROTOCOL_ID, simple_stream_handler)
|
||||
relay_host.set_stream_handler(STOP_PROTOCOL_ID, simple_stream_handler)
|
||||
|
||||
client_host.set_stream_handler(PROTOCOL_ID, simple_stream_handler)
|
||||
client_host.set_stream_handler(STOP_PROTOCOL_ID, simple_stream_handler)
|
||||
|
||||
# Set up discovery on the client host
|
||||
client_discovery = RelayDiscovery(
|
||||
client_host, discovery_interval=5
|
||||
) # Use shorter interval for testing
|
||||
|
||||
try:
|
||||
# Connect peers so they can discover each other
|
||||
with trio.fail_after(CONNECT_TIMEOUT):
|
||||
logger.info("Connecting client host to relay host")
|
||||
await connect(client_host, relay_host)
|
||||
assert relay_host.get_network().connections[client_host.get_id()], (
|
||||
"Peers not connected"
|
||||
)
|
||||
logger.info("Connection established between peers")
|
||||
except Exception as e:
|
||||
logger.error("Failed to connect peers: %s", str(e))
|
||||
raise
|
||||
|
||||
# Remove the relay from the peerstore to test fallback
|
||||
client_host.get_peerstore().clear_peerdata(relay_host.get_id())
|
||||
# Make sure that peer_id is not present in peerstore
|
||||
assert relay_host.get_id() not in client_host.get_peerstore().peer_ids()
|
||||
|
||||
# Mock the _check_via_direct_connection method to return None
|
||||
# This forces the discovery to fall back to the mux method
|
||||
async def mock_direct_check_fails(peer_id):
|
||||
"""Mock that always returns None to force mux fallback."""
|
||||
return None
|
||||
|
||||
client_discovery._check_via_direct_connection = mock_direct_check_fails
|
||||
|
||||
# Start discovery service
|
||||
async with background_trio_service(client_discovery):
|
||||
await client_discovery.event_started.wait()
|
||||
logger.info("Client discovery service started (mux method)")
|
||||
|
||||
# Wait for discovery to find the relay using the mux method
|
||||
logger.info("Waiting for relay discovery using mux fallback...")
|
||||
|
||||
# Manually trigger discovery which should fallback to mux method
|
||||
await client_discovery.discover_relays()
|
||||
|
||||
# Check if relay was found
|
||||
with trio.fail_after(DISCOVERY_TIMEOUT):
|
||||
for _ in range(20): # Try multiple times
|
||||
if relay_host.get_id() in client_discovery._discovered_relays:
|
||||
logger.info("Relay discovered successfully (mux method)")
|
||||
break
|
||||
|
||||
# Wait and try again
|
||||
await trio.sleep(1)
|
||||
# Manually trigger discovery again
|
||||
await client_discovery.discover_relays()
|
||||
else:
|
||||
pytest.fail(
|
||||
"Failed to discover relay node within timeout (mux method)"
|
||||
)
|
||||
|
||||
# Verify that relay was found and is valid
|
||||
assert relay_host.get_id() in client_discovery._discovered_relays, (
|
||||
"Relay should be discovered (mux method)"
|
||||
)
|
||||
relay_info = client_discovery._discovered_relays[relay_host.get_id()]
|
||||
assert relay_info.peer_id == relay_host.get_id(), (
|
||||
"Peer ID should match (mux method)"
|
||||
)
|
||||
|
||||
# Verify that the protocol was cached via mux method
|
||||
assert relay_host.get_id() in client_discovery._protocol_cache, (
|
||||
"Protocol should be cached (mux method)"
|
||||
)
|
||||
assert (
|
||||
str(PROTOCOL_ID)
|
||||
in client_discovery._protocol_cache[relay_host.get_id()]
|
||||
), "Relay protocol should be in cache (mux method)"
|
||||
assert relay_info.peer_id == relay_host.get_id(), "Peer ID should match"
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
|
||||
@ -1,199 +0,0 @@
|
||||
import logging
|
||||
|
||||
import pytest
|
||||
import trio
|
||||
from trio.testing import (
|
||||
memory_stream_pair,
|
||||
)
|
||||
|
||||
from libp2p.abc import IRawConnection
|
||||
from libp2p.crypto.ed25519 import (
|
||||
create_new_key_pair,
|
||||
)
|
||||
from libp2p.peer.id import (
|
||||
ID,
|
||||
)
|
||||
from libp2p.security.insecure.transport import (
|
||||
InsecureTransport,
|
||||
)
|
||||
from libp2p.stream_muxer.yamux.yamux import (
|
||||
Yamux,
|
||||
YamuxStream,
|
||||
)
|
||||
|
||||
|
||||
class TrioStreamAdapter(IRawConnection):
|
||||
"""Adapter to make trio memory streams work with libp2p."""
|
||||
|
||||
def __init__(self, send_stream, receive_stream, is_initiator=False):
|
||||
self.send_stream = send_stream
|
||||
self.receive_stream = receive_stream
|
||||
self.is_initiator = is_initiator
|
||||
|
||||
async def write(self, data: bytes) -> None:
|
||||
logging.debug(f"Attempting to write {len(data)} bytes")
|
||||
with trio.move_on_after(2):
|
||||
await self.send_stream.send_all(data)
|
||||
|
||||
async def read(self, n: int | None = None) -> bytes:
|
||||
if n is None or n <= 0:
|
||||
raise ValueError("Reading unbounded or zero bytes not supported")
|
||||
logging.debug(f"Attempting to read {n} bytes")
|
||||
with trio.move_on_after(2):
|
||||
data = await self.receive_stream.receive_some(n)
|
||||
logging.debug(f"Read {len(data)} bytes")
|
||||
return data
|
||||
|
||||
async def close(self) -> None:
|
||||
logging.debug("Closing stream")
|
||||
await self.send_stream.aclose()
|
||||
await self.receive_stream.aclose()
|
||||
|
||||
def get_remote_address(self) -> tuple[str, int] | None:
|
||||
"""Return None since this is a test adapter without real network info."""
|
||||
return None
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
def key_pair():
|
||||
return create_new_key_pair()
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
def peer_id(key_pair):
|
||||
return ID.from_pubkey(key_pair.public_key)
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
async def secure_conn_pair(key_pair, peer_id):
|
||||
"""Create a pair of secure connections for testing."""
|
||||
logging.debug("Setting up secure_conn_pair")
|
||||
client_send, server_receive = memory_stream_pair()
|
||||
server_send, client_receive = memory_stream_pair()
|
||||
|
||||
client_rw = TrioStreamAdapter(client_send, client_receive)
|
||||
server_rw = TrioStreamAdapter(server_send, server_receive)
|
||||
|
||||
insecure_transport = InsecureTransport(key_pair)
|
||||
|
||||
async def run_outbound(nursery_results):
|
||||
with trio.move_on_after(5):
|
||||
client_conn = await insecure_transport.secure_outbound(client_rw, peer_id)
|
||||
logging.debug("Outbound handshake complete")
|
||||
nursery_results["client"] = client_conn
|
||||
|
||||
async def run_inbound(nursery_results):
|
||||
with trio.move_on_after(5):
|
||||
server_conn = await insecure_transport.secure_inbound(server_rw)
|
||||
logging.debug("Inbound handshake complete")
|
||||
nursery_results["server"] = server_conn
|
||||
|
||||
nursery_results = {}
|
||||
async with trio.open_nursery() as nursery:
|
||||
nursery.start_soon(run_outbound, nursery_results)
|
||||
nursery.start_soon(run_inbound, nursery_results)
|
||||
await trio.sleep(0.1) # Give tasks a chance to finish
|
||||
|
||||
client_conn = nursery_results.get("client")
|
||||
server_conn = nursery_results.get("server")
|
||||
|
||||
if client_conn is None or server_conn is None:
|
||||
raise RuntimeError("Handshake failed: client_conn or server_conn is None")
|
||||
|
||||
logging.debug("secure_conn_pair setup complete")
|
||||
return client_conn, server_conn
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
async def yamux_pair(secure_conn_pair, peer_id):
|
||||
"""Create a pair of Yamux multiplexers for testing."""
|
||||
logging.debug("Setting up yamux_pair")
|
||||
client_conn, server_conn = secure_conn_pair
|
||||
client_yamux = Yamux(client_conn, peer_id, is_initiator=True)
|
||||
server_yamux = Yamux(server_conn, peer_id, is_initiator=False)
|
||||
async with trio.open_nursery() as nursery:
|
||||
with trio.move_on_after(5):
|
||||
nursery.start_soon(client_yamux.start)
|
||||
nursery.start_soon(server_yamux.start)
|
||||
await trio.sleep(0.1)
|
||||
logging.debug("yamux_pair started")
|
||||
yield client_yamux, server_yamux
|
||||
logging.debug("yamux_pair cleanup")
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_yamux_race_condition_without_locks(yamux_pair):
|
||||
"""
|
||||
Test for race-around/interleaving in Yamux streams,when reading in
|
||||
segments of data.
|
||||
This launches concurrent writers/readers on both sides of a stream.
|
||||
If there is no proper locking, the received data may be interleaved
|
||||
or corrupted.
|
||||
|
||||
The test creates structured messages and verifies they are received
|
||||
intact and in order.
|
||||
Without proper locking, concurrent read/write operations could cause
|
||||
data corruption
|
||||
or message interleaving, which this test will catch.
|
||||
"""
|
||||
client_yamux, server_yamux = yamux_pair
|
||||
client_stream: YamuxStream = await client_yamux.open_stream()
|
||||
server_stream: YamuxStream = await server_yamux.accept_stream()
|
||||
MSG_COUNT = 10
|
||||
MSG_SIZE = 256 * 1024 # At max,only DEFAULT_WINDOW_SIZE bytes can be read
|
||||
client_msgs = [
|
||||
f"CLIENT-MSG-{i:03d}-".encode().ljust(MSG_SIZE, b"C") for i in range(MSG_COUNT)
|
||||
]
|
||||
server_msgs = [
|
||||
f"SERVER-MSG-{i:03d}-".encode().ljust(MSG_SIZE, b"S") for i in range(MSG_COUNT)
|
||||
]
|
||||
client_received = []
|
||||
server_received = []
|
||||
|
||||
async def writer(stream, msgs, name):
|
||||
"""Write messages with minimal delays to encourage race conditions."""
|
||||
for i, msg in enumerate(msgs):
|
||||
await stream.write(msg)
|
||||
# Yield control frequently to encourage interleaving
|
||||
if i % 5 == 0:
|
||||
await trio.sleep(0.005)
|
||||
|
||||
async def reader(stream, received, name):
|
||||
"""Read messages and store them for verification."""
|
||||
for i in range(MSG_COUNT):
|
||||
data = await stream.read(MSG_SIZE)
|
||||
received.append(data)
|
||||
if i % 3 == 0:
|
||||
await trio.sleep(0.001)
|
||||
|
||||
# Running all operations concurrently
|
||||
async with trio.open_nursery() as nursery:
|
||||
nursery.start_soon(writer, client_stream, client_msgs, "client")
|
||||
nursery.start_soon(writer, server_stream, server_msgs, "server")
|
||||
nursery.start_soon(reader, client_stream, client_received, "client")
|
||||
nursery.start_soon(reader, server_stream, server_received, "server")
|
||||
|
||||
assert len(client_received) == MSG_COUNT, (
|
||||
f"Client received {len(client_received)} messages, expected {MSG_COUNT}"
|
||||
)
|
||||
assert len(server_received) == MSG_COUNT, (
|
||||
f"Server received {len(server_received)} messages, expected {MSG_COUNT}"
|
||||
)
|
||||
assert client_received == server_msgs, (
|
||||
"Client did not receive server messages in order or intact!"
|
||||
)
|
||||
assert server_received == client_msgs, (
|
||||
"Server did not receive client messages in order or intact!"
|
||||
)
|
||||
for i, msg in enumerate(client_received):
|
||||
assert len(msg) == MSG_SIZE, (
|
||||
f"Client message {i} has wrong size: {len(msg)} != {MSG_SIZE}"
|
||||
)
|
||||
|
||||
for i, msg in enumerate(server_received):
|
||||
assert len(msg) == MSG_SIZE, (
|
||||
f"Server message {i} has wrong size: {len(msg)} != {MSG_SIZE}"
|
||||
)
|
||||
|
||||
await client_stream.close()
|
||||
await server_stream.close()
|
||||
@ -1,195 +0,0 @@
|
||||
import logging
|
||||
|
||||
import pytest
|
||||
import trio
|
||||
from trio.testing import (
|
||||
memory_stream_pair,
|
||||
)
|
||||
|
||||
from libp2p.abc import IRawConnection
|
||||
from libp2p.crypto.ed25519 import (
|
||||
create_new_key_pair,
|
||||
)
|
||||
from libp2p.peer.id import (
|
||||
ID,
|
||||
)
|
||||
from libp2p.security.insecure.transport import (
|
||||
InsecureTransport,
|
||||
)
|
||||
from libp2p.stream_muxer.exceptions import MuxedStreamEOF
|
||||
from libp2p.stream_muxer.yamux.yamux import (
|
||||
Yamux,
|
||||
YamuxStream,
|
||||
)
|
||||
|
||||
|
||||
class TrioStreamAdapter(IRawConnection):
|
||||
"""Adapter to make trio memory streams work with libp2p."""
|
||||
|
||||
def __init__(self, send_stream, receive_stream, is_initiator=False):
|
||||
self.send_stream = send_stream
|
||||
self.receive_stream = receive_stream
|
||||
self.is_initiator = is_initiator
|
||||
|
||||
async def write(self, data: bytes) -> None:
|
||||
logging.debug(f"Attempting to write {len(data)} bytes")
|
||||
with trio.move_on_after(2):
|
||||
await self.send_stream.send_all(data)
|
||||
|
||||
async def read(self, n: int | None = None) -> bytes:
|
||||
if n is None or n <= 0:
|
||||
raise ValueError("Reading unbounded or zero bytes not supported")
|
||||
logging.debug(f"Attempting to read {n} bytes")
|
||||
with trio.move_on_after(2):
|
||||
data = await self.receive_stream.receive_some(n)
|
||||
logging.debug(f"Read {len(data)} bytes")
|
||||
return data
|
||||
|
||||
async def close(self) -> None:
|
||||
logging.debug("Closing stream")
|
||||
await self.send_stream.aclose()
|
||||
await self.receive_stream.aclose()
|
||||
|
||||
def get_remote_address(self) -> tuple[str, int] | None:
|
||||
"""Return None since this is a test adapter without real network info."""
|
||||
return None
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
def key_pair():
|
||||
return create_new_key_pair()
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
def peer_id(key_pair):
|
||||
return ID.from_pubkey(key_pair.public_key)
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
async def secure_conn_pair(key_pair, peer_id):
|
||||
"""Create a pair of secure connections for testing."""
|
||||
logging.debug("Setting up secure_conn_pair")
|
||||
client_send, server_receive = memory_stream_pair()
|
||||
server_send, client_receive = memory_stream_pair()
|
||||
|
||||
client_rw = TrioStreamAdapter(client_send, client_receive)
|
||||
server_rw = TrioStreamAdapter(server_send, server_receive)
|
||||
|
||||
insecure_transport = InsecureTransport(key_pair)
|
||||
|
||||
async def run_outbound(nursery_results):
|
||||
with trio.move_on_after(5):
|
||||
client_conn = await insecure_transport.secure_outbound(client_rw, peer_id)
|
||||
logging.debug("Outbound handshake complete")
|
||||
nursery_results["client"] = client_conn
|
||||
|
||||
async def run_inbound(nursery_results):
|
||||
with trio.move_on_after(5):
|
||||
server_conn = await insecure_transport.secure_inbound(server_rw)
|
||||
logging.debug("Inbound handshake complete")
|
||||
nursery_results["server"] = server_conn
|
||||
|
||||
nursery_results = {}
|
||||
async with trio.open_nursery() as nursery:
|
||||
nursery.start_soon(run_outbound, nursery_results)
|
||||
nursery.start_soon(run_inbound, nursery_results)
|
||||
await trio.sleep(0.1) # Give tasks a chance to finish
|
||||
|
||||
client_conn = nursery_results.get("client")
|
||||
server_conn = nursery_results.get("server")
|
||||
|
||||
if client_conn is None or server_conn is None:
|
||||
raise RuntimeError("Handshake failed: client_conn or server_conn is None")
|
||||
|
||||
logging.debug("secure_conn_pair setup complete")
|
||||
return client_conn, server_conn
|
||||
|
||||
|
||||
@pytest.fixture
|
||||
async def yamux_pair(secure_conn_pair, peer_id):
|
||||
"""Create a pair of Yamux multiplexers for testing."""
|
||||
logging.debug("Setting up yamux_pair")
|
||||
client_conn, server_conn = secure_conn_pair
|
||||
client_yamux = Yamux(client_conn, peer_id, is_initiator=True)
|
||||
server_yamux = Yamux(server_conn, peer_id, is_initiator=False)
|
||||
async with trio.open_nursery() as nursery:
|
||||
with trio.move_on_after(5):
|
||||
nursery.start_soon(client_yamux.start)
|
||||
nursery.start_soon(server_yamux.start)
|
||||
await trio.sleep(0.1)
|
||||
logging.debug("yamux_pair started")
|
||||
yield client_yamux, server_yamux
|
||||
logging.debug("yamux_pair cleanup")
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_yamux_race_condition_without_locks(yamux_pair):
|
||||
"""
|
||||
Test for race-around/interleaving in Yamux streams,when reading till
|
||||
EOF is being used.
|
||||
This launches concurrent writers/readers on both sides of a stream.
|
||||
If there is no proper locking, the received data may be interleaved
|
||||
or corrupted.
|
||||
|
||||
The test creates structured messages and verifies they are received
|
||||
intact and in order.
|
||||
Without proper locking, concurrent read/write operations could cause
|
||||
data corruption
|
||||
or message interleaving, which this test will catch.
|
||||
"""
|
||||
client_yamux, server_yamux = yamux_pair
|
||||
client_stream: YamuxStream = await client_yamux.open_stream()
|
||||
server_stream: YamuxStream = await server_yamux.accept_stream()
|
||||
MSG_COUNT = 1
|
||||
MSG_SIZE = 512 * 1024
|
||||
client_msgs = [
|
||||
f"CLIENT-MSG-{i:03d}-".encode().ljust(MSG_SIZE, b"C") for i in range(MSG_COUNT)
|
||||
]
|
||||
server_msgs = [
|
||||
f"SERVER-MSG-{i:03d}-".encode().ljust(MSG_SIZE, b"S") for i in range(MSG_COUNT)
|
||||
]
|
||||
client_received = []
|
||||
server_received = []
|
||||
|
||||
async def writer(stream, msgs, name):
|
||||
"""Write messages with minimal delays to encourage race conditions."""
|
||||
for i, msg in enumerate(msgs):
|
||||
await stream.write(msg)
|
||||
# Yield control frequently to encourage interleaving
|
||||
if i % 5 == 0:
|
||||
await trio.sleep(0.005)
|
||||
|
||||
async def reader(stream, received, name):
|
||||
"""Read messages and store them for verification."""
|
||||
try:
|
||||
data = await stream.read()
|
||||
if data:
|
||||
received.append(data)
|
||||
except MuxedStreamEOF:
|
||||
pass
|
||||
|
||||
# Running all operations concurrently
|
||||
async with trio.open_nursery() as nursery:
|
||||
nursery.start_soon(writer, client_stream, client_msgs, "client")
|
||||
nursery.start_soon(writer, server_stream, server_msgs, "server")
|
||||
nursery.start_soon(reader, client_stream, client_received, "client")
|
||||
nursery.start_soon(reader, server_stream, server_received, "server")
|
||||
|
||||
assert client_received == server_msgs, (
|
||||
"Client did not receive server messages in order or intact!"
|
||||
)
|
||||
assert server_received == client_msgs, (
|
||||
"Server did not receive client messages in order or intact!"
|
||||
)
|
||||
for i, msg in enumerate(client_received):
|
||||
assert len(msg) == MSG_SIZE, (
|
||||
f"Client message {i} has wrong size: {len(msg)} != {MSG_SIZE}"
|
||||
)
|
||||
|
||||
for i, msg in enumerate(server_received):
|
||||
assert len(msg) == MSG_SIZE, (
|
||||
f"Server message {i} has wrong size: {len(msg)} != {MSG_SIZE}"
|
||||
)
|
||||
|
||||
await client_stream.close()
|
||||
await server_stream.close()
|
||||
@ -1,215 +0,0 @@
|
||||
import pytest
|
||||
|
||||
from libp2p.exceptions import ParseError
|
||||
from libp2p.io.abc import Reader
|
||||
from libp2p.utils.varint import (
|
||||
decode_varint_from_bytes,
|
||||
encode_uvarint,
|
||||
encode_varint_prefixed,
|
||||
read_varint_prefixed_bytes,
|
||||
)
|
||||
|
||||
|
||||
class MockReader(Reader):
|
||||
"""Mock reader for testing varint functions."""
|
||||
|
||||
def __init__(self, data: bytes):
|
||||
self.data = data
|
||||
self.position = 0
|
||||
|
||||
async def read(self, n: int | None = None) -> bytes:
|
||||
if self.position >= len(self.data):
|
||||
return b""
|
||||
if n is None:
|
||||
n = len(self.data) - self.position
|
||||
result = self.data[self.position : self.position + n]
|
||||
self.position += len(result)
|
||||
return result
|
||||
|
||||
|
||||
def test_encode_uvarint():
|
||||
"""Test varint encoding with various values."""
|
||||
test_cases = [
|
||||
(0, b"\x00"),
|
||||
(1, b"\x01"),
|
||||
(127, b"\x7f"),
|
||||
(128, b"\x80\x01"),
|
||||
(255, b"\xff\x01"),
|
||||
(256, b"\x80\x02"),
|
||||
(65535, b"\xff\xff\x03"),
|
||||
(65536, b"\x80\x80\x04"),
|
||||
(16777215, b"\xff\xff\xff\x07"),
|
||||
(16777216, b"\x80\x80\x80\x08"),
|
||||
]
|
||||
|
||||
for value, expected in test_cases:
|
||||
result = encode_uvarint(value)
|
||||
assert result == expected, (
|
||||
f"Failed for value {value}: expected {expected.hex()}, got {result.hex()}"
|
||||
)
|
||||
|
||||
|
||||
def test_decode_varint_from_bytes():
|
||||
"""Test varint decoding with various values."""
|
||||
test_cases = [
|
||||
(b"\x00", 0),
|
||||
(b"\x01", 1),
|
||||
(b"\x7f", 127),
|
||||
(b"\x80\x01", 128),
|
||||
(b"\xff\x01", 255),
|
||||
(b"\x80\x02", 256),
|
||||
(b"\xff\xff\x03", 65535),
|
||||
(b"\x80\x80\x04", 65536),
|
||||
(b"\xff\xff\xff\x07", 16777215),
|
||||
(b"\x80\x80\x80\x08", 16777216),
|
||||
]
|
||||
|
||||
for data, expected in test_cases:
|
||||
result = decode_varint_from_bytes(data)
|
||||
assert result == expected, (
|
||||
f"Failed for data {data.hex()}: expected {expected}, got {result}"
|
||||
)
|
||||
|
||||
|
||||
def test_decode_varint_from_bytes_invalid():
|
||||
"""Test varint decoding with invalid data."""
|
||||
# Empty data
|
||||
with pytest.raises(ParseError, match="Unexpected end of data"):
|
||||
decode_varint_from_bytes(b"")
|
||||
|
||||
# Incomplete varint (should not raise, but should handle gracefully)
|
||||
# This depends on the implementation - some might raise, others might return partial
|
||||
|
||||
|
||||
def test_encode_varint_prefixed():
|
||||
"""Test encoding messages with varint length prefix."""
|
||||
test_cases = [
|
||||
(b"", b"\x00"),
|
||||
(b"hello", b"\x05hello"),
|
||||
(b"x" * 127, b"\x7f" + b"x" * 127),
|
||||
(b"x" * 128, b"\x80\x01" + b"x" * 128),
|
||||
]
|
||||
|
||||
for message, expected in test_cases:
|
||||
result = encode_varint_prefixed(message)
|
||||
assert result == expected, (
|
||||
f"Failed for message {message}: expected {expected.hex()}, "
|
||||
f"got {result.hex()}"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_read_varint_prefixed_bytes():
|
||||
"""Test reading length-prefixed bytes from a stream."""
|
||||
test_cases = [
|
||||
(b"", b""),
|
||||
(b"hello", b"hello"),
|
||||
(b"x" * 127, b"x" * 127),
|
||||
(b"x" * 128, b"x" * 128),
|
||||
]
|
||||
|
||||
for message, expected in test_cases:
|
||||
prefixed_data = encode_varint_prefixed(message)
|
||||
reader = MockReader(prefixed_data)
|
||||
|
||||
result = await read_varint_prefixed_bytes(reader)
|
||||
assert result == expected, (
|
||||
f"Failed for message {message}: expected {expected}, got {result}"
|
||||
)
|
||||
|
||||
|
||||
@pytest.mark.trio
|
||||
async def test_read_varint_prefixed_bytes_incomplete():
|
||||
"""Test reading length-prefixed bytes with incomplete data."""
|
||||
from libp2p.io.exceptions import IncompleteReadError
|
||||
|
||||
# Test with incomplete varint
|
||||
reader = MockReader(b"\x80") # Incomplete varint
|
||||
with pytest.raises(IncompleteReadError):
|
||||
await read_varint_prefixed_bytes(reader)
|
||||
|
||||
# Test with incomplete message
|
||||
prefixed_data = encode_varint_prefixed(b"hello world")
|
||||
reader = MockReader(prefixed_data[:-3]) # Missing last 3 bytes
|
||||
with pytest.raises(IncompleteReadError):
|
||||
await read_varint_prefixed_bytes(reader)
|
||||
|
||||
|
||||
def test_varint_roundtrip():
|
||||
"""Test roundtrip encoding and decoding."""
|
||||
test_values = [0, 1, 127, 128, 255, 256, 65535, 65536, 16777215, 16777216]
|
||||
|
||||
for value in test_values:
|
||||
encoded = encode_uvarint(value)
|
||||
decoded = decode_varint_from_bytes(encoded)
|
||||
assert decoded == value, (
|
||||
f"Roundtrip failed for {value}: encoded={encoded.hex()}, decoded={decoded}"
|
||||
)
|
||||
|
||||
|
||||
def test_varint_prefixed_roundtrip():
|
||||
"""Test roundtrip encoding and decoding of length-prefixed messages."""
|
||||
test_messages = [
|
||||
b"",
|
||||
b"hello",
|
||||
b"x" * 127,
|
||||
b"x" * 128,
|
||||
b"x" * 1000,
|
||||
]
|
||||
|
||||
for message in test_messages:
|
||||
prefixed = encode_varint_prefixed(message)
|
||||
|
||||
# Decode the length
|
||||
length = decode_varint_from_bytes(prefixed)
|
||||
assert length == len(message), (
|
||||
f"Length mismatch for {message}: expected {len(message)}, got {length}"
|
||||
)
|
||||
|
||||
# Extract the message
|
||||
varint_len = 0
|
||||
for i, byte in enumerate(prefixed):
|
||||
varint_len += 1
|
||||
if (byte & 0x80) == 0:
|
||||
break
|
||||
|
||||
extracted_message = prefixed[varint_len:]
|
||||
assert extracted_message == message, (
|
||||
f"Message mismatch: expected {message}, got {extracted_message}"
|
||||
)
|
||||
|
||||
|
||||
def test_large_varint_values():
|
||||
"""Test varint encoding/decoding with large values."""
|
||||
large_values = [
|
||||
2**32 - 1, # 32-bit max
|
||||
2**64 - 1, # 64-bit max (if supported)
|
||||
]
|
||||
|
||||
for value in large_values:
|
||||
try:
|
||||
encoded = encode_uvarint(value)
|
||||
decoded = decode_varint_from_bytes(encoded)
|
||||
assert decoded == value, f"Large value roundtrip failed for {value}"
|
||||
except Exception as e:
|
||||
# Some implementations might not support very large values
|
||||
pytest.skip(f"Large value {value} not supported: {e}")
|
||||
|
||||
|
||||
def test_varint_edge_cases():
|
||||
"""Test varint encoding/decoding with edge cases."""
|
||||
# Test with maximum 7-bit value
|
||||
assert encode_uvarint(127) == b"\x7f"
|
||||
assert decode_varint_from_bytes(b"\x7f") == 127
|
||||
|
||||
# Test with minimum 8-bit value
|
||||
assert encode_uvarint(128) == b"\x80\x01"
|
||||
assert decode_varint_from_bytes(b"\x80\x01") == 128
|
||||
|
||||
# Test with maximum 14-bit value
|
||||
assert encode_uvarint(16383) == b"\xff\x7f"
|
||||
assert decode_varint_from_bytes(b"\xff\x7f") == 16383
|
||||
|
||||
# Test with minimum 15-bit value
|
||||
assert encode_uvarint(16384) == b"\x80\x80\x01"
|
||||
assert decode_varint_from_bytes(b"\x80\x80\x01") == 16384
|
||||
@ -1,91 +0,0 @@
|
||||
"""
|
||||
Unit tests for mDNS broadcaster component.
|
||||
"""
|
||||
|
||||
from zeroconf import Zeroconf
|
||||
|
||||
from libp2p.discovery.mdns.broadcaster import PeerBroadcaster
|
||||
from libp2p.peer.id import ID
|
||||
|
||||
|
||||
class TestPeerBroadcaster:
|
||||
"""Unit tests for PeerBroadcaster."""
|
||||
|
||||
def test_broadcaster_initialization(self):
|
||||
"""Test that broadcaster initializes correctly."""
|
||||
zeroconf = Zeroconf()
|
||||
service_type = "_p2p._udp.local."
|
||||
service_name = "test-peer._p2p._udp.local."
|
||||
peer_id = (
|
||||
"QmNnooDu7bfjPFoTZYxMNLWUQJyrVwtbZg5gBMjTezGAJN" # String, not ID object
|
||||
)
|
||||
port = 8000
|
||||
|
||||
broadcaster = PeerBroadcaster(
|
||||
zeroconf=zeroconf,
|
||||
service_type=service_type,
|
||||
service_name=service_name,
|
||||
peer_id=peer_id,
|
||||
port=port,
|
||||
)
|
||||
|
||||
assert broadcaster.zeroconf == zeroconf
|
||||
assert broadcaster.service_type == service_type
|
||||
assert broadcaster.service_name == service_name
|
||||
assert broadcaster.peer_id == peer_id
|
||||
assert broadcaster.port == port
|
||||
|
||||
# Clean up
|
||||
zeroconf.close()
|
||||
|
||||
def test_broadcaster_service_creation(self):
|
||||
"""Test that broadcaster creates valid service info."""
|
||||
zeroconf = Zeroconf()
|
||||
service_type = "_p2p._udp.local."
|
||||
service_name = "test-peer2._p2p._udp.local."
|
||||
peer_id_obj = ID.from_base58("QmNnooDu7bfjPFoTZYxMNLWUQJyrVwtbZg5gBMjTezGAJN")
|
||||
peer_id = str(peer_id_obj) # Convert to string
|
||||
port = 8000
|
||||
|
||||
broadcaster = PeerBroadcaster(
|
||||
zeroconf=zeroconf,
|
||||
service_type=service_type,
|
||||
service_name=service_name,
|
||||
peer_id=peer_id,
|
||||
port=port,
|
||||
)
|
||||
|
||||
# Verify service was created and registered
|
||||
service_info = broadcaster.service_info
|
||||
assert service_info is not None
|
||||
assert service_info.type == service_type
|
||||
assert service_info.name == service_name
|
||||
assert service_info.port == port
|
||||
assert b"id" in service_info.properties
|
||||
assert service_info.properties[b"id"] == peer_id.encode()
|
||||
|
||||
# Clean up
|
||||
zeroconf.close()
|
||||
|
||||
def test_broadcaster_start_stop(self):
|
||||
"""Test that broadcaster can start and stop correctly."""
|
||||
zeroconf = Zeroconf()
|
||||
service_type = "_p2p._udp.local."
|
||||
service_name = "test-start-stop._p2p._udp.local."
|
||||
peer_id_obj = ID.from_base58("QmYyQSo1c1Ym7orWxLYvCrM2EmxFTANf8wXmmE7DWjhx5N")
|
||||
peer_id = str(peer_id_obj) # Convert to string
|
||||
port = 8001
|
||||
|
||||
broadcaster = PeerBroadcaster(
|
||||
zeroconf=zeroconf,
|
||||
service_type=service_type,
|
||||
service_name=service_name,
|
||||
peer_id=peer_id,
|
||||
port=port,
|
||||
)
|
||||
|
||||
# Service should be registered
|
||||
assert broadcaster.service_info is not None
|
||||
|
||||
# Clean up
|
||||
zeroconf.close()
|
||||
@ -1,114 +0,0 @@
|
||||
"""
|
||||
Unit tests for mDNS listener component.
|
||||
"""
|
||||
|
||||
import socket
|
||||
|
||||
from zeroconf import ServiceInfo, Zeroconf
|
||||
|
||||
from libp2p.abc import Multiaddr
|
||||
from libp2p.discovery.mdns.listener import PeerListener
|
||||
from libp2p.peer.id import ID
|
||||
from libp2p.peer.peerstore import PeerStore
|
||||
|
||||
|
||||
class TestPeerListener:
|
||||
"""Unit tests for PeerListener."""
|
||||
|
||||
def test_listener_initialization(self):
|
||||
"""Test that listener initializes correctly."""
|
||||
peerstore = PeerStore()
|
||||
zeroconf = Zeroconf()
|
||||
service_type = "_p2p._udp.local."
|
||||
service_name = "local-peer._p2p._udp.local."
|
||||
|
||||
listener = PeerListener(
|
||||
peerstore=peerstore,
|
||||
zeroconf=zeroconf,
|
||||
service_type=service_type,
|
||||
service_name=service_name,
|
||||
)
|
||||
|
||||
assert listener.peerstore == peerstore
|
||||
assert listener.zeroconf == zeroconf
|
||||
assert listener.service_type == service_type
|
||||
assert listener.service_name == service_name
|
||||
assert listener.discovered_services == {}
|
||||
|
||||
# Clean up
|
||||
listener.stop()
|
||||
zeroconf.close()
|
||||
|
||||
def test_listener_extract_peer_info_success(self):
|
||||
"""Test successful PeerInfo extraction from ServiceInfo."""
|
||||
peerstore = PeerStore()
|
||||
zeroconf = Zeroconf()
|
||||
|
||||
listener = PeerListener(
|
||||
peerstore=peerstore,
|
||||
zeroconf=zeroconf,
|
||||
service_type="_p2p._udp.local.",
|
||||
service_name="local._p2p._udp.local.",
|
||||
)
|
||||
|
||||
# Create sample service info
|
||||
sample_peer_id = ID.from_base58(
|
||||
"QmNnooDu7bfjPFoTZYxMNLWUQJyrVwtbZg5gBMjTezGAJN"
|
||||
)
|
||||
hostname = socket.gethostname()
|
||||
local_ip = "192.168.1.100"
|
||||
|
||||
sample_service_info = ServiceInfo(
|
||||
type_="_p2p._udp.local.",
|
||||
name="test-peer._p2p._udp.local.",
|
||||
port=8000,
|
||||
properties={b"id": str(sample_peer_id).encode()},
|
||||
server=f"{hostname}.local.",
|
||||
addresses=[socket.inet_aton(local_ip)],
|
||||
)
|
||||
|
||||
peer_info = listener._extract_peer_info(sample_service_info)
|
||||
|
||||
assert peer_info is not None
|
||||
assert isinstance(peer_info.peer_id, ID)
|
||||
assert len(peer_info.addrs) > 0
|
||||
assert all(isinstance(addr, Multiaddr) for addr in peer_info.addrs)
|
||||
|
||||
# Check that protocol is TCP since we always use TCP
|
||||
assert "/tcp/" in str(peer_info.addrs[0])
|
||||
|
||||
# Clean up
|
||||
listener.stop()
|
||||
zeroconf.close()
|
||||
|
||||
def test_listener_extract_peer_info_invalid_id(self):
|
||||
"""Test PeerInfo extraction fails with invalid peer ID."""
|
||||
peerstore = PeerStore()
|
||||
zeroconf = Zeroconf()
|
||||
|
||||
listener = PeerListener(
|
||||
peerstore=peerstore,
|
||||
zeroconf=zeroconf,
|
||||
service_type="_p2p._udp.local.",
|
||||
service_name="local._p2p._udp.local.",
|
||||
)
|
||||
|
||||
# Create service info with invalid peer ID
|
||||
hostname = socket.gethostname()
|
||||
local_ip = "192.168.1.100"
|
||||
|
||||
service_info = ServiceInfo(
|
||||
type_="_p2p._udp.local.",
|
||||
name="invalid-peer._p2p._udp.local.",
|
||||
port=8000,
|
||||
properties={b"id": b"invalid_peer_id_format"},
|
||||
server=f"{hostname}.local.",
|
||||
addresses=[socket.inet_aton(local_ip)],
|
||||
)
|
||||
|
||||
peer_info = listener._extract_peer_info(service_info)
|
||||
assert peer_info is None
|
||||
|
||||
# Clean up
|
||||
listener.stop()
|
||||
zeroconf.close()
|
||||
@ -1,121 +0,0 @@
|
||||
"""
|
||||
Comprehensive integration tests for mDNS discovery functionality.
|
||||
"""
|
||||
|
||||
import socket
|
||||
|
||||
from zeroconf import Zeroconf
|
||||
|
||||
from libp2p.discovery.mdns.broadcaster import PeerBroadcaster
|
||||
from libp2p.discovery.mdns.listener import PeerListener
|
||||
from libp2p.peer.id import ID
|
||||
from libp2p.peer.peerstore import PeerStore
|
||||
|
||||
|
||||
class TestMDNSDiscovery:
|
||||
"""Comprehensive integration tests for mDNS peer discovery."""
|
||||
|
||||
def test_one_host_finds_another(self):
|
||||
"""Test that one host can find another host using mDNS."""
|
||||
# Create two separate Zeroconf instances to simulate different hosts
|
||||
host1_zeroconf = Zeroconf()
|
||||
host2_zeroconf = Zeroconf()
|
||||
|
||||
try:
|
||||
# Host 1: Set up as broadcaster (the host to be discovered)
|
||||
host1_peer_id_obj = ID.from_base58(
|
||||
"QmNnooDu7bfjPFoTZYxMNLWUQJyrVwtbZg5gBMjTezGAJN"
|
||||
)
|
||||
host1_peer_id = str(host1_peer_id_obj) # Convert to string
|
||||
host1_broadcaster = PeerBroadcaster(
|
||||
zeroconf=host1_zeroconf,
|
||||
service_type="_p2p._udp.local.",
|
||||
service_name="host1._p2p._udp.local.",
|
||||
peer_id=host1_peer_id,
|
||||
port=8000,
|
||||
)
|
||||
|
||||
# Host 2: Set up as listener (the host that discovers others)
|
||||
host2_peerstore = PeerStore()
|
||||
host2_listener = PeerListener(
|
||||
peerstore=host2_peerstore,
|
||||
zeroconf=host2_zeroconf,
|
||||
service_type="_p2p._udp.local.",
|
||||
service_name="host2._p2p._udp.local.",
|
||||
)
|
||||
|
||||
# Host 1 registers its service for discovery
|
||||
host1_broadcaster.register()
|
||||
|
||||
# Verify that host2 discovered host1
|
||||
assert len(host2_listener.discovered_services) > 0
|
||||
assert "host1._p2p._udp.local." in host2_listener.discovered_services
|
||||
|
||||
# Verify that host1's peer info was added to host2's peerstore
|
||||
discovered_peer_id = host2_listener.discovered_services[
|
||||
"host1._p2p._udp.local."
|
||||
]
|
||||
assert str(discovered_peer_id) == host1_peer_id
|
||||
|
||||
# Verify addresses were added to peerstore
|
||||
try:
|
||||
addrs = host2_peerstore.addrs(discovered_peer_id)
|
||||
assert len(addrs) > 0
|
||||
# Should be TCP since we always use TCP protocol
|
||||
assert "/tcp/8000" in str(addrs[0])
|
||||
except Exception:
|
||||
# If no addresses found, the discovery didn't work properly
|
||||
assert False, "Host1 addresses should be in Host2's peerstore"
|
||||
|
||||
# Clean up
|
||||
host1_broadcaster.unregister()
|
||||
host2_listener.stop()
|
||||
|
||||
finally:
|
||||
host1_zeroconf.close()
|
||||
host2_zeroconf.close()
|
||||
|
||||
def test_service_info_extraction(self):
|
||||
"""Test service info extraction functionality."""
|
||||
peerstore = PeerStore()
|
||||
zeroconf = Zeroconf()
|
||||
|
||||
try:
|
||||
listener = PeerListener(
|
||||
peerstore=peerstore,
|
||||
zeroconf=zeroconf,
|
||||
service_type="_p2p._udp.local.",
|
||||
service_name="test-listener._p2p._udp.local.",
|
||||
)
|
||||
|
||||
# Create a test service info
|
||||
test_peer_id = ID.from_base58(
|
||||
"QmYyQSo1c1Ym7orWxLYvCrM2EmxFTANf8wXmmE7DWjhx5N"
|
||||
)
|
||||
hostname = socket.gethostname()
|
||||
|
||||
from zeroconf import ServiceInfo
|
||||
|
||||
service_info = ServiceInfo(
|
||||
type_="_p2p._udp.local.",
|
||||
name="test-service._p2p._udp.local.",
|
||||
port=8001,
|
||||
properties={b"id": str(test_peer_id).encode()},
|
||||
server=f"{hostname}.local.",
|
||||
addresses=[socket.inet_aton("192.168.1.100")],
|
||||
)
|
||||
|
||||
# Test extraction
|
||||
peer_info = listener._extract_peer_info(service_info)
|
||||
|
||||
assert peer_info is not None
|
||||
assert peer_info.peer_id == test_peer_id
|
||||
assert len(peer_info.addrs) == 1
|
||||
assert "/tcp/8001" in str(peer_info.addrs[0])
|
||||
|
||||
print("✅ Service info extraction test successful!")
|
||||
print(f" Extracted peer ID: {peer_info.peer_id}")
|
||||
print(f" Extracted addresses: {[str(addr) for addr in peer_info.addrs]}")
|
||||
|
||||
finally:
|
||||
zeroconf.close()
|
||||
@ -1,39 +0,0 @@
|
||||
"""
|
||||
Basic unit tests for mDNS utils module.
|
||||
"""
|
||||
|
||||
import string
|
||||
|
||||
from libp2p.discovery.mdns.utils import stringGen
|
||||
|
||||
|
||||
class TestStringGen:
|
||||
"""Unit tests for stringGen function."""
|
||||
|
||||
def test_stringgen_default_length(self):
|
||||
"""Test stringGen with default length (63)."""
|
||||
result = stringGen()
|
||||
|
||||
assert isinstance(result, str)
|
||||
assert len(result) == 63
|
||||
|
||||
# Check that all characters are from the expected charset
|
||||
charset = string.ascii_lowercase + string.digits
|
||||
for char in result:
|
||||
assert char in charset
|
||||
|
||||
def test_stringgen_custom_length(self):
|
||||
"""Test stringGen with custom lengths."""
|
||||
# Test various lengths
|
||||
test_lengths = [1, 5, 10, 20, 50, 100]
|
||||
|
||||
for length in test_lengths:
|
||||
result = stringGen(length)
|
||||
|
||||
assert isinstance(result, str)
|
||||
assert len(result) == length
|
||||
|
||||
# Check that all characters are from the expected charset
|
||||
charset = string.ascii_lowercase + string.digits
|
||||
for char in result:
|
||||
assert char in charset
|
||||
@ -1,81 +0,0 @@
|
||||
# py-libp2p and js-libp2p Interoperability Tests
|
||||
|
||||
This repository contains interoperability tests for py-libp2p and js-libp2p using the /ipfs/ping/1.0.0 protocol. The goal is to verify compatibility in stream multiplexing, protocol negotiation, ping handling, transport layer, and multiaddr parsing.
|
||||
|
||||
## Directory Structure
|
||||
|
||||
- js_node/ping.js: JavaScript implementation of a ping server and client using libp2p.
|
||||
- py_node/ping.py: Python implementation of a ping server and client using py-libp2p.
|
||||
- scripts/run_test.sh: Shell script to automate running the server and client for testing.
|
||||
- README.md: This file.
|
||||
|
||||
## Prerequisites
|
||||
|
||||
- Python 3.8+ with `py-libp2p` and dependencies (`pip install libp2p trio cryptography multiaddr`).
|
||||
- Node.js 16+ with `libp2p` dependencies (`npm install @libp2p/core @libp2p/tcp @chainsafe/libp2p-noise @chainsafe/libp2p-yamux @libp2p/ping @libp2p/identify @multiformats/multiaddr`).
|
||||
- Bash shell for running `run_test.sh`.
|
||||
|
||||
## Running Tests
|
||||
|
||||
1. Change directory:
|
||||
|
||||
```
|
||||
cd tests/interop/js_libp2p
|
||||
```
|
||||
|
||||
2. Install dependencies:
|
||||
|
||||
```
|
||||
For JavaScript: cd js_node && npm install && cd ...
|
||||
```
|
||||
|
||||
3. Run the automated test:
|
||||
|
||||
For Linux and Mac users:
|
||||
|
||||
```
|
||||
chmod +x scripts/run_test.sh
|
||||
./scripts/run_test.sh
|
||||
```
|
||||
|
||||
For Windows users:
|
||||
|
||||
```
|
||||
.\scripts\run_test.ps1
|
||||
```
|
||||
|
||||
This starts the Python server on port 8000 and runs the JavaScript client to send 5 pings.
|
||||
|
||||
## Debugging
|
||||
|
||||
- Logs are saved in py_node/py_server.log and js_node/js_client.log.
|
||||
- Check for:
|
||||
- Successful connection establishment.
|
||||
- Protocol negotiation (/ipfs/ping/1.0.0).
|
||||
- 32-byte payload echo in server logs.
|
||||
- RTT and payload hex in client logs.
|
||||
|
||||
## Test Plan
|
||||
|
||||
### The test verifies:
|
||||
|
||||
- Stream Multiplexer Compatibility: Yamux is used and negotiates correctly.
|
||||
- Multistream Protocol Negotiation: /ipfs/ping/1.0.0 is selected via multistream-select.
|
||||
- Ping Protocol Handler: Handles 32-byte payloads per the libp2p ping spec.
|
||||
- Transport Layer Support: TCP is used; WebSocket support is optional.
|
||||
- Multiaddr Parsing: Correctly resolves multiaddr strings.
|
||||
- Logging: Includes peer ID, RTT, and payload hex for debugging.
|
||||
|
||||
## Current Status
|
||||
|
||||
### Working:
|
||||
|
||||
- TCP transport and Noise encryption are functional.
|
||||
- Yamux multiplexing is implemented in both nodes.
|
||||
- Multiaddr parsing works correctly.
|
||||
- Logging provides detailed debug information.
|
||||
|
||||
## Not Working:
|
||||
|
||||
- Ping protocol handler fails to complete pings (JS client reports "operation aborted").
|
||||
- Potential issues with stream handling or protocol negotiation.
|
||||
@ -1,53 +0,0 @@
|
||||
# @libp2p/example-chat <!-- omit in toc -->
|
||||
|
||||
[](http://libp2p.io/)
|
||||
[](https://discuss.libp2p.io)
|
||||
[](https://codecov.io/gh/libp2p/js-libp2p-examples)
|
||||
[](https://github.com/libp2p/js-libp2p-examples/actions/workflows/ci.yml?query=branch%3Amain)
|
||||
|
||||
> An example chat app using libp2p
|
||||
|
||||
## Table of contents <!-- omit in toc -->
|
||||
|
||||
- [Setup](#setup)
|
||||
- [Running](#running)
|
||||
- [Need help?](#need-help)
|
||||
- [License](#license)
|
||||
- [Contribution](#contribution)
|
||||
|
||||
## Setup
|
||||
|
||||
1. Install example dependencies
|
||||
```console
|
||||
$ npm install
|
||||
```
|
||||
1. Open 2 terminal windows in the `./src` directory.
|
||||
|
||||
## Running
|
||||
|
||||
1. Run the listener in window 1, `node listener.js`
|
||||
1. Run the dialer in window 2, `node dialer.js`
|
||||
1. Wait until the two peers discover each other
|
||||
1. Type a message in either window and hit *enter*
|
||||
1. Tell yourself secrets to your hearts content!
|
||||
|
||||
## Need help?
|
||||
|
||||
- Read the [js-libp2p documentation](https://github.com/libp2p/js-libp2p/tree/main/doc)
|
||||
- Check out the [js-libp2p API docs](https://libp2p.github.io/js-libp2p/)
|
||||
- Check out the [general libp2p documentation](https://docs.libp2p.io) for tips, how-tos and more
|
||||
- Read the [libp2p specs](https://github.com/libp2p/specs)
|
||||
- Ask a question on the [js-libp2p discussion board](https://github.com/libp2p/js-libp2p/discussions)
|
||||
|
||||
## License
|
||||
|
||||
Licensed under either of
|
||||
|
||||
- Apache 2.0, ([LICENSE-APACHE](LICENSE-APACHE) / <http://www.apache.org/licenses/LICENSE-2.0>)
|
||||
- MIT ([LICENSE-MIT](LICENSE-MIT) / <http://opensource.org/licenses/MIT>)
|
||||
|
||||
## Contribution
|
||||
|
||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
||||
dual licensed as above, without any additional terms or conditions.
|
||||
@ -1,39 +0,0 @@
|
||||
{
|
||||
"name": "@libp2p/example-chat",
|
||||
"version": "0.0.0",
|
||||
"description": "An example chat app using libp2p",
|
||||
"license": "Apache-2.0 OR MIT",
|
||||
"homepage": "https://github.com/libp2p/js-libp2p-example-chat#readme",
|
||||
"repository": {
|
||||
"type": "git",
|
||||
"url": "git+https://github.com/libp2p/js-libp2p-examples.git"
|
||||
},
|
||||
"bugs": {
|
||||
"url": "https://github.com/libp2p/js-libp2p-examples/issues"
|
||||
},
|
||||
"type": "module",
|
||||
"scripts": {
|
||||
"test": "test-node-example test/*"
|
||||
},
|
||||
"dependencies": {
|
||||
"@chainsafe/libp2p-noise": "^16.0.0",
|
||||
"@chainsafe/libp2p-yamux": "^7.0.0",
|
||||
"@libp2p/identify": "^3.0.33",
|
||||
"@libp2p/mdns": "^11.0.1",
|
||||
"@libp2p/ping": "^2.0.33",
|
||||
"@libp2p/tcp": "^10.0.0",
|
||||
"@libp2p/websockets": "^9.0.0",
|
||||
"@multiformats/multiaddr": "^12.3.1",
|
||||
"@nodeutils/defaults-deep": "^1.1.0",
|
||||
"it-length-prefixed": "^10.0.1",
|
||||
"it-map": "^3.0.3",
|
||||
"it-pipe": "^3.0.1",
|
||||
"libp2p": "^2.0.0",
|
||||
"p-defer": "^4.0.0",
|
||||
"uint8arrays": "^5.1.0"
|
||||
},
|
||||
"devDependencies": {
|
||||
"test-ipfs-example": "^1.1.0"
|
||||
},
|
||||
"private": true
|
||||
}
|
||||
@ -1,204 +0,0 @@
|
||||
#!/usr/bin/env node
|
||||
|
||||
import { createLibp2p } from 'libp2p'
|
||||
import { tcp } from '@libp2p/tcp'
|
||||
import { noise } from '@chainsafe/libp2p-noise'
|
||||
import { yamux } from '@chainsafe/libp2p-yamux'
|
||||
import { ping } from '@libp2p/ping'
|
||||
import { identify } from '@libp2p/identify'
|
||||
import { multiaddr } from '@multiformats/multiaddr'
|
||||
|
||||
async function createNode() {
|
||||
return await createLibp2p({
|
||||
addresses: {
|
||||
listen: ['/ip4/0.0.0.0/tcp/0']
|
||||
},
|
||||
transports: [
|
||||
tcp()
|
||||
],
|
||||
connectionEncrypters: [
|
||||
noise()
|
||||
],
|
||||
streamMuxers: [
|
||||
yamux()
|
||||
],
|
||||
services: {
|
||||
// Use ipfs prefix to match py-libp2p example
|
||||
ping: ping({
|
||||
protocolPrefix: 'ipfs',
|
||||
maxInboundStreams: 32,
|
||||
maxOutboundStreams: 64,
|
||||
timeout: 30000
|
||||
}),
|
||||
identify: identify()
|
||||
},
|
||||
connectionManager: {
|
||||
minConnections: 0,
|
||||
maxConnections: 100,
|
||||
dialTimeout: 30000
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
async function runServer() {
|
||||
console.log('🚀 Starting js-libp2p ping server...')
|
||||
|
||||
const node = await createNode()
|
||||
await node.start()
|
||||
|
||||
console.log('✅ Server started!')
|
||||
console.log(`📋 Peer ID: ${node.peerId.toString()}`)
|
||||
console.log('📍 Listening addresses:')
|
||||
|
||||
node.getMultiaddrs().forEach(addr => {
|
||||
console.log(` ${addr.toString()}`)
|
||||
})
|
||||
|
||||
// Listen for connections
|
||||
node.addEventListener('peer:connect', (evt) => {
|
||||
console.log(`🔗 Peer connected: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
node.addEventListener('peer:disconnect', (evt) => {
|
||||
console.log(`❌ Peer disconnected: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
console.log('\n🎧 Server ready for ping requests...')
|
||||
console.log('Press Ctrl+C to exit')
|
||||
|
||||
// Graceful shutdown
|
||||
process.on('SIGINT', async () => {
|
||||
console.log('\n🛑 Shutting down...')
|
||||
await node.stop()
|
||||
process.exit(0)
|
||||
})
|
||||
|
||||
// Keep alive
|
||||
while (true) {
|
||||
await new Promise(resolve => setTimeout(resolve, 1000))
|
||||
}
|
||||
}
|
||||
|
||||
async function runClient(targetAddr, count = 5) {
|
||||
console.log('🚀 Starting js-libp2p ping client...')
|
||||
|
||||
const node = await createNode()
|
||||
await node.start()
|
||||
|
||||
console.log(`📋 Our Peer ID: ${node.peerId.toString()}`)
|
||||
console.log(`🎯 Target: ${targetAddr}`)
|
||||
|
||||
try {
|
||||
const ma = multiaddr(targetAddr)
|
||||
const targetPeerId = ma.getPeerId()
|
||||
|
||||
if (!targetPeerId) {
|
||||
throw new Error('Could not extract peer ID from multiaddr')
|
||||
}
|
||||
|
||||
console.log(`🎯 Target Peer ID: ${targetPeerId}`)
|
||||
console.log('🔗 Connecting to peer...')
|
||||
|
||||
const connection = await node.dial(ma)
|
||||
console.log('✅ Connection established!')
|
||||
console.log(`🔗 Connected to: ${connection.remotePeer.toString()}`)
|
||||
|
||||
// Add a small delay to let the connection fully establish
|
||||
await new Promise(resolve => setTimeout(resolve, 1000))
|
||||
|
||||
const rtts = []
|
||||
|
||||
for (let i = 1; i <= count; i++) {
|
||||
try {
|
||||
console.log(`\n🏓 Sending ping ${i}/${count}...`);
|
||||
console.log('[DEBUG] Attempting to open ping stream with protocol: /ipfs/ping/1.0.0');
|
||||
const start = Date.now()
|
||||
|
||||
const stream = await connection.newStream(['/ipfs/ping/1.0.0']).catch(err => {
|
||||
console.error(`[ERROR] Failed to open ping stream: ${err.message}`);
|
||||
throw err;
|
||||
});
|
||||
console.log('[DEBUG] Ping stream opened successfully');
|
||||
|
||||
const latency = await Promise.race([
|
||||
node.services.ping.ping(connection.remotePeer),
|
||||
new Promise((_, reject) =>
|
||||
setTimeout(() => reject(new Error('Ping timeout')), 30000) // Increased timeout
|
||||
)
|
||||
]).catch(err => {
|
||||
console.error(`[ERROR] Ping ${i} error: ${err.message}`);
|
||||
throw err;
|
||||
});
|
||||
|
||||
const rtt = Date.now() - start;
|
||||
|
||||
rtts.push(latency)
|
||||
console.log(`✅ Ping ${i} successful!`)
|
||||
console.log(` Reported latency: ${latency}ms`)
|
||||
console.log(` Measured RTT: ${rtt}ms`)
|
||||
|
||||
if (i < count) {
|
||||
await new Promise(resolve => setTimeout(resolve, 1000))
|
||||
}
|
||||
} catch (error) {
|
||||
console.error(`❌ Ping ${i} failed:`, error.message)
|
||||
// Try to continue with other pings
|
||||
}
|
||||
}
|
||||
|
||||
// Stats
|
||||
if (rtts.length > 0) {
|
||||
const avg = rtts.reduce((a, b) => a + b, 0) / rtts.length
|
||||
const min = Math.min(...rtts)
|
||||
const max = Math.max(...rtts)
|
||||
|
||||
console.log(`\n📊 Ping Statistics:`)
|
||||
console.log(` Packets: Sent=${count}, Received=${rtts.length}, Lost=${count - rtts.length}`)
|
||||
console.log(` Latency: min=${min}ms, avg=${avg.toFixed(2)}ms, max=${max}ms`)
|
||||
} else {
|
||||
console.log(`\n📊 All pings failed (${count} attempts)`)
|
||||
}
|
||||
|
||||
} catch (error) {
|
||||
console.error('❌ Client error:', error.message)
|
||||
console.error('Stack:', error.stack)
|
||||
process.exit(1)
|
||||
} finally {
|
||||
await node.stop()
|
||||
console.log('\n⏹️ Client stopped')
|
||||
}
|
||||
}
|
||||
|
||||
async function main() {
|
||||
const args = process.argv.slice(2)
|
||||
|
||||
if (args.length === 0) {
|
||||
console.log('Usage:')
|
||||
console.log(' node ping.js server # Start ping server')
|
||||
console.log(' node ping.js client <multiaddr> [count] # Ping a peer')
|
||||
console.log('')
|
||||
console.log('Examples:')
|
||||
console.log(' node ping.js server')
|
||||
console.log(' node ping.js client /ip4/127.0.0.1/tcp/12345/p2p/12D3Ko... 5')
|
||||
process.exit(1)
|
||||
}
|
||||
|
||||
const mode = args[0]
|
||||
|
||||
if (mode === 'server') {
|
||||
await runServer()
|
||||
} else if (mode === 'client') {
|
||||
if (args.length < 2) {
|
||||
console.error('❌ Client mode requires target multiaddr')
|
||||
process.exit(1)
|
||||
}
|
||||
const targetAddr = args[1]
|
||||
const count = parseInt(args[2]) || 5
|
||||
await runClient(targetAddr, count)
|
||||
} else {
|
||||
console.error('❌ Invalid mode. Use "server" or "client"')
|
||||
process.exit(1)
|
||||
}
|
||||
}
|
||||
|
||||
main().catch(console.error)
|
||||
@ -1,241 +0,0 @@
|
||||
#!/usr/bin/env node
|
||||
|
||||
import { createLibp2p } from 'libp2p'
|
||||
import { tcp } from '@libp2p/tcp'
|
||||
import { noise } from '@chainsafe/libp2p-noise'
|
||||
import { yamux } from '@chainsafe/libp2p-yamux'
|
||||
import { ping } from '@libp2p/ping'
|
||||
import { identify } from '@libp2p/identify'
|
||||
import { multiaddr } from '@multiformats/multiaddr'
|
||||
import fs from 'fs'
|
||||
import path from 'path'
|
||||
|
||||
// Create logs directory if it doesn't exist
|
||||
const logsDir = path.join(process.cwd(), '../logs')
|
||||
if (!fs.existsSync(logsDir)) {
|
||||
fs.mkdirSync(logsDir, { recursive: true })
|
||||
}
|
||||
|
||||
// Setup logging
|
||||
const logFile = path.join(logsDir, 'js_ping_client.log')
|
||||
const logStream = fs.createWriteStream(logFile, { flags: 'w' })
|
||||
|
||||
function log(message) {
|
||||
const timestamp = new Date().toISOString()
|
||||
const logLine = `${timestamp} - ${message}\n`
|
||||
logStream.write(logLine)
|
||||
console.log(message)
|
||||
}
|
||||
|
||||
async function createNode() {
|
||||
log('🔧 Creating libp2p node...')
|
||||
|
||||
const node = await createLibp2p({
|
||||
addresses: {
|
||||
listen: ['/ip4/0.0.0.0/tcp/0'] // Random port
|
||||
},
|
||||
transports: [
|
||||
tcp()
|
||||
],
|
||||
connectionEncrypters: [
|
||||
noise()
|
||||
],
|
||||
streamMuxers: [
|
||||
yamux()
|
||||
],
|
||||
services: {
|
||||
ping: ping({
|
||||
protocolPrefix: 'ipfs', // Use ipfs prefix to match py-libp2p
|
||||
maxInboundStreams: 32,
|
||||
maxOutboundStreams: 64,
|
||||
timeout: 30000,
|
||||
runOnTransientConnection: true
|
||||
}),
|
||||
identify: identify()
|
||||
},
|
||||
connectionManager: {
|
||||
minConnections: 0,
|
||||
maxConnections: 100,
|
||||
dialTimeout: 30000,
|
||||
maxParallelDials: 10
|
||||
}
|
||||
})
|
||||
|
||||
log('✅ Node created successfully')
|
||||
return node
|
||||
}
|
||||
|
||||
async function runClient(targetAddr, count = 5) {
|
||||
log('🚀 Starting js-libp2p ping client...')
|
||||
|
||||
const node = await createNode()
|
||||
|
||||
// Add connection event listeners
|
||||
node.addEventListener('peer:connect', (evt) => {
|
||||
log(`🔗 Connected to peer: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
node.addEventListener('peer:disconnect', (evt) => {
|
||||
log(`❌ Disconnected from peer: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
await node.start()
|
||||
log('✅ Node started')
|
||||
|
||||
log(`📋 Our Peer ID: ${node.peerId.toString()}`)
|
||||
log(`🎯 Target: ${targetAddr}`)
|
||||
|
||||
try {
|
||||
const ma = multiaddr(targetAddr)
|
||||
const targetPeerId = ma.getPeerId()
|
||||
|
||||
if (!targetPeerId) {
|
||||
throw new Error('Could not extract peer ID from multiaddr')
|
||||
}
|
||||
|
||||
log(`🎯 Target Peer ID: ${targetPeerId}`)
|
||||
|
||||
// Parse multiaddr components for debugging
|
||||
const components = ma.toString().split('/')
|
||||
log(`📍 Target components: ${components.join(' → ')}`)
|
||||
|
||||
log('🔗 Attempting to dial peer...')
|
||||
const connection = await node.dial(ma)
|
||||
log('✅ Connection established!')
|
||||
log(`🔗 Connected to: ${connection.remotePeer.toString()}`)
|
||||
log(`🔗 Connection status: ${connection.status}`)
|
||||
log(`🔗 Connection direction: ${connection.direction}`)
|
||||
|
||||
// List available protocols
|
||||
if (connection.remoteAddr) {
|
||||
log(`🌐 Remote address: ${connection.remoteAddr.toString()}`)
|
||||
}
|
||||
|
||||
// Wait for connection to stabilize
|
||||
log('⏳ Waiting for connection to stabilize...')
|
||||
await new Promise(resolve => setTimeout(resolve, 2000))
|
||||
|
||||
// Attempt ping sequence
|
||||
log(`\n🏓 Starting ping sequence (${count} pings)...`)
|
||||
const rtts = []
|
||||
|
||||
for (let i = 1; i <= count; i++) {
|
||||
try {
|
||||
log(`\n🏓 Sending ping ${i}/${count}...`)
|
||||
const start = Date.now()
|
||||
|
||||
// Create a more robust ping with better error handling
|
||||
const pingPromise = node.services.ping.ping(connection.remotePeer)
|
||||
const timeoutPromise = new Promise((_, reject) =>
|
||||
setTimeout(() => reject(new Error('Ping timeout (15s)')), 15000)
|
||||
)
|
||||
|
||||
const latency = await Promise.race([pingPromise, timeoutPromise])
|
||||
const totalRtt = Date.now() - start
|
||||
|
||||
rtts.push(latency)
|
||||
log(`✅ Ping ${i} successful!`)
|
||||
log(` Reported latency: ${latency}ms`)
|
||||
log(` Total RTT: ${totalRtt}ms`)
|
||||
|
||||
// Wait between pings
|
||||
if (i < count) {
|
||||
await new Promise(resolve => setTimeout(resolve, 1000))
|
||||
}
|
||||
} catch (error) {
|
||||
log(`❌ Ping ${i} failed: ${error.message}`)
|
||||
log(` Error type: ${error.constructor.name}`)
|
||||
if (error.code) {
|
||||
log(` Error code: ${error.code}`)
|
||||
}
|
||||
|
||||
// Check if connection is still alive
|
||||
if (connection.status !== 'open') {
|
||||
log(`⚠️ Connection status changed to: ${connection.status}`)
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Print statistics
|
||||
if (rtts.length > 0) {
|
||||
const avg = rtts.reduce((a, b) => a + b, 0) / rtts.length
|
||||
const min = Math.min(...rtts)
|
||||
const max = Math.max(...rtts)
|
||||
const lossRate = ((count - rtts.length) / count * 100).toFixed(1)
|
||||
|
||||
log(`\n📊 Ping Statistics:`)
|
||||
log(` Packets: Sent=${count}, Received=${rtts.length}, Lost=${count - rtts.length}`)
|
||||
log(` Loss rate: ${lossRate}%`)
|
||||
log(` Latency: min=${min}ms, avg=${avg.toFixed(2)}ms, max=${max}ms`)
|
||||
} else {
|
||||
log(`\n📊 All pings failed (${count} attempts)`)
|
||||
}
|
||||
|
||||
// Close connection gracefully
|
||||
log('\n🔒 Closing connection...')
|
||||
await connection.close()
|
||||
|
||||
} catch (error) {
|
||||
log(`❌ Client error: ${error.message}`)
|
||||
log(` Error type: ${error.constructor.name}`)
|
||||
if (error.stack) {
|
||||
log(` Stack trace: ${error.stack}`)
|
||||
}
|
||||
process.exit(1)
|
||||
} finally {
|
||||
log('🛑 Stopping node...')
|
||||
await node.stop()
|
||||
log('⏹️ Client stopped')
|
||||
logStream.end()
|
||||
}
|
||||
}
|
||||
|
||||
async function main() {
|
||||
const args = process.argv.slice(2)
|
||||
|
||||
if (args.length === 0) {
|
||||
console.log('Usage:')
|
||||
console.log(' node ping-client.js <target-multiaddr> [count]')
|
||||
console.log('')
|
||||
console.log('Examples:')
|
||||
console.log(' node ping-client.js /ip4/127.0.0.1/tcp/8000/p2p/QmExample... 5')
|
||||
console.log(' node ping-client.js /ip4/127.0.0.1/tcp/8000/p2p/QmExample... 10')
|
||||
process.exit(1)
|
||||
}
|
||||
|
||||
const targetAddr = args[0]
|
||||
const count = parseInt(args[1]) || 5
|
||||
|
||||
if (count <= 0 || count > 100) {
|
||||
console.error('❌ Count must be between 1 and 100')
|
||||
process.exit(1)
|
||||
}
|
||||
|
||||
await runClient(targetAddr, count)
|
||||
}
|
||||
|
||||
// Handle graceful shutdown
|
||||
process.on('SIGINT', () => {
|
||||
log('\n👋 Shutting down...')
|
||||
logStream.end()
|
||||
process.exit(0)
|
||||
})
|
||||
|
||||
process.on('uncaughtException', (error) => {
|
||||
log(`💥 Uncaught exception: ${error.message}`)
|
||||
if (error.stack) {
|
||||
log(`Stack: ${error.stack}`)
|
||||
}
|
||||
logStream.end()
|
||||
process.exit(1)
|
||||
})
|
||||
|
||||
main().catch((error) => {
|
||||
log(`💥 Fatal error: ${error.message}`)
|
||||
if (error.stack) {
|
||||
log(`Stack: ${error.stack}`)
|
||||
}
|
||||
logStream.end()
|
||||
process.exit(1)
|
||||
})
|
||||
@ -1,167 +0,0 @@
|
||||
#!/usr/bin/env node
|
||||
|
||||
import { createLibp2p } from 'libp2p'
|
||||
import { tcp } from '@libp2p/tcp'
|
||||
import { noise } from '@chainsafe/libp2p-noise'
|
||||
import { yamux } from '@chainsafe/libp2p-yamux'
|
||||
import { ping } from '@libp2p/ping'
|
||||
import { identify } from '@libp2p/identify'
|
||||
import fs from 'fs'
|
||||
import path from 'path'
|
||||
|
||||
// Create logs directory if it doesn't exist
|
||||
const logsDir = path.join(process.cwd(), '../logs')
|
||||
if (!fs.existsSync(logsDir)) {
|
||||
fs.mkdirSync(logsDir, { recursive: true })
|
||||
}
|
||||
|
||||
// Setup logging
|
||||
const logFile = path.join(logsDir, 'js_ping_server.log')
|
||||
const logStream = fs.createWriteStream(logFile, { flags: 'w' })
|
||||
|
||||
function log(message) {
|
||||
const timestamp = new Date().toISOString()
|
||||
const logLine = `${timestamp} - ${message}\n`
|
||||
logStream.write(logLine)
|
||||
console.log(message)
|
||||
}
|
||||
|
||||
async function createNode(port) {
|
||||
log('🔧 Creating libp2p node...')
|
||||
|
||||
const node = await createLibp2p({
|
||||
addresses: {
|
||||
listen: [`/ip4/0.0.0.0/tcp/${port}`]
|
||||
},
|
||||
transports: [
|
||||
tcp()
|
||||
],
|
||||
connectionEncrypters: [
|
||||
noise()
|
||||
],
|
||||
streamMuxers: [
|
||||
yamux()
|
||||
],
|
||||
services: {
|
||||
ping: ping({
|
||||
protocolPrefix: 'ipfs', // Use ipfs prefix to match py-libp2p
|
||||
maxInboundStreams: 32,
|
||||
maxOutboundStreams: 64,
|
||||
timeout: 30000,
|
||||
runOnTransientConnection: true
|
||||
}),
|
||||
identify: identify()
|
||||
},
|
||||
connectionManager: {
|
||||
minConnections: 0,
|
||||
maxConnections: 100,
|
||||
dialTimeout: 30000,
|
||||
maxParallelDials: 10
|
||||
}
|
||||
})
|
||||
|
||||
log('✅ Node created successfully')
|
||||
return node
|
||||
}
|
||||
|
||||
async function runServer(port) {
|
||||
log('🚀 Starting js-libp2p ping server...')
|
||||
|
||||
const node = await createNode(port)
|
||||
|
||||
// Add connection event listeners
|
||||
node.addEventListener('peer:connect', (evt) => {
|
||||
log(`🔗 New peer connected: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
node.addEventListener('peer:disconnect', (evt) => {
|
||||
log(`❌ Peer disconnected: ${evt.detail.toString()}`)
|
||||
})
|
||||
|
||||
// Add protocol handler for incoming streams
|
||||
node.addEventListener('peer:identify', (evt) => {
|
||||
log(`🔍 Peer identified: ${evt.detail.peerId.toString()}`)
|
||||
log(` Protocols: ${evt.detail.protocols.join(', ')}`)
|
||||
log(` Listen addresses: ${evt.detail.listenAddrs.map(addr => addr.toString()).join(', ')}`)
|
||||
})
|
||||
|
||||
await node.start()
|
||||
log('✅ Node started')
|
||||
|
||||
const peerId = node.peerId.toString()
|
||||
const listenAddrs = node.getMultiaddrs()
|
||||
|
||||
log(`📋 Peer ID: ${peerId}`)
|
||||
log(`🌐 Listen addresses:`)
|
||||
listenAddrs.forEach(addr => {
|
||||
log(` ${addr.toString()}`)
|
||||
})
|
||||
|
||||
// Find the main TCP address for easy copy-paste
|
||||
const tcpAddr = listenAddrs.find(addr =>
|
||||
addr.toString().includes('/tcp/') &&
|
||||
!addr.toString().includes('/ws')
|
||||
)
|
||||
|
||||
if (tcpAddr) {
|
||||
log(`\n🧪 Test with py-libp2p:`)
|
||||
log(` python ping_client.py ${tcpAddr.toString()}`)
|
||||
log(`\n🧪 Test with js-libp2p:`)
|
||||
log(` node ping-client.js ${tcpAddr.toString()}`)
|
||||
}
|
||||
|
||||
log(`\n🏓 Ping service is running with protocol: /ipfs/ping/1.0.0`)
|
||||
log(`🔐 Security: Noise encryption`)
|
||||
log(`🚇 Muxer: Yamux stream multiplexing`)
|
||||
log(`\n⏳ Waiting for connections...`)
|
||||
log('Press Ctrl+C to exit')
|
||||
|
||||
// Keep the server running
|
||||
return new Promise((resolve, reject) => {
|
||||
process.on('SIGINT', () => {
|
||||
log('\n🛑 Shutting down server...')
|
||||
node.stop().then(() => {
|
||||
log('⏹️ Server stopped')
|
||||
logStream.end()
|
||||
resolve()
|
||||
}).catch(reject)
|
||||
})
|
||||
|
||||
process.on('uncaughtException', (error) => {
|
||||
log(`💥 Uncaught exception: ${error.message}`)
|
||||
if (error.stack) {
|
||||
log(`Stack: ${error.stack}`)
|
||||
}
|
||||
logStream.end()
|
||||
reject(error)
|
||||
})
|
||||
})
|
||||
}
|
||||
|
||||
async function main() {
|
||||
const args = process.argv.slice(2)
|
||||
const port = parseInt(args[0]) || 9000
|
||||
|
||||
if (port <= 0 || port > 65535) {
|
||||
console.error('❌ Port must be between 1 and 65535')
|
||||
process.exit(1)
|
||||
}
|
||||
|
||||
try {
|
||||
await runServer(port)
|
||||
} catch (error) {
|
||||
console.error(`💥 Fatal error: ${error.message}`)
|
||||
if (error.stack) {
|
||||
console.error(`Stack: ${error.stack}`)
|
||||
}
|
||||
process.exit(1)
|
||||
}
|
||||
}
|
||||
|
||||
main().catch((error) => {
|
||||
console.error(`💥 Fatal error: ${error.message}`)
|
||||
if (error.stack) {
|
||||
console.error(`Stack: ${error.stack}`)
|
||||
}
|
||||
process.exit(1)
|
||||
})
|
||||
@ -1,194 +0,0 @@
|
||||
#!/usr/bin/env pwsh
|
||||
|
||||
# run_test.ps1 - libp2p Interoperability Test Runner (PowerShell)
|
||||
# Tests py-libp2p <-> js-libp2p ping communication
|
||||
|
||||
$ErrorActionPreference = "Stop"
|
||||
|
||||
# Colors for output
|
||||
$Red = "`e[31m"
|
||||
$Green = "`e[32m"
|
||||
$Yellow = "`e[33m"
|
||||
$Blue = "`e[34m"
|
||||
$Cyan = "`e[36m"
|
||||
$Reset = "`e[0m"
|
||||
|
||||
function Write-ColorOutput {
|
||||
param([string]$Message, [string]$Color = $Reset)
|
||||
Write-Host "${Color}${Message}${Reset}"
|
||||
}
|
||||
|
||||
Write-ColorOutput "[CHECK] Checking prerequisites..." $Cyan
|
||||
if (-not (Get-Command python -ErrorAction SilentlyContinue)) {
|
||||
Write-ColorOutput "[ERROR] Python not found. Install Python 3.7+" $Red
|
||||
exit 1
|
||||
}
|
||||
if (-not (Get-Command node -ErrorAction SilentlyContinue)) {
|
||||
Write-ColorOutput "[ERROR] Node.js not found. Install Node.js 16+" $Red
|
||||
exit 1
|
||||
}
|
||||
|
||||
Write-ColorOutput "[CHECK] Checking port 8000..." $Blue
|
||||
$portCheck = netstat -a -n -o | findstr :8000
|
||||
if ($portCheck) {
|
||||
Write-ColorOutput "[ERROR] Port 8000 in use. Free the port." $Red
|
||||
Write-ColorOutput $portCheck $Yellow
|
||||
exit 1
|
||||
}
|
||||
|
||||
Write-ColorOutput "[DEBUG] Cleaning up Python processes..." $Blue
|
||||
Get-Process -Name "python" -ErrorAction SilentlyContinue | Where-Object { $_.CommandLine -like "*ping.py*" } | Stop-Process -Force -ErrorAction SilentlyContinue
|
||||
|
||||
Write-ColorOutput "[PYTHON] Starting server on port 8000..." $Yellow
|
||||
Set-Location -Path "py_node"
|
||||
$pyLogFile = "py_server_8000.log"
|
||||
$pyErrLogFile = "py_server_8000.log.err"
|
||||
$pyDebugLogFile = "ping_debug.log"
|
||||
|
||||
if (Test-Path $pyLogFile) { Remove-Item $pyLogFile -Force -ErrorAction SilentlyContinue }
|
||||
if (Test-Path $pyErrLogFile) { Remove-Item $pyErrLogFile -Force -ErrorAction SilentlyContinue }
|
||||
if (Test-Path $pyDebugLogFile) { Remove-Item $pyDebugLogFile -Force -ErrorAction SilentlyContinue }
|
||||
|
||||
$pyProcess = Start-Process -FilePath "python" -ArgumentList "-u", "ping.py", "server", "--port", "8000" -NoNewWindow -PassThru -RedirectStandardOutput $pyLogFile -RedirectStandardError $pyErrLogFile
|
||||
Write-ColorOutput "[DEBUG] Python server PID: $($pyProcess.Id)" $Blue
|
||||
Write-ColorOutput "[DEBUG] Python logs: $((Get-Location).Path)\$pyLogFile, $((Get-Location).Path)\$pyErrLogFile, $((Get-Location).Path)\$pyDebugLogFile" $Blue
|
||||
|
||||
$timeoutSeconds = 20
|
||||
$startTime = Get-Date
|
||||
$serverStarted = $false
|
||||
|
||||
while (((Get-Date) - $startTime).TotalSeconds -lt $timeoutSeconds -and -not $serverStarted) {
|
||||
if (Test-Path $pyLogFile) {
|
||||
$content = Get-Content $pyLogFile -Raw -ErrorAction SilentlyContinue
|
||||
if ($content -match "Server started|Listening") {
|
||||
$serverStarted = $true
|
||||
Write-ColorOutput "[OK] Python server started" $Green
|
||||
}
|
||||
}
|
||||
if (Test-Path $pyErrLogFile) {
|
||||
$errContent = Get-Content $pyErrLogFile -Raw -ErrorAction SilentlyContinue
|
||||
if ($errContent) {
|
||||
Write-ColorOutput "[DEBUG] Error log: $errContent" $Yellow
|
||||
}
|
||||
}
|
||||
Start-Sleep -Milliseconds 500
|
||||
}
|
||||
|
||||
if (-not $serverStarted) {
|
||||
Write-ColorOutput "[ERROR] Python server failed to start" $Red
|
||||
Write-ColorOutput "[DEBUG] Logs:" $Yellow
|
||||
if (Test-Path $pyLogFile) { Get-Content $pyLogFile | Write-ColorOutput -Color $Yellow }
|
||||
if (Test-Path $pyErrLogFile) { Get-Content $pyErrLogFile | Write-ColorOutput -Color $Yellow }
|
||||
if (Test-Path $pyDebugLogFile) { Get-Content $pyDebugLogFile | Write-ColorOutput -Color $Yellow }
|
||||
Write-ColorOutput "[DEBUG] Trying foreground run..." $Yellow
|
||||
python -u ping.py server --port 8000
|
||||
exit 1
|
||||
}
|
||||
|
||||
# Extract Peer ID
|
||||
$peerInfo = $null
|
||||
if (Test-Path $pyLogFile) {
|
||||
$content = Get-Content $pyLogFile -Raw
|
||||
$peerIdPattern = "Peer ID:\s*([A-Za-z0-9]+)"
|
||||
$peerIdMatch = [regex]::Match($content, $peerIdPattern)
|
||||
if ($peerIdMatch.Success) {
|
||||
$peerId = $peerIdMatch.Groups[1].Value
|
||||
$peerInfo = @{
|
||||
PeerId = $peerId
|
||||
MultiAddr = "/ip4/127.0.0.1/tcp/8000/p2p/$peerId"
|
||||
}
|
||||
Write-ColorOutput "[OK] Peer ID: $peerId" $Cyan
|
||||
Write-ColorOutput "[OK] MultiAddr: $($peerInfo.MultiAddr)" $Cyan
|
||||
}
|
||||
}
|
||||
|
||||
if (-not $peerInfo) {
|
||||
Write-ColorOutput "[ERROR] Could not extract Peer ID" $Red
|
||||
if (Test-Path $pyLogFile) { Get-Content $pyLogFile | Write-ColorOutput -Color $Yellow }
|
||||
if (Test-Path $pyErrLogFile) { Get-Content $pyErrLogFile | Write-ColorOutput -Color $Yellow }
|
||||
if (Test-Path $pyDebugLogFile) { Get-Content $pyDebugLogFile | Write-ColorOutput -Color $Yellow }
|
||||
Stop-Process -Id $pyProcess.Id -Force -ErrorAction SilentlyContinue
|
||||
exit 1
|
||||
}
|
||||
|
||||
# Start JavaScript client
|
||||
Write-ColorOutput "[JAVASCRIPT] Starting client..." $Yellow
|
||||
Set-Location -Path "../js_node"
|
||||
$jsLogFile = "test_js_client_to_py_server.log"
|
||||
$jsErrLogFile = "test_js_client_to_py_server.log.err"
|
||||
|
||||
if (Test-Path $jsLogFile) { Remove-Item $jsLogFile -Force -ErrorAction SilentlyContinue }
|
||||
if (Test-Path $jsErrLogFile) { Remove-Item $jsErrLogFile -Force -ErrorAction SilentlyContinue }
|
||||
|
||||
$jsProcess = Start-Process -FilePath "node" -ArgumentList "src/ping.js", "client", $peerInfo.MultiAddr, "3" -NoNewWindow -PassThru -RedirectStandardOutput $jsLogFile -RedirectStandardError $jsErrLogFile
|
||||
Write-ColorOutput "[DEBUG] JavaScript client PID: $($jsProcess.Id)" $Blue
|
||||
Write-ColorOutput "[DEBUG] Client logs: $((Get-Location).Path)\$jsLogFile, $((Get-Location).Path)\$jsErrLogFile" $Blue
|
||||
|
||||
# Wait for client to complete
|
||||
$clientTimeout = 10
|
||||
$clientStart = Get-Date
|
||||
while (-not $jsProcess.HasExited -and (((Get-Date) - $clientStart).TotalSeconds -lt $clientTimeout)) {
|
||||
Start-Sleep -Seconds 1
|
||||
}
|
||||
|
||||
if (-not $jsProcess.HasExited) {
|
||||
Write-ColorOutput "[DEBUG] JavaScript client did not exit, terminating..." $Yellow
|
||||
Stop-Process -Id $jsProcess.Id -Force -ErrorAction SilentlyContinue
|
||||
}
|
||||
|
||||
Write-ColorOutput "[CHECK] Results..." $Cyan
|
||||
$success = $false
|
||||
if (Test-Path $jsLogFile) {
|
||||
$jsLogContent = Get-Content $jsLogFile -Raw -ErrorAction SilentlyContinue
|
||||
if ($jsLogContent -match "successful|Ping.*successful") {
|
||||
$success = $true
|
||||
Write-ColorOutput "[SUCCESS] Ping test passed" $Green
|
||||
} else {
|
||||
Write-ColorOutput "[FAILED] No successful pings" $Red
|
||||
Write-ColorOutput "[DEBUG] Client log path: $((Get-Location).Path)\$jsLogFile" $Yellow
|
||||
Write-ColorOutput "Client log:" $Yellow
|
||||
Write-ColorOutput $jsLogContent $Yellow
|
||||
if (Test-Path $jsErrLogFile) {
|
||||
Write-ColorOutput "[DEBUG] Client error log path: $((Get-Location).Path)\$jsErrLogFile" $Yellow
|
||||
Write-ColorOutput "Client error log:" $Yellow
|
||||
Get-Content $jsErrLogFile | Write-ColorOutput -Color $Yellow
|
||||
}
|
||||
Write-ColorOutput "[DEBUG] Python server log path: $((Get-Location).Path)\..\py_node\$pyLogFile" $Yellow
|
||||
Write-ColorOutput "Python server log:" $Yellow
|
||||
if (Test-Path "../py_node/$pyLogFile") {
|
||||
$pyLogContent = Get-Content "../py_node/$pyLogFile" -Raw -ErrorAction SilentlyContinue
|
||||
if ($pyLogContent) { Write-ColorOutput $pyLogContent $Yellow } else { Write-ColorOutput "Empty or inaccessible" $Yellow }
|
||||
} else {
|
||||
Write-ColorOutput "File not found" $Yellow
|
||||
}
|
||||
Write-ColorOutput "[DEBUG] Python server error log path: $((Get-Location).Path)\..\py_node\$pyErrLogFile" $Yellow
|
||||
Write-ColorOutput "Python server error log:" $Yellow
|
||||
if (Test-Path "../py_node/$pyErrLogFile") {
|
||||
$pyErrLogContent = Get-Content "../py_node/$pyErrLogFile" -Raw -ErrorAction SilentlyContinue
|
||||
if ($pyErrLogContent) { Write-ColorOutput $pyErrLogContent $Yellow } else { Write-ColorOutput "Empty or inaccessible" $Yellow }
|
||||
} else {
|
||||
Write-ColorOutput "File not found" $Yellow
|
||||
}
|
||||
Write-ColorOutput "[DEBUG] Python debug log path: $((Get-Location).Path)\..\py_node\$pyDebugLogFile" $Yellow
|
||||
Write-ColorOutput "Python debug log:" $Yellow
|
||||
if (Test-Path "../py_node/$pyDebugLogFile") {
|
||||
$pyDebugLogContent = Get-Content "../py_node/$pyDebugLogFile" -Raw -ErrorAction SilentlyContinue
|
||||
if ($pyDebugLogContent) { Write-ColorOutput $pyDebugLogContent $Yellow } else { Write-ColorOutput "Empty or inaccessible" $Yellow }
|
||||
} else {
|
||||
Write-ColorOutput "File not found" $Yellow
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Write-ColorOutput "[CLEANUP] Stopping processes..." $Yellow
|
||||
Stop-Process -Id $pyProcess.Id -Force -ErrorAction SilentlyContinue
|
||||
Stop-Process -Id $jsProcess.Id -Force -ErrorAction SilentlyContinue
|
||||
Set-Location -Path "../"
|
||||
|
||||
if ($success) {
|
||||
Write-ColorOutput "[SUCCESS] Test completed" $Green
|
||||
exit 0
|
||||
} else {
|
||||
Write-ColorOutput "[FAILED] Test failed" $Red
|
||||
exit 1
|
||||
}
|
||||
@ -1,215 +0,0 @@
|
||||
#!/usr/bin/env bash
|
||||
|
||||
# run_test.sh - libp2p Interoperability Test Runner (Bash)
|
||||
# Tests py-libp2p <-> js-libp2p ping communication
|
||||
|
||||
set -e
|
||||
|
||||
# Colors for output
|
||||
RED='\033[31m'
|
||||
GREEN='\033[32m'
|
||||
YELLOW='\033[33m'
|
||||
BLUE='\033[34m'
|
||||
CYAN='\033[36m'
|
||||
RESET='\033[0m'
|
||||
|
||||
write_color_output() {
|
||||
local message="$1"
|
||||
local color="${2:-$RESET}"
|
||||
echo -e "${color}${message}${RESET}"
|
||||
}
|
||||
|
||||
write_color_output "[CHECK] Checking prerequisites..." "$CYAN"
|
||||
if ! command -v python3 &> /dev/null && ! command -v python &> /dev/null; then
|
||||
write_color_output "[ERROR] Python not found. Install Python 3.7+" "$RED"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Use python3 if available, otherwise python
|
||||
PYTHON_CMD="python3"
|
||||
if ! command -v python3 &> /dev/null; then
|
||||
PYTHON_CMD="python"
|
||||
fi
|
||||
|
||||
if ! command -v node &> /dev/null; then
|
||||
write_color_output "[ERROR] Node.js not found. Install Node.js 16+" "$RED"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
write_color_output "[CHECK] Checking port 8000..." "$BLUE"
|
||||
if netstat -tuln 2>/dev/null | grep -q ":8000 " || ss -tuln 2>/dev/null | grep -q ":8000 "; then
|
||||
write_color_output "[ERROR] Port 8000 in use. Free the port." "$RED"
|
||||
if command -v netstat &> /dev/null; then
|
||||
netstat -tuln | grep ":8000 " | write_color_output "$(cat)" "$YELLOW"
|
||||
elif command -v ss &> /dev/null; then
|
||||
ss -tuln | grep ":8000 " | write_color_output "$(cat)" "$YELLOW"
|
||||
fi
|
||||
exit 1
|
||||
fi
|
||||
|
||||
write_color_output "[DEBUG] Cleaning up Python processes..." "$BLUE"
|
||||
pkill -f "ping.py" 2>/dev/null || true
|
||||
|
||||
write_color_output "[PYTHON] Starting server on port 8000..." "$YELLOW"
|
||||
cd py_node
|
||||
|
||||
PY_LOG_FILE="py_server_8000.log"
|
||||
PY_ERR_LOG_FILE="py_server_8000.log.err"
|
||||
PY_DEBUG_LOG_FILE="ping_debug.log"
|
||||
|
||||
rm -f "$PY_LOG_FILE" "$PY_ERR_LOG_FILE" "$PY_DEBUG_LOG_FILE"
|
||||
|
||||
$PYTHON_CMD -u ping.py server --port 8000 > "$PY_LOG_FILE" 2> "$PY_ERR_LOG_FILE" &
|
||||
PY_PROCESS_PID=$!
|
||||
|
||||
write_color_output "[DEBUG] Python server PID: $PY_PROCESS_PID" "$BLUE"
|
||||
write_color_output "[DEBUG] Python logs: $(pwd)/$PY_LOG_FILE, $(pwd)/$PY_ERR_LOG_FILE, $(pwd)/$PY_DEBUG_LOG_FILE" "$BLUE"
|
||||
|
||||
TIMEOUT_SECONDS=20
|
||||
START_TIME=$(date +%s)
|
||||
SERVER_STARTED=false
|
||||
|
||||
while [ $(($(date +%s) - START_TIME)) -lt $TIMEOUT_SECONDS ] && [ "$SERVER_STARTED" = false ]; do
|
||||
if [ -f "$PY_LOG_FILE" ]; then
|
||||
if grep -q "Server started\|Listening" "$PY_LOG_FILE" 2>/dev/null; then
|
||||
SERVER_STARTED=true
|
||||
write_color_output "[OK] Python server started" "$GREEN"
|
||||
fi
|
||||
fi
|
||||
if [ -f "$PY_ERR_LOG_FILE" ] && [ -s "$PY_ERR_LOG_FILE" ]; then
|
||||
ERR_CONTENT=$(cat "$PY_ERR_LOG_FILE" 2>/dev/null || true)
|
||||
if [ -n "$ERR_CONTENT" ]; then
|
||||
write_color_output "[DEBUG] Error log: $ERR_CONTENT" "$YELLOW"
|
||||
fi
|
||||
fi
|
||||
sleep 0.5
|
||||
done
|
||||
|
||||
if [ "$SERVER_STARTED" = false ]; then
|
||||
write_color_output "[ERROR] Python server failed to start" "$RED"
|
||||
write_color_output "[DEBUG] Logs:" "$YELLOW"
|
||||
[ -f "$PY_LOG_FILE" ] && cat "$PY_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
[ -f "$PY_ERR_LOG_FILE" ] && cat "$PY_ERR_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
[ -f "$PY_DEBUG_LOG_FILE" ] && cat "$PY_DEBUG_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
write_color_output "[DEBUG] Trying foreground run..." "$YELLOW"
|
||||
$PYTHON_CMD -u ping.py server --port 8000
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Extract Peer ID
|
||||
PEER_ID=""
|
||||
MULTI_ADDR=""
|
||||
if [ -f "$PY_LOG_FILE" ]; then
|
||||
CONTENT=$(cat "$PY_LOG_FILE" 2>/dev/null || true)
|
||||
PEER_ID=$(echo "$CONTENT" | grep -oP "Peer ID:\s*\K[A-Za-z0-9]+" || true)
|
||||
if [ -n "$PEER_ID" ]; then
|
||||
MULTI_ADDR="/ip4/127.0.0.1/tcp/8000/p2p/$PEER_ID"
|
||||
write_color_output "[OK] Peer ID: $PEER_ID" "$CYAN"
|
||||
write_color_output "[OK] MultiAddr: $MULTI_ADDR" "$CYAN"
|
||||
fi
|
||||
fi
|
||||
|
||||
if [ -z "$PEER_ID" ]; then
|
||||
write_color_output "[ERROR] Could not extract Peer ID" "$RED"
|
||||
[ -f "$PY_LOG_FILE" ] && cat "$PY_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
[ -f "$PY_ERR_LOG_FILE" ] && cat "$PY_ERR_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
[ -f "$PY_DEBUG_LOG_FILE" ] && cat "$PY_DEBUG_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
kill $PY_PROCESS_PID 2>/dev/null || true
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Start JavaScript client
|
||||
write_color_output "[JAVASCRIPT] Starting client..." "$YELLOW"
|
||||
cd ../js_node
|
||||
|
||||
JS_LOG_FILE="test_js_client_to_py_server.log"
|
||||
JS_ERR_LOG_FILE="test_js_client_to_py_server.log.err"
|
||||
|
||||
rm -f "$JS_LOG_FILE" "$JS_ERR_LOG_FILE"
|
||||
|
||||
node src/ping.js client "$MULTI_ADDR" 3 > "$JS_LOG_FILE" 2> "$JS_ERR_LOG_FILE" &
|
||||
JS_PROCESS_PID=$!
|
||||
|
||||
write_color_output "[DEBUG] JavaScript client PID: $JS_PROCESS_PID" "$BLUE"
|
||||
write_color_output "[DEBUG] Client logs: $(pwd)/$JS_LOG_FILE, $(pwd)/$JS_ERR_LOG_FILE" "$BLUE"
|
||||
|
||||
# Wait for client to complete
|
||||
CLIENT_TIMEOUT=10
|
||||
CLIENT_START=$(date +%s)
|
||||
while kill -0 $JS_PROCESS_PID 2>/dev/null && [ $(($(date +%s) - CLIENT_START)) -lt $CLIENT_TIMEOUT ]; do
|
||||
sleep 1
|
||||
done
|
||||
|
||||
if kill -0 $JS_PROCESS_PID 2>/dev/null; then
|
||||
write_color_output "[DEBUG] JavaScript client did not exit, terminating..." "$YELLOW"
|
||||
kill $JS_PROCESS_PID 2>/dev/null || true
|
||||
fi
|
||||
|
||||
write_color_output "[CHECK] Results..." "$CYAN"
|
||||
SUCCESS=false
|
||||
if [ -f "$JS_LOG_FILE" ]; then
|
||||
JS_LOG_CONTENT=$(cat "$JS_LOG_FILE" 2>/dev/null || true)
|
||||
if echo "$JS_LOG_CONTENT" | grep -q "successful\|Ping.*successful"; then
|
||||
SUCCESS=true
|
||||
write_color_output "[SUCCESS] Ping test passed" "$GREEN"
|
||||
else
|
||||
write_color_output "[FAILED] No successful pings" "$RED"
|
||||
write_color_output "[DEBUG] Client log path: $(pwd)/$JS_LOG_FILE" "$YELLOW"
|
||||
write_color_output "Client log:" "$YELLOW"
|
||||
write_color_output "$JS_LOG_CONTENT" "$YELLOW"
|
||||
if [ -f "$JS_ERR_LOG_FILE" ]; then
|
||||
write_color_output "[DEBUG] Client error log path: $(pwd)/$JS_ERR_LOG_FILE" "$YELLOW"
|
||||
write_color_output "Client error log:" "$YELLOW"
|
||||
cat "$JS_ERR_LOG_FILE" | while read line; do write_color_output "$line" "$YELLOW"; done
|
||||
fi
|
||||
write_color_output "[DEBUG] Python server log path: $(pwd)/../py_node/$PY_LOG_FILE" "$YELLOW"
|
||||
write_color_output "Python server log:" "$YELLOW"
|
||||
if [ -f "../py_node/$PY_LOG_FILE" ]; then
|
||||
PY_LOG_CONTENT=$(cat "../py_node/$PY_LOG_FILE" 2>/dev/null || true)
|
||||
if [ -n "$PY_LOG_CONTENT" ]; then
|
||||
write_color_output "$PY_LOG_CONTENT" "$YELLOW"
|
||||
else
|
||||
write_color_output "Empty or inaccessible" "$YELLOW"
|
||||
fi
|
||||
else
|
||||
write_color_output "File not found" "$YELLOW"
|
||||
fi
|
||||
write_color_output "[DEBUG] Python server error log path: $(pwd)/../py_node/$PY_ERR_LOG_FILE" "$YELLOW"
|
||||
write_color_output "Python server error log:" "$YELLOW"
|
||||
if [ -f "../py_node/$PY_ERR_LOG_FILE" ]; then
|
||||
PY_ERR_LOG_CONTENT=$(cat "../py_node/$PY_ERR_LOG_FILE" 2>/dev/null || true)
|
||||
if [ -n "$PY_ERR_LOG_CONTENT" ]; then
|
||||
write_color_output "$PY_ERR_LOG_CONTENT" "$YELLOW"
|
||||
else
|
||||
write_color_output "Empty or inaccessible" "$YELLOW"
|
||||
fi
|
||||
else
|
||||
write_color_output "File not found" "$YELLOW"
|
||||
fi
|
||||
write_color_output "[DEBUG] Python debug log path: $(pwd)/../py_node/$PY_DEBUG_LOG_FILE" "$YELLOW"
|
||||
write_color_output "Python debug log:" "$YELLOW"
|
||||
if [ -f "../py_node/$PY_DEBUG_LOG_FILE" ]; then
|
||||
PY_DEBUG_LOG_CONTENT=$(cat "../py_node/$PY_DEBUG_LOG_FILE" 2>/dev/null || true)
|
||||
if [ -n "$PY_DEBUG_LOG_CONTENT" ]; then
|
||||
write_color_output "$PY_DEBUG_LOG_CONTENT" "$YELLOW"
|
||||
else
|
||||
write_color_output "Empty or inaccessible" "$YELLOW"
|
||||
fi
|
||||
else
|
||||
write_color_output "File not found" "$YELLOW"
|
||||
fi
|
||||
fi
|
||||
fi
|
||||
|
||||
write_color_output "[CLEANUP] Stopping processes..." "$YELLOW"
|
||||
kill $PY_PROCESS_PID 2>/dev/null || true
|
||||
kill $JS_PROCESS_PID 2>/dev/null || true
|
||||
cd ../
|
||||
|
||||
if [ "$SUCCESS" = true ]; then
|
||||
write_color_output "[SUCCESS] Test completed" "$GREEN"
|
||||
exit 0
|
||||
else
|
||||
write_color_output "[FAILED] Test failed" "$RED"
|
||||
exit 1
|
||||
fi
|
||||
5
tests/interop/js_libp2p/test_js_basic.py
Normal file
5
tests/interop/js_libp2p/test_js_basic.py
Normal file
@ -0,0 +1,5 @@
|
||||
def test_js_libp2p_placeholder():
|
||||
"""
|
||||
Placeholder test for js-libp2p interop tests.
|
||||
"""
|
||||
assert True, "Placeholder test for js-libp2p interop tests"
|
||||
@ -24,22 +24,16 @@ def make_pubsub_msg(
|
||||
)
|
||||
|
||||
|
||||
# TODO: Implement sparse connect
|
||||
async def dense_connect(hosts: Sequence[IHost]) -> None:
|
||||
await connect_some(hosts, 10)
|
||||
|
||||
|
||||
# FIXME: `degree` is not used at all
|
||||
async def connect_some(hosts: Sequence[IHost], degree: int) -> None:
|
||||
"""
|
||||
Connect each host to up to 'degree' number of other hosts.
|
||||
Creates a sparse network topology where each node has limited connections.
|
||||
"""
|
||||
for i, host in enumerate(hosts):
|
||||
connections_made = 0
|
||||
for j in range(i + 1, len(hosts)):
|
||||
if connections_made >= degree:
|
||||
break
|
||||
await connect(host, hosts[j])
|
||||
connections_made += 1
|
||||
for host2 in hosts[i + 1 :]:
|
||||
await connect(host, host2)
|
||||
|
||||
|
||||
async def one_to_all_connect(hosts: Sequence[IHost], central_host_index: int) -> None:
|
||||
|
||||
@ -1,31 +0,0 @@
|
||||
from unittest.mock import (
|
||||
MagicMock,
|
||||
)
|
||||
|
||||
import trio
|
||||
|
||||
from libp2p.abc import IHost
|
||||
|
||||
|
||||
def create_mock_connections(count: int = 50) -> dict:
|
||||
connections = {}
|
||||
|
||||
for i in range(1, count):
|
||||
peer_id = f"peer-{i}"
|
||||
mock_conn = MagicMock(name=f"INetConn-{i}")
|
||||
connections[peer_id] = mock_conn
|
||||
|
||||
return connections
|
||||
|
||||
|
||||
async def run_host_forever(host: IHost, addr):
|
||||
async with host.run([addr]):
|
||||
await trio.sleep_forever()
|
||||
|
||||
|
||||
async def wait_until_listening(host, timeout=3):
|
||||
with trio.move_on_after(timeout):
|
||||
while not host.get_addrs():
|
||||
await trio.sleep(0.05)
|
||||
return
|
||||
raise RuntimeError("Timed out waiting for host to get an address")
|
||||
Reference in New Issue
Block a user